diff --git a/nginx-nodejs-redis/web/node_modules/.bin/mime b/nginx-nodejs-redis/web/node_modules/.bin/mime
new file mode 120000
index 0000000..fbb7ee0
--- /dev/null
+++ b/nginx-nodejs-redis/web/node_modules/.bin/mime
@@ -0,0 +1 @@
+../mime/cli.js
\ No newline at end of file
diff --git a/nginx-nodejs-redis/web/node_modules/accepts/HISTORY.md b/nginx-nodejs-redis/web/node_modules/accepts/HISTORY.md
new file mode 100644
index 0000000..cb5990c
--- /dev/null
+++ b/nginx-nodejs-redis/web/node_modules/accepts/HISTORY.md
@@ -0,0 +1,243 @@
+1.3.8 / 2022-02-02
+==================
+
+ * deps: mime-types@~2.1.34
+ - deps: mime-db@~1.51.0
+ * deps: negotiator@0.6.3
+
+1.3.7 / 2019-04-29
+==================
+
+ * deps: negotiator@0.6.2
+ - Fix sorting charset, encoding, and language with extra parameters
+
+1.3.6 / 2019-04-28
+==================
+
+ * deps: mime-types@~2.1.24
+ - deps: mime-db@~1.40.0
+
+1.3.5 / 2018-02-28
+==================
+
+ * deps: mime-types@~2.1.18
+ - deps: mime-db@~1.33.0
+
+1.3.4 / 2017-08-22
+==================
+
+ * deps: mime-types@~2.1.16
+ - deps: mime-db@~1.29.0
+
+1.3.3 / 2016-05-02
+==================
+
+ * deps: mime-types@~2.1.11
+ - deps: mime-db@~1.23.0
+ * deps: negotiator@0.6.1
+ - perf: improve `Accept` parsing speed
+ - perf: improve `Accept-Charset` parsing speed
+ - perf: improve `Accept-Encoding` parsing speed
+ - perf: improve `Accept-Language` parsing speed
+
+1.3.2 / 2016-03-08
+==================
+
+ * deps: mime-types@~2.1.10
+ - Fix extension of `application/dash+xml`
+ - Update primary extension for `audio/mp4`
+ - deps: mime-db@~1.22.0
+
+1.3.1 / 2016-01-19
+==================
+
+ * deps: mime-types@~2.1.9
+ - deps: mime-db@~1.21.0
+
+1.3.0 / 2015-09-29
+==================
+
+ * deps: mime-types@~2.1.7
+ - deps: mime-db@~1.19.0
+ * deps: negotiator@0.6.0
+ - Fix including type extensions in parameters in `Accept` parsing
+ - Fix parsing `Accept` parameters with quoted equals
+ - Fix parsing `Accept` parameters with quoted semicolons
+ - Lazy-load modules from main entry point
+ - perf: delay type concatenation until needed
+ - perf: enable strict mode
+ - perf: hoist regular expressions
+ - perf: remove closures getting spec properties
+ - perf: remove a closure from media type parsing
+ - perf: remove property delete from media type parsing
+
+1.2.13 / 2015-09-06
+===================
+
+ * deps: mime-types@~2.1.6
+ - deps: mime-db@~1.18.0
+
+1.2.12 / 2015-07-30
+===================
+
+ * deps: mime-types@~2.1.4
+ - deps: mime-db@~1.16.0
+
+1.2.11 / 2015-07-16
+===================
+
+ * deps: mime-types@~2.1.3
+ - deps: mime-db@~1.15.0
+
+1.2.10 / 2015-07-01
+===================
+
+ * deps: mime-types@~2.1.2
+ - deps: mime-db@~1.14.0
+
+1.2.9 / 2015-06-08
+==================
+
+ * deps: mime-types@~2.1.1
+ - perf: fix deopt during mapping
+
+1.2.8 / 2015-06-07
+==================
+
+ * deps: mime-types@~2.1.0
+ - deps: mime-db@~1.13.0
+ * perf: avoid argument reassignment & argument slice
+ * perf: avoid negotiator recursive construction
+ * perf: enable strict mode
+ * perf: remove unnecessary bitwise operator
+
+1.2.7 / 2015-05-10
+==================
+
+ * deps: negotiator@0.5.3
+ - Fix media type parameter matching to be case-insensitive
+
+1.2.6 / 2015-05-07
+==================
+
+ * deps: mime-types@~2.0.11
+ - deps: mime-db@~1.9.1
+ * deps: negotiator@0.5.2
+ - Fix comparing media types with quoted values
+ - Fix splitting media types with quoted commas
+
+1.2.5 / 2015-03-13
+==================
+
+ * deps: mime-types@~2.0.10
+ - deps: mime-db@~1.8.0
+
+1.2.4 / 2015-02-14
+==================
+
+ * Support Node.js 0.6
+ * deps: mime-types@~2.0.9
+ - deps: mime-db@~1.7.0
+ * deps: negotiator@0.5.1
+ - Fix preference sorting to be stable for long acceptable lists
+
+1.2.3 / 2015-01-31
+==================
+
+ * deps: mime-types@~2.0.8
+ - deps: mime-db@~1.6.0
+
+1.2.2 / 2014-12-30
+==================
+
+ * deps: mime-types@~2.0.7
+ - deps: mime-db@~1.5.0
+
+1.2.1 / 2014-12-30
+==================
+
+ * deps: mime-types@~2.0.5
+ - deps: mime-db@~1.3.1
+
+1.2.0 / 2014-12-19
+==================
+
+ * deps: negotiator@0.5.0
+ - Fix list return order when large accepted list
+ - Fix missing identity encoding when q=0 exists
+ - Remove dynamic building of Negotiator class
+
+1.1.4 / 2014-12-10
+==================
+
+ * deps: mime-types@~2.0.4
+ - deps: mime-db@~1.3.0
+
+1.1.3 / 2014-11-09
+==================
+
+ * deps: mime-types@~2.0.3
+ - deps: mime-db@~1.2.0
+
+1.1.2 / 2014-10-14
+==================
+
+ * deps: negotiator@0.4.9
+ - Fix error when media type has invalid parameter
+
+1.1.1 / 2014-09-28
+==================
+
+ * deps: mime-types@~2.0.2
+ - deps: mime-db@~1.1.0
+ * deps: negotiator@0.4.8
+ - Fix all negotiations to be case-insensitive
+ - Stable sort preferences of same quality according to client order
+
+1.1.0 / 2014-09-02
+==================
+
+ * update `mime-types`
+
+1.0.7 / 2014-07-04
+==================
+
+ * Fix wrong type returned from `type` when match after unknown extension
+
+1.0.6 / 2014-06-24
+==================
+
+ * deps: negotiator@0.4.7
+
+1.0.5 / 2014-06-20
+==================
+
+ * fix crash when unknown extension given
+
+1.0.4 / 2014-06-19
+==================
+
+ * use `mime-types`
+
+1.0.3 / 2014-06-11
+==================
+
+ * deps: negotiator@0.4.6
+ - Order by specificity when quality is the same
+
+1.0.2 / 2014-05-29
+==================
+
+ * Fix interpretation when header not in request
+ * deps: pin negotiator@0.4.5
+
+1.0.1 / 2014-01-18
+==================
+
+ * Identity encoding isn't always acceptable
+ * deps: negotiator@~0.4.0
+
+1.0.0 / 2013-12-27
+==================
+
+ * Genesis
diff --git a/nginx-nodejs-redis/web/node_modules/accepts/LICENSE b/nginx-nodejs-redis/web/node_modules/accepts/LICENSE
new file mode 100644
index 0000000..0616607
--- /dev/null
+++ b/nginx-nodejs-redis/web/node_modules/accepts/LICENSE
@@ -0,0 +1,23 @@
+(The MIT License)
+
+Copyright (c) 2014 Jonathan Ong
+Copyright (c) 2015 Douglas Christopher Wilson
+
+Permission is hereby granted, free of charge, to any person obtaining
+a copy of this software and associated documentation files (the
+'Software'), to deal in the Software without restriction, including
+without limitation the rights to use, copy, modify, merge, publish,
+distribute, sublicense, and/or sell copies of the Software, and to
+permit persons to whom the Software is furnished to do so, subject to
+the following conditions:
+
+The above copyright notice and this permission notice shall be
+included in all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND,
+EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.
+IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY
+CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT,
+TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE
+SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
diff --git a/nginx-nodejs-redis/web/node_modules/accepts/README.md b/nginx-nodejs-redis/web/node_modules/accepts/README.md
new file mode 100644
index 0000000..82680c5
--- /dev/null
+++ b/nginx-nodejs-redis/web/node_modules/accepts/README.md
@@ -0,0 +1,140 @@
+# accepts
+
+[![NPM Version][npm-version-image]][npm-url]
+[![NPM Downloads][npm-downloads-image]][npm-url]
+[![Node.js Version][node-version-image]][node-version-url]
+[![Build Status][github-actions-ci-image]][github-actions-ci-url]
+[![Test Coverage][coveralls-image]][coveralls-url]
+
+Higher level content negotiation based on [negotiator](https://www.npmjs.com/package/negotiator).
+Extracted from [koa](https://www.npmjs.com/package/koa) for general use.
+
+In addition to negotiator, it allows:
+
+- Allows types as an array or arguments list, ie `(['text/html', 'application/json'])`
+ as well as `('text/html', 'application/json')`.
+- Allows type shorthands such as `json`.
+- Returns `false` when no types match
+- Treats non-existent headers as `*`
+
+## Installation
+
+This is a [Node.js](https://nodejs.org/en/) module available through the
+[npm registry](https://www.npmjs.com/). Installation is done using the
+[`npm install` command](https://docs.npmjs.com/getting-started/installing-npm-packages-locally):
+
+```sh
+$ npm install accepts
+```
+
+## API
+
+```js
+var accepts = require('accepts')
+```
+
+### accepts(req)
+
+Create a new `Accepts` object for the given `req`.
+
+#### .charset(charsets)
+
+Return the first accepted charset. If nothing in `charsets` is accepted,
+then `false` is returned.
+
+#### .charsets()
+
+Return the charsets that the request accepts, in the order of the client's
+preference (most preferred first).
+
+#### .encoding(encodings)
+
+Return the first accepted encoding. If nothing in `encodings` is accepted,
+then `false` is returned.
+
+#### .encodings()
+
+Return the encodings that the request accepts, in the order of the client's
+preference (most preferred first).
+
+#### .language(languages)
+
+Return the first accepted language. If nothing in `languages` is accepted,
+then `false` is returned.
+
+#### .languages()
+
+Return the languages that the request accepts, in the order of the client's
+preference (most preferred first).
+
+#### .type(types)
+
+Return the first accepted type (and it is returned as the same text as what
+appears in the `types` array). If nothing in `types` is accepted, then `false`
+is returned.
+
+The `types` array can contain full MIME types or file extensions. Any value
+that is not a full MIME types is passed to `require('mime-types').lookup`.
+
+#### .types()
+
+Return the types that the request accepts, in the order of the client's
+preference (most preferred first).
+
+## Examples
+
+### Simple type negotiation
+
+This simple example shows how to use `accepts` to return a different typed
+respond body based on what the client wants to accept. The server lists it's
+preferences in order and will get back the best match between the client and
+server.
+
+```js
+var accepts = require('accepts')
+var http = require('http')
+
+function app (req, res) {
+ var accept = accepts(req)
+
+ // the order of this list is significant; should be server preferred order
+ switch (accept.type(['json', 'html'])) {
+ case 'json':
+ res.setHeader('Content-Type', 'application/json')
+ res.write('{"hello":"world!"}')
+ break
+ case 'html':
+ res.setHeader('Content-Type', 'text/html')
+ res.write('hello, world!')
+ break
+ default:
+ // the fallback is text/plain, so no need to specify it above
+ res.setHeader('Content-Type', 'text/plain')
+ res.write('hello, world!')
+ break
+ }
+
+ res.end()
+}
+
+http.createServer(app).listen(3000)
+```
+
+You can test this out with the cURL program:
+```sh
+curl -I -H'Accept: text/html' http://localhost:3000/
+```
+
+## License
+
+[MIT](LICENSE)
+
+[coveralls-image]: https://badgen.net/coveralls/c/github/jshttp/accepts/master
+[coveralls-url]: https://coveralls.io/r/jshttp/accepts?branch=master
+[github-actions-ci-image]: https://badgen.net/github/checks/jshttp/accepts/master?label=ci
+[github-actions-ci-url]: https://github.com/jshttp/accepts/actions/workflows/ci.yml
+[node-version-image]: https://badgen.net/npm/node/accepts
+[node-version-url]: https://nodejs.org/en/download
+[npm-downloads-image]: https://badgen.net/npm/dm/accepts
+[npm-url]: https://npmjs.org/package/accepts
+[npm-version-image]: https://badgen.net/npm/v/accepts
diff --git a/nginx-nodejs-redis/web/node_modules/accepts/index.js b/nginx-nodejs-redis/web/node_modules/accepts/index.js
new file mode 100644
index 0000000..e9b2f63
--- /dev/null
+++ b/nginx-nodejs-redis/web/node_modules/accepts/index.js
@@ -0,0 +1,238 @@
+/*!
+ * accepts
+ * Copyright(c) 2014 Jonathan Ong
+ * Copyright(c) 2015 Douglas Christopher Wilson
+ * MIT Licensed
+ */
+
+'use strict'
+
+/**
+ * Module dependencies.
+ * @private
+ */
+
+var Negotiator = require('negotiator')
+var mime = require('mime-types')
+
+/**
+ * Module exports.
+ * @public
+ */
+
+module.exports = Accepts
+
+/**
+ * Create a new Accepts object for the given req.
+ *
+ * @param {object} req
+ * @public
+ */
+
+function Accepts (req) {
+ if (!(this instanceof Accepts)) {
+ return new Accepts(req)
+ }
+
+ this.headers = req.headers
+ this.negotiator = new Negotiator(req)
+}
+
+/**
+ * Check if the given `type(s)` is acceptable, returning
+ * the best match when true, otherwise `undefined`, in which
+ * case you should respond with 406 "Not Acceptable".
+ *
+ * The `type` value may be a single mime type string
+ * such as "application/json", the extension name
+ * such as "json" or an array `["json", "html", "text/plain"]`. When a list
+ * or array is given the _best_ match, if any is returned.
+ *
+ * Examples:
+ *
+ * // Accept: text/html
+ * this.types('html');
+ * // => "html"
+ *
+ * // Accept: text/*, application/json
+ * this.types('html');
+ * // => "html"
+ * this.types('text/html');
+ * // => "text/html"
+ * this.types('json', 'text');
+ * // => "json"
+ * this.types('application/json');
+ * // => "application/json"
+ *
+ * // Accept: text/*, application/json
+ * this.types('image/png');
+ * this.types('png');
+ * // => undefined
+ *
+ * // Accept: text/*;q=.5, application/json
+ * this.types(['html', 'json']);
+ * this.types('html', 'json');
+ * // => "json"
+ *
+ * @param {String|Array} types...
+ * @return {String|Array|Boolean}
+ * @public
+ */
+
+Accepts.prototype.type =
+Accepts.prototype.types = function (types_) {
+ var types = types_
+
+ // support flattened arguments
+ if (types && !Array.isArray(types)) {
+ types = new Array(arguments.length)
+ for (var i = 0; i < types.length; i++) {
+ types[i] = arguments[i]
+ }
+ }
+
+ // no types, return all requested types
+ if (!types || types.length === 0) {
+ return this.negotiator.mediaTypes()
+ }
+
+ // no accept header, return first given type
+ if (!this.headers.accept) {
+ return types[0]
+ }
+
+ var mimes = types.map(extToMime)
+ var accepts = this.negotiator.mediaTypes(mimes.filter(validMime))
+ var first = accepts[0]
+
+ return first
+ ? types[mimes.indexOf(first)]
+ : false
+}
+
+/**
+ * Return accepted encodings or best fit based on `encodings`.
+ *
+ * Given `Accept-Encoding: gzip, deflate`
+ * an array sorted by quality is returned:
+ *
+ * ['gzip', 'deflate']
+ *
+ * @param {String|Array} encodings...
+ * @return {String|Array}
+ * @public
+ */
+
+Accepts.prototype.encoding =
+Accepts.prototype.encodings = function (encodings_) {
+ var encodings = encodings_
+
+ // support flattened arguments
+ if (encodings && !Array.isArray(encodings)) {
+ encodings = new Array(arguments.length)
+ for (var i = 0; i < encodings.length; i++) {
+ encodings[i] = arguments[i]
+ }
+ }
+
+ // no encodings, return all requested encodings
+ if (!encodings || encodings.length === 0) {
+ return this.negotiator.encodings()
+ }
+
+ return this.negotiator.encodings(encodings)[0] || false
+}
+
+/**
+ * Return accepted charsets or best fit based on `charsets`.
+ *
+ * Given `Accept-Charset: utf-8, iso-8859-1;q=0.2, utf-7;q=0.5`
+ * an array sorted by quality is returned:
+ *
+ * ['utf-8', 'utf-7', 'iso-8859-1']
+ *
+ * @param {String|Array} charsets...
+ * @return {String|Array}
+ * @public
+ */
+
+Accepts.prototype.charset =
+Accepts.prototype.charsets = function (charsets_) {
+ var charsets = charsets_
+
+ // support flattened arguments
+ if (charsets && !Array.isArray(charsets)) {
+ charsets = new Array(arguments.length)
+ for (var i = 0; i < charsets.length; i++) {
+ charsets[i] = arguments[i]
+ }
+ }
+
+ // no charsets, return all requested charsets
+ if (!charsets || charsets.length === 0) {
+ return this.negotiator.charsets()
+ }
+
+ return this.negotiator.charsets(charsets)[0] || false
+}
+
+/**
+ * Return accepted languages or best fit based on `langs`.
+ *
+ * Given `Accept-Language: en;q=0.8, es, pt`
+ * an array sorted by quality is returned:
+ *
+ * ['es', 'pt', 'en']
+ *
+ * @param {String|Array} langs...
+ * @return {Array|String}
+ * @public
+ */
+
+Accepts.prototype.lang =
+Accepts.prototype.langs =
+Accepts.prototype.language =
+Accepts.prototype.languages = function (languages_) {
+ var languages = languages_
+
+ // support flattened arguments
+ if (languages && !Array.isArray(languages)) {
+ languages = new Array(arguments.length)
+ for (var i = 0; i < languages.length; i++) {
+ languages[i] = arguments[i]
+ }
+ }
+
+ // no languages, return all requested languages
+ if (!languages || languages.length === 0) {
+ return this.negotiator.languages()
+ }
+
+ return this.negotiator.languages(languages)[0] || false
+}
+
+/**
+ * Convert extnames to mime.
+ *
+ * @param {String} type
+ * @return {String}
+ * @private
+ */
+
+function extToMime (type) {
+ return type.indexOf('/') === -1
+ ? mime.lookup(type)
+ : type
+}
+
+/**
+ * Check if mime is valid.
+ *
+ * @param {String} type
+ * @return {String}
+ * @private
+ */
+
+function validMime (type) {
+ return typeof type === 'string'
+}
diff --git a/nginx-nodejs-redis/web/node_modules/accepts/package.json b/nginx-nodejs-redis/web/node_modules/accepts/package.json
new file mode 100644
index 0000000..476a644
--- /dev/null
+++ b/nginx-nodejs-redis/web/node_modules/accepts/package.json
@@ -0,0 +1,86 @@
+{
+ "_from": "accepts@~1.3.8",
+ "_id": "accepts@1.3.8",
+ "_inBundle": false,
+ "_integrity": "sha512-PYAthTa2m2VKxuvSD3DPC/Gy+U+sOA1LAuT8mkmRuvw+NACSaeXEQ+NHcVF7rONl6qcaxV3Uuemwawk+7+SJLw==",
+ "_location": "/accepts",
+ "_phantomChildren": {},
+ "_requested": {
+ "type": "range",
+ "registry": true,
+ "raw": "accepts@~1.3.8",
+ "name": "accepts",
+ "escapedName": "accepts",
+ "rawSpec": "~1.3.8",
+ "saveSpec": null,
+ "fetchSpec": "~1.3.8"
+ },
+ "_requiredBy": [
+ "/express"
+ ],
+ "_resolved": "https://registry.npmjs.org/accepts/-/accepts-1.3.8.tgz",
+ "_shasum": "0bf0be125b67014adcb0b0921e62db7bffe16b2e",
+ "_spec": "accepts@~1.3.8",
+ "_where": "/Users/ajeetraina/projects/13march/awesome-compose/nginx-nodejs-redis/web/node_modules/express",
+ "bugs": {
+ "url": "https://github.com/jshttp/accepts/issues"
+ },
+ "bundleDependencies": false,
+ "contributors": [
+ {
+ "name": "Douglas Christopher Wilson",
+ "email": "doug@somethingdoug.com"
+ },
+ {
+ "name": "Jonathan Ong",
+ "email": "me@jongleberry.com",
+ "url": "http://jongleberry.com"
+ }
+ ],
+ "dependencies": {
+ "mime-types": "~2.1.34",
+ "negotiator": "0.6.3"
+ },
+ "deprecated": false,
+ "description": "Higher-level content negotiation",
+ "devDependencies": {
+ "deep-equal": "1.0.1",
+ "eslint": "7.32.0",
+ "eslint-config-standard": "14.1.1",
+ "eslint-plugin-import": "2.25.4",
+ "eslint-plugin-markdown": "2.2.1",
+ "eslint-plugin-node": "11.1.0",
+ "eslint-plugin-promise": "4.3.1",
+ "eslint-plugin-standard": "4.1.0",
+ "mocha": "9.2.0",
+ "nyc": "15.1.0"
+ },
+ "engines": {
+ "node": ">= 0.6"
+ },
+ "files": [
+ "LICENSE",
+ "HISTORY.md",
+ "index.js"
+ ],
+ "homepage": "https://github.com/jshttp/accepts#readme",
+ "keywords": [
+ "content",
+ "negotiation",
+ "accept",
+ "accepts"
+ ],
+ "license": "MIT",
+ "name": "accepts",
+ "repository": {
+ "type": "git",
+ "url": "git+https://github.com/jshttp/accepts.git"
+ },
+ "scripts": {
+ "lint": "eslint .",
+ "test": "mocha --reporter spec --check-leaks --bail test/",
+ "test-ci": "nyc --reporter=lcov --reporter=text npm test",
+ "test-cov": "nyc --reporter=html --reporter=text npm test"
+ },
+ "version": "1.3.8"
+}
diff --git a/nginx-nodejs-redis/web/node_modules/array-flatten/LICENSE b/nginx-nodejs-redis/web/node_modules/array-flatten/LICENSE
new file mode 100644
index 0000000..983fbe8
--- /dev/null
+++ b/nginx-nodejs-redis/web/node_modules/array-flatten/LICENSE
@@ -0,0 +1,21 @@
+The MIT License (MIT)
+
+Copyright (c) 2014 Blake Embrey (hello@blakeembrey.com)
+
+Permission is hereby granted, free of charge, to any person obtaining a copy
+of this software and associated documentation files (the "Software"), to deal
+in the Software without restriction, including without limitation the rights
+to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
+copies of the Software, and to permit persons to whom the Software is
+furnished to do so, subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in
+all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
+LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
+OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN
+THE SOFTWARE.
diff --git a/nginx-nodejs-redis/web/node_modules/array-flatten/README.md b/nginx-nodejs-redis/web/node_modules/array-flatten/README.md
new file mode 100644
index 0000000..91fa5b6
--- /dev/null
+++ b/nginx-nodejs-redis/web/node_modules/array-flatten/README.md
@@ -0,0 +1,43 @@
+# Array Flatten
+
+[![NPM version][npm-image]][npm-url]
+[![NPM downloads][downloads-image]][downloads-url]
+[![Build status][travis-image]][travis-url]
+[![Test coverage][coveralls-image]][coveralls-url]
+
+> Flatten an array of nested arrays into a single flat array. Accepts an optional depth.
+
+## Installation
+
+```
+npm install array-flatten --save
+```
+
+## Usage
+
+```javascript
+var flatten = require('array-flatten')
+
+flatten([1, [2, [3, [4, [5], 6], 7], 8], 9])
+//=> [1, 2, 3, 4, 5, 6, 7, 8, 9]
+
+flatten([1, [2, [3, [4, [5], 6], 7], 8], 9], 2)
+//=> [1, 2, 3, [4, [5], 6], 7, 8, 9]
+
+(function () {
+ flatten(arguments) //=> [1, 2, 3]
+})(1, [2, 3])
+```
+
+## License
+
+MIT
+
+[npm-image]: https://img.shields.io/npm/v/array-flatten.svg?style=flat
+[npm-url]: https://npmjs.org/package/array-flatten
+[downloads-image]: https://img.shields.io/npm/dm/array-flatten.svg?style=flat
+[downloads-url]: https://npmjs.org/package/array-flatten
+[travis-image]: https://img.shields.io/travis/blakeembrey/array-flatten.svg?style=flat
+[travis-url]: https://travis-ci.org/blakeembrey/array-flatten
+[coveralls-image]: https://img.shields.io/coveralls/blakeembrey/array-flatten.svg?style=flat
+[coveralls-url]: https://coveralls.io/r/blakeembrey/array-flatten?branch=master
diff --git a/nginx-nodejs-redis/web/node_modules/array-flatten/array-flatten.js b/nginx-nodejs-redis/web/node_modules/array-flatten/array-flatten.js
new file mode 100644
index 0000000..089117b
--- /dev/null
+++ b/nginx-nodejs-redis/web/node_modules/array-flatten/array-flatten.js
@@ -0,0 +1,64 @@
+'use strict'
+
+/**
+ * Expose `arrayFlatten`.
+ */
+module.exports = arrayFlatten
+
+/**
+ * Recursive flatten function with depth.
+ *
+ * @param {Array} array
+ * @param {Array} result
+ * @param {Number} depth
+ * @return {Array}
+ */
+function flattenWithDepth (array, result, depth) {
+ for (var i = 0; i < array.length; i++) {
+ var value = array[i]
+
+ if (depth > 0 && Array.isArray(value)) {
+ flattenWithDepth(value, result, depth - 1)
+ } else {
+ result.push(value)
+ }
+ }
+
+ return result
+}
+
+/**
+ * Recursive flatten function. Omitting depth is slightly faster.
+ *
+ * @param {Array} array
+ * @param {Array} result
+ * @return {Array}
+ */
+function flattenForever (array, result) {
+ for (var i = 0; i < array.length; i++) {
+ var value = array[i]
+
+ if (Array.isArray(value)) {
+ flattenForever(value, result)
+ } else {
+ result.push(value)
+ }
+ }
+
+ return result
+}
+
+/**
+ * Flatten an array, with the ability to define a depth.
+ *
+ * @param {Array} array
+ * @param {Number} depth
+ * @return {Array}
+ */
+function arrayFlatten (array, depth) {
+ if (depth == null) {
+ return flattenForever(array, [])
+ }
+
+ return flattenWithDepth(array, [], depth)
+}
diff --git a/nginx-nodejs-redis/web/node_modules/array-flatten/package.json b/nginx-nodejs-redis/web/node_modules/array-flatten/package.json
new file mode 100644
index 0000000..b5b555e
--- /dev/null
+++ b/nginx-nodejs-redis/web/node_modules/array-flatten/package.json
@@ -0,0 +1,64 @@
+{
+ "_from": "array-flatten@1.1.1",
+ "_id": "array-flatten@1.1.1",
+ "_inBundle": false,
+ "_integrity": "sha1-ml9pkFGx5wczKPKgCJaLZOopVdI=",
+ "_location": "/array-flatten",
+ "_phantomChildren": {},
+ "_requested": {
+ "type": "version",
+ "registry": true,
+ "raw": "array-flatten@1.1.1",
+ "name": "array-flatten",
+ "escapedName": "array-flatten",
+ "rawSpec": "1.1.1",
+ "saveSpec": null,
+ "fetchSpec": "1.1.1"
+ },
+ "_requiredBy": [
+ "/express"
+ ],
+ "_resolved": "https://registry.npmjs.org/array-flatten/-/array-flatten-1.1.1.tgz",
+ "_shasum": "9a5f699051b1e7073328f2a008968b64ea2955d2",
+ "_spec": "array-flatten@1.1.1",
+ "_where": "/Users/ajeetraina/projects/13march/awesome-compose/nginx-nodejs-redis/web/node_modules/express",
+ "author": {
+ "name": "Blake Embrey",
+ "email": "hello@blakeembrey.com",
+ "url": "http://blakeembrey.me"
+ },
+ "bugs": {
+ "url": "https://github.com/blakeembrey/array-flatten/issues"
+ },
+ "bundleDependencies": false,
+ "deprecated": false,
+ "description": "Flatten an array of nested arrays into a single flat array",
+ "devDependencies": {
+ "istanbul": "^0.3.13",
+ "mocha": "^2.2.4",
+ "pre-commit": "^1.0.7",
+ "standard": "^3.7.3"
+ },
+ "files": [
+ "array-flatten.js",
+ "LICENSE"
+ ],
+ "homepage": "https://github.com/blakeembrey/array-flatten",
+ "keywords": [
+ "array",
+ "flatten",
+ "arguments",
+ "depth"
+ ],
+ "license": "MIT",
+ "main": "array-flatten.js",
+ "name": "array-flatten",
+ "repository": {
+ "type": "git",
+ "url": "git://github.com/blakeembrey/array-flatten.git"
+ },
+ "scripts": {
+ "test": "istanbul cover _mocha -- -R spec"
+ },
+ "version": "1.1.1"
+}
diff --git a/nginx-nodejs-redis/web/node_modules/body-parser/HISTORY.md b/nginx-nodejs-redis/web/node_modules/body-parser/HISTORY.md
new file mode 100644
index 0000000..622f40c
--- /dev/null
+++ b/nginx-nodejs-redis/web/node_modules/body-parser/HISTORY.md
@@ -0,0 +1,633 @@
+1.19.2 / 2022-02-15
+===================
+
+ * deps: bytes@3.1.2
+ * deps: qs@6.9.7
+ * Fix handling of `__proto__` keys
+ * deps: raw-body@2.4.3
+ - deps: bytes@3.1.2
+
+1.19.1 / 2021-12-10
+===================
+
+ * deps: bytes@3.1.1
+ * deps: http-errors@1.8.1
+ - deps: inherits@2.0.4
+ - deps: toidentifier@1.0.1
+ - deps: setprototypeof@1.2.0
+ * deps: qs@6.9.6
+ * deps: raw-body@2.4.2
+ - deps: bytes@3.1.1
+ - deps: http-errors@1.8.1
+ * deps: safe-buffer@5.2.1
+ * deps: type-is@~1.6.18
+
+1.19.0 / 2019-04-25
+===================
+
+ * deps: bytes@3.1.0
+ - Add petabyte (`pb`) support
+ * deps: http-errors@1.7.2
+ - Set constructor name when possible
+ - deps: setprototypeof@1.1.1
+ - deps: statuses@'>= 1.5.0 < 2'
+ * deps: iconv-lite@0.4.24
+ - Added encoding MIK
+ * deps: qs@6.7.0
+ - Fix parsing array brackets after index
+ * deps: raw-body@2.4.0
+ - deps: bytes@3.1.0
+ - deps: http-errors@1.7.2
+ - deps: iconv-lite@0.4.24
+ * deps: type-is@~1.6.17
+ - deps: mime-types@~2.1.24
+ - perf: prevent internal `throw` on invalid type
+
+1.18.3 / 2018-05-14
+===================
+
+ * Fix stack trace for strict json parse error
+ * deps: depd@~1.1.2
+ - perf: remove argument reassignment
+ * deps: http-errors@~1.6.3
+ - deps: depd@~1.1.2
+ - deps: setprototypeof@1.1.0
+ - deps: statuses@'>= 1.3.1 < 2'
+ * deps: iconv-lite@0.4.23
+ - Fix loading encoding with year appended
+ - Fix deprecation warnings on Node.js 10+
+ * deps: qs@6.5.2
+ * deps: raw-body@2.3.3
+ - deps: http-errors@1.6.3
+ - deps: iconv-lite@0.4.23
+ * deps: type-is@~1.6.16
+ - deps: mime-types@~2.1.18
+
+1.18.2 / 2017-09-22
+===================
+
+ * deps: debug@2.6.9
+ * perf: remove argument reassignment
+
+1.18.1 / 2017-09-12
+===================
+
+ * deps: content-type@~1.0.4
+ - perf: remove argument reassignment
+ - perf: skip parameter parsing when no parameters
+ * deps: iconv-lite@0.4.19
+ - Fix ISO-8859-1 regression
+ - Update Windows-1255
+ * deps: qs@6.5.1
+ - Fix parsing & compacting very deep objects
+ * deps: raw-body@2.3.2
+ - deps: iconv-lite@0.4.19
+
+1.18.0 / 2017-09-08
+===================
+
+ * Fix JSON strict violation error to match native parse error
+ * Include the `body` property on verify errors
+ * Include the `type` property on all generated errors
+ * Use `http-errors` to set status code on errors
+ * deps: bytes@3.0.0
+ * deps: debug@2.6.8
+ * deps: depd@~1.1.1
+ - Remove unnecessary `Buffer` loading
+ * deps: http-errors@~1.6.2
+ - deps: depd@1.1.1
+ * deps: iconv-lite@0.4.18
+ - Add support for React Native
+ - Add a warning if not loaded as utf-8
+ - Fix CESU-8 decoding in Node.js 8
+ - Improve speed of ISO-8859-1 encoding
+ * deps: qs@6.5.0
+ * deps: raw-body@2.3.1
+ - Use `http-errors` for standard emitted errors
+ - deps: bytes@3.0.0
+ - deps: iconv-lite@0.4.18
+ - perf: skip buffer decoding on overage chunk
+ * perf: prevent internal `throw` when missing charset
+
+1.17.2 / 2017-05-17
+===================
+
+ * deps: debug@2.6.7
+ - Fix `DEBUG_MAX_ARRAY_LENGTH`
+ - deps: ms@2.0.0
+ * deps: type-is@~1.6.15
+ - deps: mime-types@~2.1.15
+
+1.17.1 / 2017-03-06
+===================
+
+ * deps: qs@6.4.0
+ - Fix regression parsing keys starting with `[`
+
+1.17.0 / 2017-03-01
+===================
+
+ * deps: http-errors@~1.6.1
+ - Make `message` property enumerable for `HttpError`s
+ - deps: setprototypeof@1.0.3
+ * deps: qs@6.3.1
+ - Fix compacting nested arrays
+
+1.16.1 / 2017-02-10
+===================
+
+ * deps: debug@2.6.1
+ - Fix deprecation messages in WebStorm and other editors
+ - Undeprecate `DEBUG_FD` set to `1` or `2`
+
+1.16.0 / 2017-01-17
+===================
+
+ * deps: debug@2.6.0
+ - Allow colors in workers
+ - Deprecated `DEBUG_FD` environment variable
+ - Fix error when running under React Native
+ - Use same color for same namespace
+ - deps: ms@0.7.2
+ * deps: http-errors@~1.5.1
+ - deps: inherits@2.0.3
+ - deps: setprototypeof@1.0.2
+ - deps: statuses@'>= 1.3.1 < 2'
+ * deps: iconv-lite@0.4.15
+ - Added encoding MS-31J
+ - Added encoding MS-932
+ - Added encoding MS-936
+ - Added encoding MS-949
+ - Added encoding MS-950
+ - Fix GBK/GB18030 handling of Euro character
+ * deps: qs@6.2.1
+ - Fix array parsing from skipping empty values
+ * deps: raw-body@~2.2.0
+ - deps: iconv-lite@0.4.15
+ * deps: type-is@~1.6.14
+ - deps: mime-types@~2.1.13
+
+1.15.2 / 2016-06-19
+===================
+
+ * deps: bytes@2.4.0
+ * deps: content-type@~1.0.2
+ - perf: enable strict mode
+ * deps: http-errors@~1.5.0
+ - Use `setprototypeof` module to replace `__proto__` setting
+ - deps: statuses@'>= 1.3.0 < 2'
+ - perf: enable strict mode
+ * deps: qs@6.2.0
+ * deps: raw-body@~2.1.7
+ - deps: bytes@2.4.0
+ - perf: remove double-cleanup on happy path
+ * deps: type-is@~1.6.13
+ - deps: mime-types@~2.1.11
+
+1.15.1 / 2016-05-05
+===================
+
+ * deps: bytes@2.3.0
+ - Drop partial bytes on all parsed units
+ - Fix parsing byte string that looks like hex
+ * deps: raw-body@~2.1.6
+ - deps: bytes@2.3.0
+ * deps: type-is@~1.6.12
+ - deps: mime-types@~2.1.10
+
+1.15.0 / 2016-02-10
+===================
+
+ * deps: http-errors@~1.4.0
+ - Add `HttpError` export, for `err instanceof createError.HttpError`
+ - deps: inherits@2.0.1
+ - deps: statuses@'>= 1.2.1 < 2'
+ * deps: qs@6.1.0
+ * deps: type-is@~1.6.11
+ - deps: mime-types@~2.1.9
+
+1.14.2 / 2015-12-16
+===================
+
+ * deps: bytes@2.2.0
+ * deps: iconv-lite@0.4.13
+ * deps: qs@5.2.0
+ * deps: raw-body@~2.1.5
+ - deps: bytes@2.2.0
+ - deps: iconv-lite@0.4.13
+ * deps: type-is@~1.6.10
+ - deps: mime-types@~2.1.8
+
+1.14.1 / 2015-09-27
+===================
+
+ * Fix issue where invalid charset results in 400 when `verify` used
+ * deps: iconv-lite@0.4.12
+ - Fix CESU-8 decoding in Node.js 4.x
+ * deps: raw-body@~2.1.4
+ - Fix masking critical errors from `iconv-lite`
+ - deps: iconv-lite@0.4.12
+ * deps: type-is@~1.6.9
+ - deps: mime-types@~2.1.7
+
+1.14.0 / 2015-09-16
+===================
+
+ * Fix JSON strict parse error to match syntax errors
+ * Provide static `require` analysis in `urlencoded` parser
+ * deps: depd@~1.1.0
+ - Support web browser loading
+ * deps: qs@5.1.0
+ * deps: raw-body@~2.1.3
+ - Fix sync callback when attaching data listener causes sync read
+ * deps: type-is@~1.6.8
+ - Fix type error when given invalid type to match against
+ - deps: mime-types@~2.1.6
+
+1.13.3 / 2015-07-31
+===================
+
+ * deps: type-is@~1.6.6
+ - deps: mime-types@~2.1.4
+
+1.13.2 / 2015-07-05
+===================
+
+ * deps: iconv-lite@0.4.11
+ * deps: qs@4.0.0
+ - Fix dropping parameters like `hasOwnProperty`
+ - Fix user-visible incompatibilities from 3.1.0
+ - Fix various parsing edge cases
+ * deps: raw-body@~2.1.2
+ - Fix error stack traces to skip `makeError`
+ - deps: iconv-lite@0.4.11
+ * deps: type-is@~1.6.4
+ - deps: mime-types@~2.1.2
+ - perf: enable strict mode
+ - perf: remove argument reassignment
+
+1.13.1 / 2015-06-16
+===================
+
+ * deps: qs@2.4.2
+ - Downgraded from 3.1.0 because of user-visible incompatibilities
+
+1.13.0 / 2015-06-14
+===================
+
+ * Add `statusCode` property on `Error`s, in addition to `status`
+ * Change `type` default to `application/json` for JSON parser
+ * Change `type` default to `application/x-www-form-urlencoded` for urlencoded parser
+ * Provide static `require` analysis
+ * Use the `http-errors` module to generate errors
+ * deps: bytes@2.1.0
+ - Slight optimizations
+ * deps: iconv-lite@0.4.10
+ - The encoding UTF-16 without BOM now defaults to UTF-16LE when detection fails
+ - Leading BOM is now removed when decoding
+ * deps: on-finished@~2.3.0
+ - Add defined behavior for HTTP `CONNECT` requests
+ - Add defined behavior for HTTP `Upgrade` requests
+ - deps: ee-first@1.1.1
+ * deps: qs@3.1.0
+ - Fix dropping parameters like `hasOwnProperty`
+ - Fix various parsing edge cases
+ - Parsed object now has `null` prototype
+ * deps: raw-body@~2.1.1
+ - Use `unpipe` module for unpiping requests
+ - deps: iconv-lite@0.4.10
+ * deps: type-is@~1.6.3
+ - deps: mime-types@~2.1.1
+ - perf: reduce try block size
+ - perf: remove bitwise operations
+ * perf: enable strict mode
+ * perf: remove argument reassignment
+ * perf: remove delete call
+
+1.12.4 / 2015-05-10
+===================
+
+ * deps: debug@~2.2.0
+ * deps: qs@2.4.2
+ - Fix allowing parameters like `constructor`
+ * deps: on-finished@~2.2.1
+ * deps: raw-body@~2.0.1
+ - Fix a false-positive when unpiping in Node.js 0.8
+ - deps: bytes@2.0.1
+ * deps: type-is@~1.6.2
+ - deps: mime-types@~2.0.11
+
+1.12.3 / 2015-04-15
+===================
+
+ * Slight efficiency improvement when not debugging
+ * deps: depd@~1.0.1
+ * deps: iconv-lite@0.4.8
+ - Add encoding alias UNICODE-1-1-UTF-7
+ * deps: raw-body@1.3.4
+ - Fix hanging callback if request aborts during read
+ - deps: iconv-lite@0.4.8
+
+1.12.2 / 2015-03-16
+===================
+
+ * deps: qs@2.4.1
+ - Fix error when parameter `hasOwnProperty` is present
+
+1.12.1 / 2015-03-15
+===================
+
+ * deps: debug@~2.1.3
+ - Fix high intensity foreground color for bold
+ - deps: ms@0.7.0
+ * deps: type-is@~1.6.1
+ - deps: mime-types@~2.0.10
+
+1.12.0 / 2015-02-13
+===================
+
+ * add `debug` messages
+ * accept a function for the `type` option
+ * use `content-type` to parse `Content-Type` headers
+ * deps: iconv-lite@0.4.7
+ - Gracefully support enumerables on `Object.prototype`
+ * deps: raw-body@1.3.3
+ - deps: iconv-lite@0.4.7
+ * deps: type-is@~1.6.0
+ - fix argument reassignment
+ - fix false-positives in `hasBody` `Transfer-Encoding` check
+ - support wildcard for both type and subtype (`*/*`)
+ - deps: mime-types@~2.0.9
+
+1.11.0 / 2015-01-30
+===================
+
+ * make internal `extended: true` depth limit infinity
+ * deps: type-is@~1.5.6
+ - deps: mime-types@~2.0.8
+
+1.10.2 / 2015-01-20
+===================
+
+ * deps: iconv-lite@0.4.6
+ - Fix rare aliases of single-byte encodings
+ * deps: raw-body@1.3.2
+ - deps: iconv-lite@0.4.6
+
+1.10.1 / 2015-01-01
+===================
+
+ * deps: on-finished@~2.2.0
+ * deps: type-is@~1.5.5
+ - deps: mime-types@~2.0.7
+
+1.10.0 / 2014-12-02
+===================
+
+ * make internal `extended: true` array limit dynamic
+
+1.9.3 / 2014-11-21
+==================
+
+ * deps: iconv-lite@0.4.5
+ - Fix Windows-31J and X-SJIS encoding support
+ * deps: qs@2.3.3
+ - Fix `arrayLimit` behavior
+ * deps: raw-body@1.3.1
+ - deps: iconv-lite@0.4.5
+ * deps: type-is@~1.5.3
+ - deps: mime-types@~2.0.3
+
+1.9.2 / 2014-10-27
+==================
+
+ * deps: qs@2.3.2
+ - Fix parsing of mixed objects and values
+
+1.9.1 / 2014-10-22
+==================
+
+ * deps: on-finished@~2.1.1
+ - Fix handling of pipelined requests
+ * deps: qs@2.3.0
+ - Fix parsing of mixed implicit and explicit arrays
+ * deps: type-is@~1.5.2
+ - deps: mime-types@~2.0.2
+
+1.9.0 / 2014-09-24
+==================
+
+ * include the charset in "unsupported charset" error message
+ * include the encoding in "unsupported content encoding" error message
+ * deps: depd@~1.0.0
+
+1.8.4 / 2014-09-23
+==================
+
+ * fix content encoding to be case-insensitive
+
+1.8.3 / 2014-09-19
+==================
+
+ * deps: qs@2.2.4
+ - Fix issue with object keys starting with numbers truncated
+
+1.8.2 / 2014-09-15
+==================
+
+ * deps: depd@0.4.5
+
+1.8.1 / 2014-09-07
+==================
+
+ * deps: media-typer@0.3.0
+ * deps: type-is@~1.5.1
+
+1.8.0 / 2014-09-05
+==================
+
+ * make empty-body-handling consistent between chunked requests
+ - empty `json` produces `{}`
+ - empty `raw` produces `new Buffer(0)`
+ - empty `text` produces `''`
+ - empty `urlencoded` produces `{}`
+ * deps: qs@2.2.3
+ - Fix issue where first empty value in array is discarded
+ * deps: type-is@~1.5.0
+ - fix `hasbody` to be true for `content-length: 0`
+
+1.7.0 / 2014-09-01
+==================
+
+ * add `parameterLimit` option to `urlencoded` parser
+ * change `urlencoded` extended array limit to 100
+ * respond with 413 when over `parameterLimit` in `urlencoded`
+
+1.6.7 / 2014-08-29
+==================
+
+ * deps: qs@2.2.2
+ - Remove unnecessary cloning
+
+1.6.6 / 2014-08-27
+==================
+
+ * deps: qs@2.2.0
+ - Array parsing fix
+ - Performance improvements
+
+1.6.5 / 2014-08-16
+==================
+
+ * deps: on-finished@2.1.0
+
+1.6.4 / 2014-08-14
+==================
+
+ * deps: qs@1.2.2
+
+1.6.3 / 2014-08-10
+==================
+
+ * deps: qs@1.2.1
+
+1.6.2 / 2014-08-07
+==================
+
+ * deps: qs@1.2.0
+ - Fix parsing array of objects
+
+1.6.1 / 2014-08-06
+==================
+
+ * deps: qs@1.1.0
+ - Accept urlencoded square brackets
+ - Accept empty values in implicit array notation
+
+1.6.0 / 2014-08-05
+==================
+
+ * deps: qs@1.0.2
+ - Complete rewrite
+ - Limits array length to 20
+ - Limits object depth to 5
+ - Limits parameters to 1,000
+
+1.5.2 / 2014-07-27
+==================
+
+ * deps: depd@0.4.4
+ - Work-around v8 generating empty stack traces
+
+1.5.1 / 2014-07-26
+==================
+
+ * deps: depd@0.4.3
+ - Fix exception when global `Error.stackTraceLimit` is too low
+
+1.5.0 / 2014-07-20
+==================
+
+ * deps: depd@0.4.2
+ - Add `TRACE_DEPRECATION` environment variable
+ - Remove non-standard grey color from color output
+ - Support `--no-deprecation` argument
+ - Support `--trace-deprecation` argument
+ * deps: iconv-lite@0.4.4
+ - Added encoding UTF-7
+ * deps: raw-body@1.3.0
+ - deps: iconv-lite@0.4.4
+ - Added encoding UTF-7
+ - Fix `Cannot switch to old mode now` error on Node.js 0.10+
+ * deps: type-is@~1.3.2
+
+1.4.3 / 2014-06-19
+==================
+
+ * deps: type-is@1.3.1
+ - fix global variable leak
+
+1.4.2 / 2014-06-19
+==================
+
+ * deps: type-is@1.3.0
+ - improve type parsing
+
+1.4.1 / 2014-06-19
+==================
+
+ * fix urlencoded extended deprecation message
+
+1.4.0 / 2014-06-19
+==================
+
+ * add `text` parser
+ * add `raw` parser
+ * check accepted charset in content-type (accepts utf-8)
+ * check accepted encoding in content-encoding (accepts identity)
+ * deprecate `bodyParser()` middleware; use `.json()` and `.urlencoded()` as needed
+ * deprecate `urlencoded()` without provided `extended` option
+ * lazy-load urlencoded parsers
+ * parsers split into files for reduced mem usage
+ * support gzip and deflate bodies
+ - set `inflate: false` to turn off
+ * deps: raw-body@1.2.2
+ - Support all encodings from `iconv-lite`
+
+1.3.1 / 2014-06-11
+==================
+
+ * deps: type-is@1.2.1
+ - Switch dependency from mime to mime-types@1.0.0
+
+1.3.0 / 2014-05-31
+==================
+
+ * add `extended` option to urlencoded parser
+
+1.2.2 / 2014-05-27
+==================
+
+ * deps: raw-body@1.1.6
+ - assert stream encoding on node.js 0.8
+ - assert stream encoding on node.js < 0.10.6
+ - deps: bytes@1
+
+1.2.1 / 2014-05-26
+==================
+
+ * invoke `next(err)` after request fully read
+ - prevents hung responses and socket hang ups
+
+1.2.0 / 2014-05-11
+==================
+
+ * add `verify` option
+ * deps: type-is@1.2.0
+ - support suffix matching
+
+1.1.2 / 2014-05-11
+==================
+
+ * improve json parser speed
+
+1.1.1 / 2014-05-11
+==================
+
+ * fix repeated limit parsing with every request
+
+1.1.0 / 2014-05-10
+==================
+
+ * add `type` option
+ * deps: pin for safety and consistency
+
+1.0.2 / 2014-04-14
+==================
+
+ * use `type-is` module
+
+1.0.1 / 2014-03-20
+==================
+
+ * lower default limits to 100kb
diff --git a/nginx-nodejs-redis/web/node_modules/body-parser/LICENSE b/nginx-nodejs-redis/web/node_modules/body-parser/LICENSE
new file mode 100644
index 0000000..386b7b6
--- /dev/null
+++ b/nginx-nodejs-redis/web/node_modules/body-parser/LICENSE
@@ -0,0 +1,23 @@
+(The MIT License)
+
+Copyright (c) 2014 Jonathan Ong
+Copyright (c) 2014-2015 Douglas Christopher Wilson
+
+Permission is hereby granted, free of charge, to any person obtaining
+a copy of this software and associated documentation files (the
+'Software'), to deal in the Software without restriction, including
+without limitation the rights to use, copy, modify, merge, publish,
+distribute, sublicense, and/or sell copies of the Software, and to
+permit persons to whom the Software is furnished to do so, subject to
+the following conditions:
+
+The above copyright notice and this permission notice shall be
+included in all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND,
+EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.
+IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY
+CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT,
+TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE
+SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
diff --git a/nginx-nodejs-redis/web/node_modules/body-parser/README.md b/nginx-nodejs-redis/web/node_modules/body-parser/README.md
new file mode 100644
index 0000000..7d7fa88
--- /dev/null
+++ b/nginx-nodejs-redis/web/node_modules/body-parser/README.md
@@ -0,0 +1,456 @@
+# body-parser
+
+[![NPM Version][npm-image]][npm-url]
+[![NPM Downloads][downloads-image]][downloads-url]
+[![Build Status][github-actions-ci-image]][github-actions-ci-url]
+[![Test Coverage][coveralls-image]][coveralls-url]
+
+Node.js body parsing middleware.
+
+Parse incoming request bodies in a middleware before your handlers, available
+under the `req.body` property.
+
+**Note** As `req.body`'s shape is based on user-controlled input, all
+properties and values in this object are untrusted and should be validated
+before trusting. For example, `req.body.foo.toString()` may fail in multiple
+ways, for example the `foo` property may not be there or may not be a string,
+and `toString` may not be a function and instead a string or other user input.
+
+[Learn about the anatomy of an HTTP transaction in Node.js](https://nodejs.org/en/docs/guides/anatomy-of-an-http-transaction/).
+
+_This does not handle multipart bodies_, due to their complex and typically
+large nature. For multipart bodies, you may be interested in the following
+modules:
+
+ * [busboy](https://www.npmjs.org/package/busboy#readme) and
+ [connect-busboy](https://www.npmjs.org/package/connect-busboy#readme)
+ * [multiparty](https://www.npmjs.org/package/multiparty#readme) and
+ [connect-multiparty](https://www.npmjs.org/package/connect-multiparty#readme)
+ * [formidable](https://www.npmjs.org/package/formidable#readme)
+ * [multer](https://www.npmjs.org/package/multer#readme)
+
+This module provides the following parsers:
+
+ * [JSON body parser](#bodyparserjsonoptions)
+ * [Raw body parser](#bodyparserrawoptions)
+ * [Text body parser](#bodyparsertextoptions)
+ * [URL-encoded form body parser](#bodyparserurlencodedoptions)
+
+Other body parsers you might be interested in:
+
+- [body](https://www.npmjs.org/package/body#readme)
+- [co-body](https://www.npmjs.org/package/co-body#readme)
+
+## Installation
+
+```sh
+$ npm install body-parser
+```
+
+## API
+
+```js
+var bodyParser = require('body-parser')
+```
+
+The `bodyParser` object exposes various factories to create middlewares. All
+middlewares will populate the `req.body` property with the parsed body when
+the `Content-Type` request header matches the `type` option, or an empty
+object (`{}`) if there was no body to parse, the `Content-Type` was not matched,
+or an error occurred.
+
+The various errors returned by this module are described in the
+[errors section](#errors).
+
+### bodyParser.json([options])
+
+Returns middleware that only parses `json` and only looks at requests where
+the `Content-Type` header matches the `type` option. This parser accepts any
+Unicode encoding of the body and supports automatic inflation of `gzip` and
+`deflate` encodings.
+
+A new `body` object containing the parsed data is populated on the `request`
+object after the middleware (i.e. `req.body`).
+
+#### Options
+
+The `json` function takes an optional `options` object that may contain any of
+the following keys:
+
+##### inflate
+
+When set to `true`, then deflated (compressed) bodies will be inflated; when
+`false`, deflated bodies are rejected. Defaults to `true`.
+
+##### limit
+
+Controls the maximum request body size. If this is a number, then the value
+specifies the number of bytes; if it is a string, the value is passed to the
+[bytes](https://www.npmjs.com/package/bytes) library for parsing. Defaults
+to `'100kb'`.
+
+##### reviver
+
+The `reviver` option is passed directly to `JSON.parse` as the second
+argument. You can find more information on this argument
+[in the MDN documentation about JSON.parse](https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Global_Objects/JSON/parse#Example.3A_Using_the_reviver_parameter).
+
+##### strict
+
+When set to `true`, will only accept arrays and objects; when `false` will
+accept anything `JSON.parse` accepts. Defaults to `true`.
+
+##### type
+
+The `type` option is used to determine what media type the middleware will
+parse. This option can be a string, array of strings, or a function. If not a
+function, `type` option is passed directly to the
+[type-is](https://www.npmjs.org/package/type-is#readme) library and this can
+be an extension name (like `json`), a mime type (like `application/json`), or
+a mime type with a wildcard (like `*/*` or `*/json`). If a function, the `type`
+option is called as `fn(req)` and the request is parsed if it returns a truthy
+value. Defaults to `application/json`.
+
+##### verify
+
+The `verify` option, if supplied, is called as `verify(req, res, buf, encoding)`,
+where `buf` is a `Buffer` of the raw request body and `encoding` is the
+encoding of the request. The parsing can be aborted by throwing an error.
+
+### bodyParser.raw([options])
+
+Returns middleware that parses all bodies as a `Buffer` and only looks at
+requests where the `Content-Type` header matches the `type` option. This
+parser supports automatic inflation of `gzip` and `deflate` encodings.
+
+A new `body` object containing the parsed data is populated on the `request`
+object after the middleware (i.e. `req.body`). This will be a `Buffer` object
+of the body.
+
+#### Options
+
+The `raw` function takes an optional `options` object that may contain any of
+the following keys:
+
+##### inflate
+
+When set to `true`, then deflated (compressed) bodies will be inflated; when
+`false`, deflated bodies are rejected. Defaults to `true`.
+
+##### limit
+
+Controls the maximum request body size. If this is a number, then the value
+specifies the number of bytes; if it is a string, the value is passed to the
+[bytes](https://www.npmjs.com/package/bytes) library for parsing. Defaults
+to `'100kb'`.
+
+##### type
+
+The `type` option is used to determine what media type the middleware will
+parse. This option can be a string, array of strings, or a function.
+If not a function, `type` option is passed directly to the
+[type-is](https://www.npmjs.org/package/type-is#readme) library and this
+can be an extension name (like `bin`), a mime type (like
+`application/octet-stream`), or a mime type with a wildcard (like `*/*` or
+`application/*`). If a function, the `type` option is called as `fn(req)`
+and the request is parsed if it returns a truthy value. Defaults to
+`application/octet-stream`.
+
+##### verify
+
+The `verify` option, if supplied, is called as `verify(req, res, buf, encoding)`,
+where `buf` is a `Buffer` of the raw request body and `encoding` is the
+encoding of the request. The parsing can be aborted by throwing an error.
+
+### bodyParser.text([options])
+
+Returns middleware that parses all bodies as a string and only looks at
+requests where the `Content-Type` header matches the `type` option. This
+parser supports automatic inflation of `gzip` and `deflate` encodings.
+
+A new `body` string containing the parsed data is populated on the `request`
+object after the middleware (i.e. `req.body`). This will be a string of the
+body.
+
+#### Options
+
+The `text` function takes an optional `options` object that may contain any of
+the following keys:
+
+##### defaultCharset
+
+Specify the default character set for the text content if the charset is not
+specified in the `Content-Type` header of the request. Defaults to `utf-8`.
+
+##### inflate
+
+When set to `true`, then deflated (compressed) bodies will be inflated; when
+`false`, deflated bodies are rejected. Defaults to `true`.
+
+##### limit
+
+Controls the maximum request body size. If this is a number, then the value
+specifies the number of bytes; if it is a string, the value is passed to the
+[bytes](https://www.npmjs.com/package/bytes) library for parsing. Defaults
+to `'100kb'`.
+
+##### type
+
+The `type` option is used to determine what media type the middleware will
+parse. This option can be a string, array of strings, or a function. If not
+a function, `type` option is passed directly to the
+[type-is](https://www.npmjs.org/package/type-is#readme) library and this can
+be an extension name (like `txt`), a mime type (like `text/plain`), or a mime
+type with a wildcard (like `*/*` or `text/*`). If a function, the `type`
+option is called as `fn(req)` and the request is parsed if it returns a
+truthy value. Defaults to `text/plain`.
+
+##### verify
+
+The `verify` option, if supplied, is called as `verify(req, res, buf, encoding)`,
+where `buf` is a `Buffer` of the raw request body and `encoding` is the
+encoding of the request. The parsing can be aborted by throwing an error.
+
+### bodyParser.urlencoded([options])
+
+Returns middleware that only parses `urlencoded` bodies and only looks at
+requests where the `Content-Type` header matches the `type` option. This
+parser accepts only UTF-8 encoding of the body and supports automatic
+inflation of `gzip` and `deflate` encodings.
+
+A new `body` object containing the parsed data is populated on the `request`
+object after the middleware (i.e. `req.body`). This object will contain
+key-value pairs, where the value can be a string or array (when `extended` is
+`false`), or any type (when `extended` is `true`).
+
+#### Options
+
+The `urlencoded` function takes an optional `options` object that may contain
+any of the following keys:
+
+##### extended
+
+The `extended` option allows to choose between parsing the URL-encoded data
+with the `querystring` library (when `false`) or the `qs` library (when
+`true`). The "extended" syntax allows for rich objects and arrays to be
+encoded into the URL-encoded format, allowing for a JSON-like experience
+with URL-encoded. For more information, please
+[see the qs library](https://www.npmjs.org/package/qs#readme).
+
+Defaults to `true`, but using the default has been deprecated. Please
+research into the difference between `qs` and `querystring` and choose the
+appropriate setting.
+
+##### inflate
+
+When set to `true`, then deflated (compressed) bodies will be inflated; when
+`false`, deflated bodies are rejected. Defaults to `true`.
+
+##### limit
+
+Controls the maximum request body size. If this is a number, then the value
+specifies the number of bytes; if it is a string, the value is passed to the
+[bytes](https://www.npmjs.com/package/bytes) library for parsing. Defaults
+to `'100kb'`.
+
+##### parameterLimit
+
+The `parameterLimit` option controls the maximum number of parameters that
+are allowed in the URL-encoded data. If a request contains more parameters
+than this value, a 413 will be returned to the client. Defaults to `1000`.
+
+##### type
+
+The `type` option is used to determine what media type the middleware will
+parse. This option can be a string, array of strings, or a function. If not
+a function, `type` option is passed directly to the
+[type-is](https://www.npmjs.org/package/type-is#readme) library and this can
+be an extension name (like `urlencoded`), a mime type (like
+`application/x-www-form-urlencoded`), or a mime type with a wildcard (like
+`*/x-www-form-urlencoded`). If a function, the `type` option is called as
+`fn(req)` and the request is parsed if it returns a truthy value. Defaults
+to `application/x-www-form-urlencoded`.
+
+##### verify
+
+The `verify` option, if supplied, is called as `verify(req, res, buf, encoding)`,
+where `buf` is a `Buffer` of the raw request body and `encoding` is the
+encoding of the request. The parsing can be aborted by throwing an error.
+
+## Errors
+
+The middlewares provided by this module create errors using the
+[`http-errors` module](https://www.npmjs.com/package/http-errors). The errors
+will typically have a `status`/`statusCode` property that contains the suggested
+HTTP response code, an `expose` property to determine if the `message` property
+should be displayed to the client, a `type` property to determine the type of
+error without matching against the `message`, and a `body` property containing
+the read body, if available.
+
+The following are the common errors created, though any error can come through
+for various reasons.
+
+### content encoding unsupported
+
+This error will occur when the request had a `Content-Encoding` header that
+contained an encoding but the "inflation" option was set to `false`. The
+`status` property is set to `415`, the `type` property is set to
+`'encoding.unsupported'`, and the `charset` property will be set to the
+encoding that is unsupported.
+
+### entity parse failed
+
+This error will occur when the request contained an entity that could not be
+parsed by the middleware. The `status` property is set to `400`, the `type`
+property is set to `'entity.parse.failed'`, and the `body` property is set to
+the entity value that failed parsing.
+
+### entity verify failed
+
+This error will occur when the request contained an entity that could not be
+failed verification by the defined `verify` option. The `status` property is
+set to `403`, the `type` property is set to `'entity.verify.failed'`, and the
+`body` property is set to the entity value that failed verification.
+
+### request aborted
+
+This error will occur when the request is aborted by the client before reading
+the body has finished. The `received` property will be set to the number of
+bytes received before the request was aborted and the `expected` property is
+set to the number of expected bytes. The `status` property is set to `400`
+and `type` property is set to `'request.aborted'`.
+
+### request entity too large
+
+This error will occur when the request body's size is larger than the "limit"
+option. The `limit` property will be set to the byte limit and the `length`
+property will be set to the request body's length. The `status` property is
+set to `413` and the `type` property is set to `'entity.too.large'`.
+
+### request size did not match content length
+
+This error will occur when the request's length did not match the length from
+the `Content-Length` header. This typically occurs when the request is malformed,
+typically when the `Content-Length` header was calculated based on characters
+instead of bytes. The `status` property is set to `400` and the `type` property
+is set to `'request.size.invalid'`.
+
+### stream encoding should not be set
+
+This error will occur when something called the `req.setEncoding` method prior
+to this middleware. This module operates directly on bytes only and you cannot
+call `req.setEncoding` when using this module. The `status` property is set to
+`500` and the `type` property is set to `'stream.encoding.set'`.
+
+### too many parameters
+
+This error will occur when the content of the request exceeds the configured
+`parameterLimit` for the `urlencoded` parser. The `status` property is set to
+`413` and the `type` property is set to `'parameters.too.many'`.
+
+### unsupported charset "BOGUS"
+
+This error will occur when the request had a charset parameter in the
+`Content-Type` header, but the `iconv-lite` module does not support it OR the
+parser does not support it. The charset is contained in the message as well
+as in the `charset` property. The `status` property is set to `415`, the
+`type` property is set to `'charset.unsupported'`, and the `charset` property
+is set to the charset that is unsupported.
+
+### unsupported content encoding "bogus"
+
+This error will occur when the request had a `Content-Encoding` header that
+contained an unsupported encoding. The encoding is contained in the message
+as well as in the `encoding` property. The `status` property is set to `415`,
+the `type` property is set to `'encoding.unsupported'`, and the `encoding`
+property is set to the encoding that is unsupported.
+
+## Examples
+
+### Express/Connect top-level generic
+
+This example demonstrates adding a generic JSON and URL-encoded parser as a
+top-level middleware, which will parse the bodies of all incoming requests.
+This is the simplest setup.
+
+```js
+var express = require('express')
+var bodyParser = require('body-parser')
+
+var app = express()
+
+// parse application/x-www-form-urlencoded
+app.use(bodyParser.urlencoded({ extended: false }))
+
+// parse application/json
+app.use(bodyParser.json())
+
+app.use(function (req, res) {
+ res.setHeader('Content-Type', 'text/plain')
+ res.write('you posted:\n')
+ res.end(JSON.stringify(req.body, null, 2))
+})
+```
+
+### Express route-specific
+
+This example demonstrates adding body parsers specifically to the routes that
+need them. In general, this is the most recommended way to use body-parser with
+Express.
+
+```js
+var express = require('express')
+var bodyParser = require('body-parser')
+
+var app = express()
+
+// create application/json parser
+var jsonParser = bodyParser.json()
+
+// create application/x-www-form-urlencoded parser
+var urlencodedParser = bodyParser.urlencoded({ extended: false })
+
+// POST /login gets urlencoded bodies
+app.post('/login', urlencodedParser, function (req, res) {
+ res.send('welcome, ' + req.body.username)
+})
+
+// POST /api/users gets JSON bodies
+app.post('/api/users', jsonParser, function (req, res) {
+ // create user in req.body
+})
+```
+
+### Change accepted type for parsers
+
+All the parsers accept a `type` option which allows you to change the
+`Content-Type` that the middleware will parse.
+
+```js
+var express = require('express')
+var bodyParser = require('body-parser')
+
+var app = express()
+
+// parse various different custom JSON types as JSON
+app.use(bodyParser.json({ type: 'application/*+json' }))
+
+// parse some custom thing into a Buffer
+app.use(bodyParser.raw({ type: 'application/vnd.custom-type' }))
+
+// parse an HTML body into a string
+app.use(bodyParser.text({ type: 'text/html' }))
+```
+
+## License
+
+[MIT](LICENSE)
+
+[npm-image]: https://img.shields.io/npm/v/body-parser.svg
+[npm-url]: https://npmjs.org/package/body-parser
+[coveralls-image]: https://img.shields.io/coveralls/expressjs/body-parser/master.svg
+[coveralls-url]: https://coveralls.io/r/expressjs/body-parser?branch=master
+[downloads-image]: https://img.shields.io/npm/dm/body-parser.svg
+[downloads-url]: https://npmjs.org/package/body-parser
+[github-actions-ci-image]: https://img.shields.io/github/workflow/status/expressjs/body-parser/ci/master?label=ci
+[github-actions-ci-url]: https://github.com/expressjs/body-parser?query=workflow%3Aci
diff --git a/nginx-nodejs-redis/web/node_modules/body-parser/index.js b/nginx-nodejs-redis/web/node_modules/body-parser/index.js
new file mode 100644
index 0000000..93c3a1f
--- /dev/null
+++ b/nginx-nodejs-redis/web/node_modules/body-parser/index.js
@@ -0,0 +1,157 @@
+/*!
+ * body-parser
+ * Copyright(c) 2014-2015 Douglas Christopher Wilson
+ * MIT Licensed
+ */
+
+'use strict'
+
+/**
+ * Module dependencies.
+ * @private
+ */
+
+var deprecate = require('depd')('body-parser')
+
+/**
+ * Cache of loaded parsers.
+ * @private
+ */
+
+var parsers = Object.create(null)
+
+/**
+ * @typedef Parsers
+ * @type {function}
+ * @property {function} json
+ * @property {function} raw
+ * @property {function} text
+ * @property {function} urlencoded
+ */
+
+/**
+ * Module exports.
+ * @type {Parsers}
+ */
+
+exports = module.exports = deprecate.function(bodyParser,
+ 'bodyParser: use individual json/urlencoded middlewares')
+
+/**
+ * JSON parser.
+ * @public
+ */
+
+Object.defineProperty(exports, 'json', {
+ configurable: true,
+ enumerable: true,
+ get: createParserGetter('json')
+})
+
+/**
+ * Raw parser.
+ * @public
+ */
+
+Object.defineProperty(exports, 'raw', {
+ configurable: true,
+ enumerable: true,
+ get: createParserGetter('raw')
+})
+
+/**
+ * Text parser.
+ * @public
+ */
+
+Object.defineProperty(exports, 'text', {
+ configurable: true,
+ enumerable: true,
+ get: createParserGetter('text')
+})
+
+/**
+ * URL-encoded parser.
+ * @public
+ */
+
+Object.defineProperty(exports, 'urlencoded', {
+ configurable: true,
+ enumerable: true,
+ get: createParserGetter('urlencoded')
+})
+
+/**
+ * Create a middleware to parse json and urlencoded bodies.
+ *
+ * @param {object} [options]
+ * @return {function}
+ * @deprecated
+ * @public
+ */
+
+function bodyParser (options) {
+ var opts = {}
+
+ // exclude type option
+ if (options) {
+ for (var prop in options) {
+ if (prop !== 'type') {
+ opts[prop] = options[prop]
+ }
+ }
+ }
+
+ var _urlencoded = exports.urlencoded(opts)
+ var _json = exports.json(opts)
+
+ return function bodyParser (req, res, next) {
+ _json(req, res, function (err) {
+ if (err) return next(err)
+ _urlencoded(req, res, next)
+ })
+ }
+}
+
+/**
+ * Create a getter for loading a parser.
+ * @private
+ */
+
+function createParserGetter (name) {
+ return function get () {
+ return loadParser(name)
+ }
+}
+
+/**
+ * Load a parser module.
+ * @private
+ */
+
+function loadParser (parserName) {
+ var parser = parsers[parserName]
+
+ if (parser !== undefined) {
+ return parser
+ }
+
+ // this uses a switch for static require analysis
+ switch (parserName) {
+ case 'json':
+ parser = require('./lib/types/json')
+ break
+ case 'raw':
+ parser = require('./lib/types/raw')
+ break
+ case 'text':
+ parser = require('./lib/types/text')
+ break
+ case 'urlencoded':
+ parser = require('./lib/types/urlencoded')
+ break
+ }
+
+ // store to prevent invoking require()
+ return (parsers[parserName] = parser)
+}
diff --git a/nginx-nodejs-redis/web/node_modules/body-parser/lib/read.js b/nginx-nodejs-redis/web/node_modules/body-parser/lib/read.js
new file mode 100644
index 0000000..c102609
--- /dev/null
+++ b/nginx-nodejs-redis/web/node_modules/body-parser/lib/read.js
@@ -0,0 +1,181 @@
+/*!
+ * body-parser
+ * Copyright(c) 2014-2015 Douglas Christopher Wilson
+ * MIT Licensed
+ */
+
+'use strict'
+
+/**
+ * Module dependencies.
+ * @private
+ */
+
+var createError = require('http-errors')
+var getBody = require('raw-body')
+var iconv = require('iconv-lite')
+var onFinished = require('on-finished')
+var zlib = require('zlib')
+
+/**
+ * Module exports.
+ */
+
+module.exports = read
+
+/**
+ * Read a request into a buffer and parse.
+ *
+ * @param {object} req
+ * @param {object} res
+ * @param {function} next
+ * @param {function} parse
+ * @param {function} debug
+ * @param {object} options
+ * @private
+ */
+
+function read (req, res, next, parse, debug, options) {
+ var length
+ var opts = options
+ var stream
+
+ // flag as parsed
+ req._body = true
+
+ // read options
+ var encoding = opts.encoding !== null
+ ? opts.encoding
+ : null
+ var verify = opts.verify
+
+ try {
+ // get the content stream
+ stream = contentstream(req, debug, opts.inflate)
+ length = stream.length
+ stream.length = undefined
+ } catch (err) {
+ return next(err)
+ }
+
+ // set raw-body options
+ opts.length = length
+ opts.encoding = verify
+ ? null
+ : encoding
+
+ // assert charset is supported
+ if (opts.encoding === null && encoding !== null && !iconv.encodingExists(encoding)) {
+ return next(createError(415, 'unsupported charset "' + encoding.toUpperCase() + '"', {
+ charset: encoding.toLowerCase(),
+ type: 'charset.unsupported'
+ }))
+ }
+
+ // read body
+ debug('read body')
+ getBody(stream, opts, function (error, body) {
+ if (error) {
+ var _error
+
+ if (error.type === 'encoding.unsupported') {
+ // echo back charset
+ _error = createError(415, 'unsupported charset "' + encoding.toUpperCase() + '"', {
+ charset: encoding.toLowerCase(),
+ type: 'charset.unsupported'
+ })
+ } else {
+ // set status code on error
+ _error = createError(400, error)
+ }
+
+ // read off entire request
+ stream.resume()
+ onFinished(req, function onfinished () {
+ next(createError(400, _error))
+ })
+ return
+ }
+
+ // verify
+ if (verify) {
+ try {
+ debug('verify body')
+ verify(req, res, body, encoding)
+ } catch (err) {
+ next(createError(403, err, {
+ body: body,
+ type: err.type || 'entity.verify.failed'
+ }))
+ return
+ }
+ }
+
+ // parse
+ var str = body
+ try {
+ debug('parse body')
+ str = typeof body !== 'string' && encoding !== null
+ ? iconv.decode(body, encoding)
+ : body
+ req.body = parse(str)
+ } catch (err) {
+ next(createError(400, err, {
+ body: str,
+ type: err.type || 'entity.parse.failed'
+ }))
+ return
+ }
+
+ next()
+ })
+}
+
+/**
+ * Get the content stream of the request.
+ *
+ * @param {object} req
+ * @param {function} debug
+ * @param {boolean} [inflate=true]
+ * @return {object}
+ * @api private
+ */
+
+function contentstream (req, debug, inflate) {
+ var encoding = (req.headers['content-encoding'] || 'identity').toLowerCase()
+ var length = req.headers['content-length']
+ var stream
+
+ debug('content-encoding "%s"', encoding)
+
+ if (inflate === false && encoding !== 'identity') {
+ throw createError(415, 'content encoding unsupported', {
+ encoding: encoding,
+ type: 'encoding.unsupported'
+ })
+ }
+
+ switch (encoding) {
+ case 'deflate':
+ stream = zlib.createInflate()
+ debug('inflate body')
+ req.pipe(stream)
+ break
+ case 'gzip':
+ stream = zlib.createGunzip()
+ debug('gunzip body')
+ req.pipe(stream)
+ break
+ case 'identity':
+ stream = req
+ stream.length = length
+ break
+ default:
+ throw createError(415, 'unsupported content encoding "' + encoding + '"', {
+ encoding: encoding,
+ type: 'encoding.unsupported'
+ })
+ }
+
+ return stream
+}
diff --git a/nginx-nodejs-redis/web/node_modules/body-parser/lib/types/json.js b/nginx-nodejs-redis/web/node_modules/body-parser/lib/types/json.js
new file mode 100644
index 0000000..2971dc1
--- /dev/null
+++ b/nginx-nodejs-redis/web/node_modules/body-parser/lib/types/json.js
@@ -0,0 +1,230 @@
+/*!
+ * body-parser
+ * Copyright(c) 2014 Jonathan Ong
+ * Copyright(c) 2014-2015 Douglas Christopher Wilson
+ * MIT Licensed
+ */
+
+'use strict'
+
+/**
+ * Module dependencies.
+ * @private
+ */
+
+var bytes = require('bytes')
+var contentType = require('content-type')
+var createError = require('http-errors')
+var debug = require('debug')('body-parser:json')
+var read = require('../read')
+var typeis = require('type-is')
+
+/**
+ * Module exports.
+ */
+
+module.exports = json
+
+/**
+ * RegExp to match the first non-space in a string.
+ *
+ * Allowed whitespace is defined in RFC 7159:
+ *
+ * ws = *(
+ * %x20 / ; Space
+ * %x09 / ; Horizontal tab
+ * %x0A / ; Line feed or New line
+ * %x0D ) ; Carriage return
+ */
+
+var FIRST_CHAR_REGEXP = /^[\x20\x09\x0a\x0d]*(.)/ // eslint-disable-line no-control-regex
+
+/**
+ * Create a middleware to parse JSON bodies.
+ *
+ * @param {object} [options]
+ * @return {function}
+ * @public
+ */
+
+function json (options) {
+ var opts = options || {}
+
+ var limit = typeof opts.limit !== 'number'
+ ? bytes.parse(opts.limit || '100kb')
+ : opts.limit
+ var inflate = opts.inflate !== false
+ var reviver = opts.reviver
+ var strict = opts.strict !== false
+ var type = opts.type || 'application/json'
+ var verify = opts.verify || false
+
+ if (verify !== false && typeof verify !== 'function') {
+ throw new TypeError('option verify must be function')
+ }
+
+ // create the appropriate type checking function
+ var shouldParse = typeof type !== 'function'
+ ? typeChecker(type)
+ : type
+
+ function parse (body) {
+ if (body.length === 0) {
+ // special-case empty json body, as it's a common client-side mistake
+ // TODO: maybe make this configurable or part of "strict" option
+ return {}
+ }
+
+ if (strict) {
+ var first = firstchar(body)
+
+ if (first !== '{' && first !== '[') {
+ debug('strict violation')
+ throw createStrictSyntaxError(body, first)
+ }
+ }
+
+ try {
+ debug('parse json')
+ return JSON.parse(body, reviver)
+ } catch (e) {
+ throw normalizeJsonSyntaxError(e, {
+ message: e.message,
+ stack: e.stack
+ })
+ }
+ }
+
+ return function jsonParser (req, res, next) {
+ if (req._body) {
+ debug('body already parsed')
+ next()
+ return
+ }
+
+ req.body = req.body || {}
+
+ // skip requests without bodies
+ if (!typeis.hasBody(req)) {
+ debug('skip empty body')
+ next()
+ return
+ }
+
+ debug('content-type %j', req.headers['content-type'])
+
+ // determine if request should be parsed
+ if (!shouldParse(req)) {
+ debug('skip parsing')
+ next()
+ return
+ }
+
+ // assert charset per RFC 7159 sec 8.1
+ var charset = getCharset(req) || 'utf-8'
+ if (charset.substr(0, 4) !== 'utf-') {
+ debug('invalid charset')
+ next(createError(415, 'unsupported charset "' + charset.toUpperCase() + '"', {
+ charset: charset,
+ type: 'charset.unsupported'
+ }))
+ return
+ }
+
+ // read
+ read(req, res, next, parse, debug, {
+ encoding: charset,
+ inflate: inflate,
+ limit: limit,
+ verify: verify
+ })
+ }
+}
+
+/**
+ * Create strict violation syntax error matching native error.
+ *
+ * @param {string} str
+ * @param {string} char
+ * @return {Error}
+ * @private
+ */
+
+function createStrictSyntaxError (str, char) {
+ var index = str.indexOf(char)
+ var partial = str.substring(0, index) + '#'
+
+ try {
+ JSON.parse(partial); /* istanbul ignore next */ throw new SyntaxError('strict violation')
+ } catch (e) {
+ return normalizeJsonSyntaxError(e, {
+ message: e.message.replace('#', char),
+ stack: e.stack
+ })
+ }
+}
+
+/**
+ * Get the first non-whitespace character in a string.
+ *
+ * @param {string} str
+ * @return {function}
+ * @private
+ */
+
+function firstchar (str) {
+ return FIRST_CHAR_REGEXP.exec(str)[1]
+}
+
+/**
+ * Get the charset of a request.
+ *
+ * @param {object} req
+ * @api private
+ */
+
+function getCharset (req) {
+ try {
+ return (contentType.parse(req).parameters.charset || '').toLowerCase()
+ } catch (e) {
+ return undefined
+ }
+}
+
+/**
+ * Normalize a SyntaxError for JSON.parse.
+ *
+ * @param {SyntaxError} error
+ * @param {object} obj
+ * @return {SyntaxError}
+ */
+
+function normalizeJsonSyntaxError (error, obj) {
+ var keys = Object.getOwnPropertyNames(error)
+
+ for (var i = 0; i < keys.length; i++) {
+ var key = keys[i]
+ if (key !== 'stack' && key !== 'message') {
+ delete error[key]
+ }
+ }
+
+ // replace stack before message for Node.js 0.10 and below
+ error.stack = obj.stack.replace(error.message, obj.message)
+ error.message = obj.message
+
+ return error
+}
+
+/**
+ * Get the simple type checker.
+ *
+ * @param {string} type
+ * @return {function}
+ */
+
+function typeChecker (type) {
+ return function checkType (req) {
+ return Boolean(typeis(req, type))
+ }
+}
diff --git a/nginx-nodejs-redis/web/node_modules/body-parser/lib/types/raw.js b/nginx-nodejs-redis/web/node_modules/body-parser/lib/types/raw.js
new file mode 100644
index 0000000..f5d1b67
--- /dev/null
+++ b/nginx-nodejs-redis/web/node_modules/body-parser/lib/types/raw.js
@@ -0,0 +1,101 @@
+/*!
+ * body-parser
+ * Copyright(c) 2014-2015 Douglas Christopher Wilson
+ * MIT Licensed
+ */
+
+'use strict'
+
+/**
+ * Module dependencies.
+ */
+
+var bytes = require('bytes')
+var debug = require('debug')('body-parser:raw')
+var read = require('../read')
+var typeis = require('type-is')
+
+/**
+ * Module exports.
+ */
+
+module.exports = raw
+
+/**
+ * Create a middleware to parse raw bodies.
+ *
+ * @param {object} [options]
+ * @return {function}
+ * @api public
+ */
+
+function raw (options) {
+ var opts = options || {}
+
+ var inflate = opts.inflate !== false
+ var limit = typeof opts.limit !== 'number'
+ ? bytes.parse(opts.limit || '100kb')
+ : opts.limit
+ var type = opts.type || 'application/octet-stream'
+ var verify = opts.verify || false
+
+ if (verify !== false && typeof verify !== 'function') {
+ throw new TypeError('option verify must be function')
+ }
+
+ // create the appropriate type checking function
+ var shouldParse = typeof type !== 'function'
+ ? typeChecker(type)
+ : type
+
+ function parse (buf) {
+ return buf
+ }
+
+ return function rawParser (req, res, next) {
+ if (req._body) {
+ debug('body already parsed')
+ next()
+ return
+ }
+
+ req.body = req.body || {}
+
+ // skip requests without bodies
+ if (!typeis.hasBody(req)) {
+ debug('skip empty body')
+ next()
+ return
+ }
+
+ debug('content-type %j', req.headers['content-type'])
+
+ // determine if request should be parsed
+ if (!shouldParse(req)) {
+ debug('skip parsing')
+ next()
+ return
+ }
+
+ // read
+ read(req, res, next, parse, debug, {
+ encoding: null,
+ inflate: inflate,
+ limit: limit,
+ verify: verify
+ })
+ }
+}
+
+/**
+ * Get the simple type checker.
+ *
+ * @param {string} type
+ * @return {function}
+ */
+
+function typeChecker (type) {
+ return function checkType (req) {
+ return Boolean(typeis(req, type))
+ }
+}
diff --git a/nginx-nodejs-redis/web/node_modules/body-parser/lib/types/text.js b/nginx-nodejs-redis/web/node_modules/body-parser/lib/types/text.js
new file mode 100644
index 0000000..083a009
--- /dev/null
+++ b/nginx-nodejs-redis/web/node_modules/body-parser/lib/types/text.js
@@ -0,0 +1,121 @@
+/*!
+ * body-parser
+ * Copyright(c) 2014-2015 Douglas Christopher Wilson
+ * MIT Licensed
+ */
+
+'use strict'
+
+/**
+ * Module dependencies.
+ */
+
+var bytes = require('bytes')
+var contentType = require('content-type')
+var debug = require('debug')('body-parser:text')
+var read = require('../read')
+var typeis = require('type-is')
+
+/**
+ * Module exports.
+ */
+
+module.exports = text
+
+/**
+ * Create a middleware to parse text bodies.
+ *
+ * @param {object} [options]
+ * @return {function}
+ * @api public
+ */
+
+function text (options) {
+ var opts = options || {}
+
+ var defaultCharset = opts.defaultCharset || 'utf-8'
+ var inflate = opts.inflate !== false
+ var limit = typeof opts.limit !== 'number'
+ ? bytes.parse(opts.limit || '100kb')
+ : opts.limit
+ var type = opts.type || 'text/plain'
+ var verify = opts.verify || false
+
+ if (verify !== false && typeof verify !== 'function') {
+ throw new TypeError('option verify must be function')
+ }
+
+ // create the appropriate type checking function
+ var shouldParse = typeof type !== 'function'
+ ? typeChecker(type)
+ : type
+
+ function parse (buf) {
+ return buf
+ }
+
+ return function textParser (req, res, next) {
+ if (req._body) {
+ debug('body already parsed')
+ next()
+ return
+ }
+
+ req.body = req.body || {}
+
+ // skip requests without bodies
+ if (!typeis.hasBody(req)) {
+ debug('skip empty body')
+ next()
+ return
+ }
+
+ debug('content-type %j', req.headers['content-type'])
+
+ // determine if request should be parsed
+ if (!shouldParse(req)) {
+ debug('skip parsing')
+ next()
+ return
+ }
+
+ // get charset
+ var charset = getCharset(req) || defaultCharset
+
+ // read
+ read(req, res, next, parse, debug, {
+ encoding: charset,
+ inflate: inflate,
+ limit: limit,
+ verify: verify
+ })
+ }
+}
+
+/**
+ * Get the charset of a request.
+ *
+ * @param {object} req
+ * @api private
+ */
+
+function getCharset (req) {
+ try {
+ return (contentType.parse(req).parameters.charset || '').toLowerCase()
+ } catch (e) {
+ return undefined
+ }
+}
+
+/**
+ * Get the simple type checker.
+ *
+ * @param {string} type
+ * @return {function}
+ */
+
+function typeChecker (type) {
+ return function checkType (req) {
+ return Boolean(typeis(req, type))
+ }
+}
diff --git a/nginx-nodejs-redis/web/node_modules/body-parser/lib/types/urlencoded.js b/nginx-nodejs-redis/web/node_modules/body-parser/lib/types/urlencoded.js
new file mode 100644
index 0000000..b2ca8f1
--- /dev/null
+++ b/nginx-nodejs-redis/web/node_modules/body-parser/lib/types/urlencoded.js
@@ -0,0 +1,284 @@
+/*!
+ * body-parser
+ * Copyright(c) 2014 Jonathan Ong
+ * Copyright(c) 2014-2015 Douglas Christopher Wilson
+ * MIT Licensed
+ */
+
+'use strict'
+
+/**
+ * Module dependencies.
+ * @private
+ */
+
+var bytes = require('bytes')
+var contentType = require('content-type')
+var createError = require('http-errors')
+var debug = require('debug')('body-parser:urlencoded')
+var deprecate = require('depd')('body-parser')
+var read = require('../read')
+var typeis = require('type-is')
+
+/**
+ * Module exports.
+ */
+
+module.exports = urlencoded
+
+/**
+ * Cache of parser modules.
+ */
+
+var parsers = Object.create(null)
+
+/**
+ * Create a middleware to parse urlencoded bodies.
+ *
+ * @param {object} [options]
+ * @return {function}
+ * @public
+ */
+
+function urlencoded (options) {
+ var opts = options || {}
+
+ // notice because option default will flip in next major
+ if (opts.extended === undefined) {
+ deprecate('undefined extended: provide extended option')
+ }
+
+ var extended = opts.extended !== false
+ var inflate = opts.inflate !== false
+ var limit = typeof opts.limit !== 'number'
+ ? bytes.parse(opts.limit || '100kb')
+ : opts.limit
+ var type = opts.type || 'application/x-www-form-urlencoded'
+ var verify = opts.verify || false
+
+ if (verify !== false && typeof verify !== 'function') {
+ throw new TypeError('option verify must be function')
+ }
+
+ // create the appropriate query parser
+ var queryparse = extended
+ ? extendedparser(opts)
+ : simpleparser(opts)
+
+ // create the appropriate type checking function
+ var shouldParse = typeof type !== 'function'
+ ? typeChecker(type)
+ : type
+
+ function parse (body) {
+ return body.length
+ ? queryparse(body)
+ : {}
+ }
+
+ return function urlencodedParser (req, res, next) {
+ if (req._body) {
+ debug('body already parsed')
+ next()
+ return
+ }
+
+ req.body = req.body || {}
+
+ // skip requests without bodies
+ if (!typeis.hasBody(req)) {
+ debug('skip empty body')
+ next()
+ return
+ }
+
+ debug('content-type %j', req.headers['content-type'])
+
+ // determine if request should be parsed
+ if (!shouldParse(req)) {
+ debug('skip parsing')
+ next()
+ return
+ }
+
+ // assert charset
+ var charset = getCharset(req) || 'utf-8'
+ if (charset !== 'utf-8') {
+ debug('invalid charset')
+ next(createError(415, 'unsupported charset "' + charset.toUpperCase() + '"', {
+ charset: charset,
+ type: 'charset.unsupported'
+ }))
+ return
+ }
+
+ // read
+ read(req, res, next, parse, debug, {
+ debug: debug,
+ encoding: charset,
+ inflate: inflate,
+ limit: limit,
+ verify: verify
+ })
+ }
+}
+
+/**
+ * Get the extended query parser.
+ *
+ * @param {object} options
+ */
+
+function extendedparser (options) {
+ var parameterLimit = options.parameterLimit !== undefined
+ ? options.parameterLimit
+ : 1000
+ var parse = parser('qs')
+
+ if (isNaN(parameterLimit) || parameterLimit < 1) {
+ throw new TypeError('option parameterLimit must be a positive number')
+ }
+
+ if (isFinite(parameterLimit)) {
+ parameterLimit = parameterLimit | 0
+ }
+
+ return function queryparse (body) {
+ var paramCount = parameterCount(body, parameterLimit)
+
+ if (paramCount === undefined) {
+ debug('too many parameters')
+ throw createError(413, 'too many parameters', {
+ type: 'parameters.too.many'
+ })
+ }
+
+ var arrayLimit = Math.max(100, paramCount)
+
+ debug('parse extended urlencoding')
+ return parse(body, {
+ allowPrototypes: true,
+ arrayLimit: arrayLimit,
+ depth: Infinity,
+ parameterLimit: parameterLimit
+ })
+ }
+}
+
+/**
+ * Get the charset of a request.
+ *
+ * @param {object} req
+ * @api private
+ */
+
+function getCharset (req) {
+ try {
+ return (contentType.parse(req).parameters.charset || '').toLowerCase()
+ } catch (e) {
+ return undefined
+ }
+}
+
+/**
+ * Count the number of parameters, stopping once limit reached
+ *
+ * @param {string} body
+ * @param {number} limit
+ * @api private
+ */
+
+function parameterCount (body, limit) {
+ var count = 0
+ var index = 0
+
+ while ((index = body.indexOf('&', index)) !== -1) {
+ count++
+ index++
+
+ if (count === limit) {
+ return undefined
+ }
+ }
+
+ return count
+}
+
+/**
+ * Get parser for module name dynamically.
+ *
+ * @param {string} name
+ * @return {function}
+ * @api private
+ */
+
+function parser (name) {
+ var mod = parsers[name]
+
+ if (mod !== undefined) {
+ return mod.parse
+ }
+
+ // this uses a switch for static require analysis
+ switch (name) {
+ case 'qs':
+ mod = require('qs')
+ break
+ case 'querystring':
+ mod = require('querystring')
+ break
+ }
+
+ // store to prevent invoking require()
+ parsers[name] = mod
+
+ return mod.parse
+}
+
+/**
+ * Get the simple query parser.
+ *
+ * @param {object} options
+ */
+
+function simpleparser (options) {
+ var parameterLimit = options.parameterLimit !== undefined
+ ? options.parameterLimit
+ : 1000
+ var parse = parser('querystring')
+
+ if (isNaN(parameterLimit) || parameterLimit < 1) {
+ throw new TypeError('option parameterLimit must be a positive number')
+ }
+
+ if (isFinite(parameterLimit)) {
+ parameterLimit = parameterLimit | 0
+ }
+
+ return function queryparse (body) {
+ var paramCount = parameterCount(body, parameterLimit)
+
+ if (paramCount === undefined) {
+ debug('too many parameters')
+ throw createError(413, 'too many parameters', {
+ type: 'parameters.too.many'
+ })
+ }
+
+ debug('parse urlencoding')
+ return parse(body, undefined, undefined, { maxKeys: parameterLimit })
+ }
+}
+
+/**
+ * Get the simple type checker.
+ *
+ * @param {string} type
+ * @return {function}
+ */
+
+function typeChecker (type) {
+ return function checkType (req) {
+ return Boolean(typeis(req, type))
+ }
+}
diff --git a/nginx-nodejs-redis/web/node_modules/body-parser/package.json b/nginx-nodejs-redis/web/node_modules/body-parser/package.json
new file mode 100644
index 0000000..5ced45f
--- /dev/null
+++ b/nginx-nodejs-redis/web/node_modules/body-parser/package.json
@@ -0,0 +1,91 @@
+{
+ "_from": "body-parser@1.19.2",
+ "_id": "body-parser@1.19.2",
+ "_inBundle": false,
+ "_integrity": "sha512-SAAwOxgoCKMGs9uUAUFHygfLAyaniaoun6I8mFY9pRAJL9+Kec34aU+oIjDhTycub1jozEfEwx1W1IuOYxVSFw==",
+ "_location": "/body-parser",
+ "_phantomChildren": {},
+ "_requested": {
+ "type": "version",
+ "registry": true,
+ "raw": "body-parser@1.19.2",
+ "name": "body-parser",
+ "escapedName": "body-parser",
+ "rawSpec": "1.19.2",
+ "saveSpec": null,
+ "fetchSpec": "1.19.2"
+ },
+ "_requiredBy": [
+ "/express"
+ ],
+ "_resolved": "https://registry.npmjs.org/body-parser/-/body-parser-1.19.2.tgz",
+ "_shasum": "4714ccd9c157d44797b8b5607d72c0b89952f26e",
+ "_spec": "body-parser@1.19.2",
+ "_where": "/Users/ajeetraina/projects/13march/awesome-compose/nginx-nodejs-redis/web/node_modules/express",
+ "bugs": {
+ "url": "https://github.com/expressjs/body-parser/issues"
+ },
+ "bundleDependencies": false,
+ "contributors": [
+ {
+ "name": "Douglas Christopher Wilson",
+ "email": "doug@somethingdoug.com"
+ },
+ {
+ "name": "Jonathan Ong",
+ "email": "me@jongleberry.com",
+ "url": "http://jongleberry.com"
+ }
+ ],
+ "dependencies": {
+ "bytes": "3.1.2",
+ "content-type": "~1.0.4",
+ "debug": "2.6.9",
+ "depd": "~1.1.2",
+ "http-errors": "1.8.1",
+ "iconv-lite": "0.4.24",
+ "on-finished": "~2.3.0",
+ "qs": "6.9.7",
+ "raw-body": "2.4.3",
+ "type-is": "~1.6.18"
+ },
+ "deprecated": false,
+ "description": "Node.js body parsing middleware",
+ "devDependencies": {
+ "eslint": "7.32.0",
+ "eslint-config-standard": "14.1.1",
+ "eslint-plugin-import": "2.25.4",
+ "eslint-plugin-markdown": "2.2.1",
+ "eslint-plugin-node": "11.1.0",
+ "eslint-plugin-promise": "5.2.0",
+ "eslint-plugin-standard": "4.1.0",
+ "methods": "1.1.2",
+ "mocha": "9.2.0",
+ "nyc": "15.1.0",
+ "safe-buffer": "5.2.1",
+ "supertest": "6.2.2"
+ },
+ "engines": {
+ "node": ">= 0.8"
+ },
+ "files": [
+ "lib/",
+ "LICENSE",
+ "HISTORY.md",
+ "index.js"
+ ],
+ "homepage": "https://github.com/expressjs/body-parser#readme",
+ "license": "MIT",
+ "name": "body-parser",
+ "repository": {
+ "type": "git",
+ "url": "git+https://github.com/expressjs/body-parser.git"
+ },
+ "scripts": {
+ "lint": "eslint .",
+ "test": "mocha --require test/support/env --reporter spec --check-leaks --bail test/",
+ "test-ci": "nyc --reporter=lcov --reporter=text npm test",
+ "test-cov": "nyc --reporter=html --reporter=text npm test"
+ },
+ "version": "1.19.2"
+}
diff --git a/nginx-nodejs-redis/web/node_modules/bytes/History.md b/nginx-nodejs-redis/web/node_modules/bytes/History.md
new file mode 100644
index 0000000..d60ce0e
--- /dev/null
+++ b/nginx-nodejs-redis/web/node_modules/bytes/History.md
@@ -0,0 +1,97 @@
+3.1.2 / 2022-01-27
+==================
+
+ * Fix return value for un-parsable strings
+
+3.1.1 / 2021-11-15
+==================
+
+ * Fix "thousandsSeparator" incorrecting formatting fractional part
+
+3.1.0 / 2019-01-22
+==================
+
+ * Add petabyte (`pb`) support
+
+3.0.0 / 2017-08-31
+==================
+
+ * Change "kB" to "KB" in format output
+ * Remove support for Node.js 0.6
+ * Remove support for ComponentJS
+
+2.5.0 / 2017-03-24
+==================
+
+ * Add option "unit"
+
+2.4.0 / 2016-06-01
+==================
+
+ * Add option "unitSeparator"
+
+2.3.0 / 2016-02-15
+==================
+
+ * Drop partial bytes on all parsed units
+ * Fix non-finite numbers to `.format` to return `null`
+ * Fix parsing byte string that looks like hex
+ * perf: hoist regular expressions
+
+2.2.0 / 2015-11-13
+==================
+
+ * add option "decimalPlaces"
+ * add option "fixedDecimals"
+
+2.1.0 / 2015-05-21
+==================
+
+ * add `.format` export
+ * add `.parse` export
+
+2.0.2 / 2015-05-20
+==================
+
+ * remove map recreation
+ * remove unnecessary object construction
+
+2.0.1 / 2015-05-07
+==================
+
+ * fix browserify require
+ * remove node.extend dependency
+
+2.0.0 / 2015-04-12
+==================
+
+ * add option "case"
+ * add option "thousandsSeparator"
+ * return "null" on invalid parse input
+ * support proper round-trip: bytes(bytes(num)) === num
+ * units no longer case sensitive when parsing
+
+1.0.0 / 2014-05-05
+==================
+
+ * add negative support. fixes #6
+
+0.3.0 / 2014-03-19
+==================
+
+ * added terabyte support
+
+0.2.1 / 2013-04-01
+==================
+
+ * add .component
+
+0.2.0 / 2012-10-28
+==================
+
+ * bytes(200).should.eql('200b')
+
+0.1.0 / 2012-07-04
+==================
+
+ * add bytes to string conversion [yields]
diff --git a/nginx-nodejs-redis/web/node_modules/bytes/LICENSE b/nginx-nodejs-redis/web/node_modules/bytes/LICENSE
new file mode 100644
index 0000000..63e95a9
--- /dev/null
+++ b/nginx-nodejs-redis/web/node_modules/bytes/LICENSE
@@ -0,0 +1,23 @@
+(The MIT License)
+
+Copyright (c) 2012-2014 TJ Holowaychuk
+Copyright (c) 2015 Jed Watson
+
+Permission is hereby granted, free of charge, to any person obtaining
+a copy of this software and associated documentation files (the
+'Software'), to deal in the Software without restriction, including
+without limitation the rights to use, copy, modify, merge, publish,
+distribute, sublicense, and/or sell copies of the Software, and to
+permit persons to whom the Software is furnished to do so, subject to
+the following conditions:
+
+The above copyright notice and this permission notice shall be
+included in all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND,
+EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.
+IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY
+CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT,
+TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE
+SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
diff --git a/nginx-nodejs-redis/web/node_modules/bytes/Readme.md b/nginx-nodejs-redis/web/node_modules/bytes/Readme.md
new file mode 100644
index 0000000..5790e23
--- /dev/null
+++ b/nginx-nodejs-redis/web/node_modules/bytes/Readme.md
@@ -0,0 +1,152 @@
+# Bytes utility
+
+[![NPM Version][npm-image]][npm-url]
+[![NPM Downloads][downloads-image]][downloads-url]
+[![Build Status][ci-image]][ci-url]
+[![Test Coverage][coveralls-image]][coveralls-url]
+
+Utility to parse a string bytes (ex: `1TB`) to bytes (`1099511627776`) and vice-versa.
+
+## Installation
+
+This is a [Node.js](https://nodejs.org/en/) module available through the
+[npm registry](https://www.npmjs.com/). Installation is done using the
+[`npm install` command](https://docs.npmjs.com/getting-started/installing-npm-packages-locally):
+
+```bash
+$ npm install bytes
+```
+
+## Usage
+
+```js
+var bytes = require('bytes');
+```
+
+#### bytes(number|string value, [options]): number|string|null
+
+Default export function. Delegates to either `bytes.format` or `bytes.parse` based on the type of `value`.
+
+**Arguments**
+
+| Name | Type | Description |
+|---------|----------|--------------------|
+| value | `number`|`string` | Number value to format or string value to parse |
+| options | `Object` | Conversion options for `format` |
+
+**Returns**
+
+| Name | Type | Description |
+|---------|------------------|-------------------------------------------------|
+| results | `string`|`number`|`null` | Return null upon error. Numeric value in bytes, or string value otherwise. |
+
+**Example**
+
+```js
+bytes(1024);
+// output: '1KB'
+
+bytes('1KB');
+// output: 1024
+```
+
+#### bytes.format(number value, [options]): string|null
+
+Format the given value in bytes into a string. If the value is negative, it is kept as such. If it is a float, it is
+ rounded.
+
+**Arguments**
+
+| Name | Type | Description |
+|---------|----------|--------------------|
+| value | `number` | Value in bytes |
+| options | `Object` | Conversion options |
+
+**Options**
+
+| Property | Type | Description |
+|-------------------|--------|-----------------------------------------------------------------------------------------|
+| decimalPlaces | `number`|`null` | Maximum number of decimal places to include in output. Default value to `2`. |
+| fixedDecimals | `boolean`|`null` | Whether to always display the maximum number of decimal places. Default value to `false` |
+| thousandsSeparator | `string`|`null` | Example of values: `' '`, `','` and `'.'`... Default value to `''`. |
+| unit | `string`|`null` | The unit in which the result will be returned (B/KB/MB/GB/TB). Default value to `''` (which means auto detect). |
+| unitSeparator | `string`|`null` | Separator to use between number and unit. Default value to `''`. |
+
+**Returns**
+
+| Name | Type | Description |
+|---------|------------------|-------------------------------------------------|
+| results | `string`|`null` | Return null upon error. String value otherwise. |
+
+**Example**
+
+```js
+bytes.format(1024);
+// output: '1KB'
+
+bytes.format(1000);
+// output: '1000B'
+
+bytes.format(1000, {thousandsSeparator: ' '});
+// output: '1 000B'
+
+bytes.format(1024 * 1.7, {decimalPlaces: 0});
+// output: '2KB'
+
+bytes.format(1024, {unitSeparator: ' '});
+// output: '1 KB'
+```
+
+#### bytes.parse(string|number value): number|null
+
+Parse the string value into an integer in bytes. If no unit is given, or `value`
+is a number, it is assumed the value is in bytes.
+
+Supported units and abbreviations are as follows and are case-insensitive:
+
+ * `b` for bytes
+ * `kb` for kilobytes
+ * `mb` for megabytes
+ * `gb` for gigabytes
+ * `tb` for terabytes
+ * `pb` for petabytes
+
+The units are in powers of two, not ten. This means 1kb = 1024b according to this parser.
+
+**Arguments**
+
+| Name | Type | Description |
+|---------------|--------|--------------------|
+| value | `string`|`number` | String to parse, or number in bytes. |
+
+**Returns**
+
+| Name | Type | Description |
+|---------|-------------|-------------------------|
+| results | `number`|`null` | Return null upon error. Value in bytes otherwise. |
+
+**Example**
+
+```js
+bytes.parse('1KB');
+// output: 1024
+
+bytes.parse('1024');
+// output: 1024
+
+bytes.parse(1024);
+// output: 1024
+```
+
+## License
+
+[MIT](LICENSE)
+
+[ci-image]: https://badgen.net/github/checks/visionmedia/bytes.js/master?label=ci
+[ci-url]: https://github.com/visionmedia/bytes.js/actions?query=workflow%3Aci
+[coveralls-image]: https://badgen.net/coveralls/c/github/visionmedia/bytes.js/master
+[coveralls-url]: https://coveralls.io/r/visionmedia/bytes.js?branch=master
+[downloads-image]: https://badgen.net/npm/dm/bytes
+[downloads-url]: https://npmjs.org/package/bytes
+[npm-image]: https://badgen.net/npm/v/bytes
+[npm-url]: https://npmjs.org/package/bytes
diff --git a/nginx-nodejs-redis/web/node_modules/bytes/index.js b/nginx-nodejs-redis/web/node_modules/bytes/index.js
new file mode 100644
index 0000000..6f2d0f8
--- /dev/null
+++ b/nginx-nodejs-redis/web/node_modules/bytes/index.js
@@ -0,0 +1,170 @@
+/*!
+ * bytes
+ * Copyright(c) 2012-2014 TJ Holowaychuk
+ * Copyright(c) 2015 Jed Watson
+ * MIT Licensed
+ */
+
+'use strict';
+
+/**
+ * Module exports.
+ * @public
+ */
+
+module.exports = bytes;
+module.exports.format = format;
+module.exports.parse = parse;
+
+/**
+ * Module variables.
+ * @private
+ */
+
+var formatThousandsRegExp = /\B(?=(\d{3})+(?!\d))/g;
+
+var formatDecimalsRegExp = /(?:\.0*|(\.[^0]+)0+)$/;
+
+var map = {
+ b: 1,
+ kb: 1 << 10,
+ mb: 1 << 20,
+ gb: 1 << 30,
+ tb: Math.pow(1024, 4),
+ pb: Math.pow(1024, 5),
+};
+
+var parseRegExp = /^((-|\+)?(\d+(?:\.\d+)?)) *(kb|mb|gb|tb|pb)$/i;
+
+/**
+ * Convert the given value in bytes into a string or parse to string to an integer in bytes.
+ *
+ * @param {string|number} value
+ * @param {{
+ * case: [string],
+ * decimalPlaces: [number]
+ * fixedDecimals: [boolean]
+ * thousandsSeparator: [string]
+ * unitSeparator: [string]
+ * }} [options] bytes options.
+ *
+ * @returns {string|number|null}
+ */
+
+function bytes(value, options) {
+ if (typeof value === 'string') {
+ return parse(value);
+ }
+
+ if (typeof value === 'number') {
+ return format(value, options);
+ }
+
+ return null;
+}
+
+/**
+ * Format the given value in bytes into a string.
+ *
+ * If the value is negative, it is kept as such. If it is a float,
+ * it is rounded.
+ *
+ * @param {number} value
+ * @param {object} [options]
+ * @param {number} [options.decimalPlaces=2]
+ * @param {number} [options.fixedDecimals=false]
+ * @param {string} [options.thousandsSeparator=]
+ * @param {string} [options.unit=]
+ * @param {string} [options.unitSeparator=]
+ *
+ * @returns {string|null}
+ * @public
+ */
+
+function format(value, options) {
+ if (!Number.isFinite(value)) {
+ return null;
+ }
+
+ var mag = Math.abs(value);
+ var thousandsSeparator = (options && options.thousandsSeparator) || '';
+ var unitSeparator = (options && options.unitSeparator) || '';
+ var decimalPlaces = (options && options.decimalPlaces !== undefined) ? options.decimalPlaces : 2;
+ var fixedDecimals = Boolean(options && options.fixedDecimals);
+ var unit = (options && options.unit) || '';
+
+ if (!unit || !map[unit.toLowerCase()]) {
+ if (mag >= map.pb) {
+ unit = 'PB';
+ } else if (mag >= map.tb) {
+ unit = 'TB';
+ } else if (mag >= map.gb) {
+ unit = 'GB';
+ } else if (mag >= map.mb) {
+ unit = 'MB';
+ } else if (mag >= map.kb) {
+ unit = 'KB';
+ } else {
+ unit = 'B';
+ }
+ }
+
+ var val = value / map[unit.toLowerCase()];
+ var str = val.toFixed(decimalPlaces);
+
+ if (!fixedDecimals) {
+ str = str.replace(formatDecimalsRegExp, '$1');
+ }
+
+ if (thousandsSeparator) {
+ str = str.split('.').map(function (s, i) {
+ return i === 0
+ ? s.replace(formatThousandsRegExp, thousandsSeparator)
+ : s
+ }).join('.');
+ }
+
+ return str + unitSeparator + unit;
+}
+
+/**
+ * Parse the string value into an integer in bytes.
+ *
+ * If no unit is given, it is assumed the value is in bytes.
+ *
+ * @param {number|string} val
+ *
+ * @returns {number|null}
+ * @public
+ */
+
+function parse(val) {
+ if (typeof val === 'number' && !isNaN(val)) {
+ return val;
+ }
+
+ if (typeof val !== 'string') {
+ return null;
+ }
+
+ // Test if the string passed is valid
+ var results = parseRegExp.exec(val);
+ var floatValue;
+ var unit = 'b';
+
+ if (!results) {
+ // Nothing could be extracted from the given string
+ floatValue = parseInt(val, 10);
+ unit = 'b'
+ } else {
+ // Retrieve the value and the unit
+ floatValue = parseFloat(results[1]);
+ unit = results[4].toLowerCase();
+ }
+
+ if (isNaN(floatValue)) {
+ return null;
+ }
+
+ return Math.floor(map[unit] * floatValue);
+}
diff --git a/nginx-nodejs-redis/web/node_modules/bytes/package.json b/nginx-nodejs-redis/web/node_modules/bytes/package.json
new file mode 100644
index 0000000..eeaa28a
--- /dev/null
+++ b/nginx-nodejs-redis/web/node_modules/bytes/package.json
@@ -0,0 +1,85 @@
+{
+ "_from": "bytes@3.1.2",
+ "_id": "bytes@3.1.2",
+ "_inBundle": false,
+ "_integrity": "sha512-/Nf7TyzTx6S3yRJObOAV7956r8cr2+Oj8AC5dt8wSP3BQAoeX58NoHyCU8P8zGkNXStjTSi6fzO6F0pBdcYbEg==",
+ "_location": "/bytes",
+ "_phantomChildren": {},
+ "_requested": {
+ "type": "version",
+ "registry": true,
+ "raw": "bytes@3.1.2",
+ "name": "bytes",
+ "escapedName": "bytes",
+ "rawSpec": "3.1.2",
+ "saveSpec": null,
+ "fetchSpec": "3.1.2"
+ },
+ "_requiredBy": [
+ "/body-parser",
+ "/raw-body"
+ ],
+ "_resolved": "https://registry.npmjs.org/bytes/-/bytes-3.1.2.tgz",
+ "_shasum": "8b0beeb98605adf1b128fa4386403c009e0221a5",
+ "_spec": "bytes@3.1.2",
+ "_where": "/Users/ajeetraina/projects/13march/awesome-compose/nginx-nodejs-redis/web/node_modules/body-parser",
+ "author": {
+ "name": "TJ Holowaychuk",
+ "email": "tj@vision-media.ca",
+ "url": "http://tjholowaychuk.com"
+ },
+ "bugs": {
+ "url": "https://github.com/visionmedia/bytes.js/issues"
+ },
+ "bundleDependencies": false,
+ "contributors": [
+ {
+ "name": "Jed Watson",
+ "email": "jed.watson@me.com"
+ },
+ {
+ "name": "Théo FIDRY",
+ "email": "theo.fidry@gmail.com"
+ }
+ ],
+ "deprecated": false,
+ "description": "Utility to parse a string bytes to bytes and vice-versa",
+ "devDependencies": {
+ "eslint": "7.32.0",
+ "eslint-plugin-markdown": "2.2.1",
+ "mocha": "9.2.0",
+ "nyc": "15.1.0"
+ },
+ "engines": {
+ "node": ">= 0.8"
+ },
+ "files": [
+ "History.md",
+ "LICENSE",
+ "Readme.md",
+ "index.js"
+ ],
+ "homepage": "https://github.com/visionmedia/bytes.js#readme",
+ "keywords": [
+ "byte",
+ "bytes",
+ "utility",
+ "parse",
+ "parser",
+ "convert",
+ "converter"
+ ],
+ "license": "MIT",
+ "name": "bytes",
+ "repository": {
+ "type": "git",
+ "url": "git+https://github.com/visionmedia/bytes.js.git"
+ },
+ "scripts": {
+ "lint": "eslint .",
+ "test": "mocha --check-leaks --reporter spec",
+ "test-ci": "nyc --reporter=lcov --reporter=text npm test",
+ "test-cov": "nyc --reporter=html --reporter=text npm test"
+ },
+ "version": "3.1.2"
+}
diff --git a/nginx-nodejs-redis/web/node_modules/content-disposition/HISTORY.md b/nginx-nodejs-redis/web/node_modules/content-disposition/HISTORY.md
new file mode 100644
index 0000000..488effa
--- /dev/null
+++ b/nginx-nodejs-redis/web/node_modules/content-disposition/HISTORY.md
@@ -0,0 +1,60 @@
+0.5.4 / 2021-12-10
+==================
+
+ * deps: safe-buffer@5.2.1
+
+0.5.3 / 2018-12-17
+==================
+
+ * Use `safe-buffer` for improved Buffer API
+
+0.5.2 / 2016-12-08
+==================
+
+ * Fix `parse` to accept any linear whitespace character
+
+0.5.1 / 2016-01-17
+==================
+
+ * perf: enable strict mode
+
+0.5.0 / 2014-10-11
+==================
+
+ * Add `parse` function
+
+0.4.0 / 2014-09-21
+==================
+
+ * Expand non-Unicode `filename` to the full ISO-8859-1 charset
+
+0.3.0 / 2014-09-20
+==================
+
+ * Add `fallback` option
+ * Add `type` option
+
+0.2.0 / 2014-09-19
+==================
+
+ * Reduce ambiguity of file names with hex escape in buggy browsers
+
+0.1.2 / 2014-09-19
+==================
+
+ * Fix periodic invalid Unicode filename header
+
+0.1.1 / 2014-09-19
+==================
+
+ * Fix invalid characters appearing in `filename*` parameter
+
+0.1.0 / 2014-09-18
+==================
+
+ * Make the `filename` argument optional
+
+0.0.0 / 2014-09-18
+==================
+
+ * Initial release
diff --git a/nginx-nodejs-redis/web/node_modules/content-disposition/LICENSE b/nginx-nodejs-redis/web/node_modules/content-disposition/LICENSE
new file mode 100644
index 0000000..84441fb
--- /dev/null
+++ b/nginx-nodejs-redis/web/node_modules/content-disposition/LICENSE
@@ -0,0 +1,22 @@
+(The MIT License)
+
+Copyright (c) 2014-2017 Douglas Christopher Wilson
+
+Permission is hereby granted, free of charge, to any person obtaining
+a copy of this software and associated documentation files (the
+'Software'), to deal in the Software without restriction, including
+without limitation the rights to use, copy, modify, merge, publish,
+distribute, sublicense, and/or sell copies of the Software, and to
+permit persons to whom the Software is furnished to do so, subject to
+the following conditions:
+
+The above copyright notice and this permission notice shall be
+included in all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND,
+EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.
+IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY
+CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT,
+TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE
+SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
diff --git a/nginx-nodejs-redis/web/node_modules/content-disposition/README.md b/nginx-nodejs-redis/web/node_modules/content-disposition/README.md
new file mode 100644
index 0000000..3a0bb05
--- /dev/null
+++ b/nginx-nodejs-redis/web/node_modules/content-disposition/README.md
@@ -0,0 +1,142 @@
+# content-disposition
+
+[![NPM Version][npm-image]][npm-url]
+[![NPM Downloads][downloads-image]][downloads-url]
+[![Node.js Version][node-version-image]][node-version-url]
+[![Build Status][github-actions-ci-image]][github-actions-ci-url]
+[![Test Coverage][coveralls-image]][coveralls-url]
+
+Create and parse HTTP `Content-Disposition` header
+
+## Installation
+
+```sh
+$ npm install content-disposition
+```
+
+## API
+
+```js
+var contentDisposition = require('content-disposition')
+```
+
+### contentDisposition(filename, options)
+
+Create an attachment `Content-Disposition` header value using the given file name,
+if supplied. The `filename` is optional and if no file name is desired, but you
+want to specify `options`, set `filename` to `undefined`.
+
+```js
+res.setHeader('Content-Disposition', contentDisposition('∫ maths.pdf'))
+```
+
+**note** HTTP headers are of the ISO-8859-1 character set. If you are writing this
+header through a means different from `setHeader` in Node.js, you'll want to specify
+the `'binary'` encoding in Node.js.
+
+#### Options
+
+`contentDisposition` accepts these properties in the options object.
+
+##### fallback
+
+If the `filename` option is outside ISO-8859-1, then the file name is actually
+stored in a supplemental field for clients that support Unicode file names and
+a ISO-8859-1 version of the file name is automatically generated.
+
+This specifies the ISO-8859-1 file name to override the automatic generation or
+disables the generation all together, defaults to `true`.
+
+ - A string will specify the ISO-8859-1 file name to use in place of automatic
+ generation.
+ - `false` will disable including a ISO-8859-1 file name and only include the
+ Unicode version (unless the file name is already ISO-8859-1).
+ - `true` will enable automatic generation if the file name is outside ISO-8859-1.
+
+If the `filename` option is ISO-8859-1 and this option is specified and has a
+different value, then the `filename` option is encoded in the extended field
+and this set as the fallback field, even though they are both ISO-8859-1.
+
+##### type
+
+Specifies the disposition type, defaults to `"attachment"`. This can also be
+`"inline"`, or any other value (all values except inline are treated like
+`attachment`, but can convey additional information if both parties agree to
+it). The type is normalized to lower-case.
+
+### contentDisposition.parse(string)
+
+```js
+var disposition = contentDisposition.parse('attachment; filename="EURO rates.txt"; filename*=UTF-8\'\'%e2%82%ac%20rates.txt')
+```
+
+Parse a `Content-Disposition` header string. This automatically handles extended
+("Unicode") parameters by decoding them and providing them under the standard
+parameter name. This will return an object with the following properties (examples
+are shown for the string `'attachment; filename="EURO rates.txt"; filename*=UTF-8\'\'%e2%82%ac%20rates.txt'`):
+
+ - `type`: The disposition type (always lower case). Example: `'attachment'`
+
+ - `parameters`: An object of the parameters in the disposition (name of parameter
+ always lower case and extended versions replace non-extended versions). Example:
+ `{filename: "€ rates.txt"}`
+
+## Examples
+
+### Send a file for download
+
+```js
+var contentDisposition = require('content-disposition')
+var destroy = require('destroy')
+var fs = require('fs')
+var http = require('http')
+var onFinished = require('on-finished')
+
+var filePath = '/path/to/public/plans.pdf'
+
+http.createServer(function onRequest (req, res) {
+ // set headers
+ res.setHeader('Content-Type', 'application/pdf')
+ res.setHeader('Content-Disposition', contentDisposition(filePath))
+
+ // send file
+ var stream = fs.createReadStream(filePath)
+ stream.pipe(res)
+ onFinished(res, function () {
+ destroy(stream)
+ })
+})
+```
+
+## Testing
+
+```sh
+$ npm test
+```
+
+## References
+
+- [RFC 2616: Hypertext Transfer Protocol -- HTTP/1.1][rfc-2616]
+- [RFC 5987: Character Set and Language Encoding for Hypertext Transfer Protocol (HTTP) Header Field Parameters][rfc-5987]
+- [RFC 6266: Use of the Content-Disposition Header Field in the Hypertext Transfer Protocol (HTTP)][rfc-6266]
+- [Test Cases for HTTP Content-Disposition header field (RFC 6266) and the Encodings defined in RFCs 2047, 2231 and 5987][tc-2231]
+
+[rfc-2616]: https://tools.ietf.org/html/rfc2616
+[rfc-5987]: https://tools.ietf.org/html/rfc5987
+[rfc-6266]: https://tools.ietf.org/html/rfc6266
+[tc-2231]: http://greenbytes.de/tech/tc2231/
+
+## License
+
+[MIT](LICENSE)
+
+[npm-image]: https://img.shields.io/npm/v/content-disposition.svg
+[npm-url]: https://npmjs.org/package/content-disposition
+[node-version-image]: https://img.shields.io/node/v/content-disposition.svg
+[node-version-url]: https://nodejs.org/en/download
+[coveralls-image]: https://img.shields.io/coveralls/jshttp/content-disposition.svg
+[coveralls-url]: https://coveralls.io/r/jshttp/content-disposition?branch=master
+[downloads-image]: https://img.shields.io/npm/dm/content-disposition.svg
+[downloads-url]: https://npmjs.org/package/content-disposition
+[github-actions-ci-image]: https://img.shields.io/github/workflow/status/jshttp/content-disposition/ci/master?label=ci
+[github-actions-ci-url]: https://github.com/jshttp/content-disposition?query=workflow%3Aci
diff --git a/nginx-nodejs-redis/web/node_modules/content-disposition/index.js b/nginx-nodejs-redis/web/node_modules/content-disposition/index.js
new file mode 100644
index 0000000..ecec899
--- /dev/null
+++ b/nginx-nodejs-redis/web/node_modules/content-disposition/index.js
@@ -0,0 +1,458 @@
+/*!
+ * content-disposition
+ * Copyright(c) 2014-2017 Douglas Christopher Wilson
+ * MIT Licensed
+ */
+
+'use strict'
+
+/**
+ * Module exports.
+ * @public
+ */
+
+module.exports = contentDisposition
+module.exports.parse = parse
+
+/**
+ * Module dependencies.
+ * @private
+ */
+
+var basename = require('path').basename
+var Buffer = require('safe-buffer').Buffer
+
+/**
+ * RegExp to match non attr-char, *after* encodeURIComponent (i.e. not including "%")
+ * @private
+ */
+
+var ENCODE_URL_ATTR_CHAR_REGEXP = /[\x00-\x20"'()*,/:;<=>?@[\\\]{}\x7f]/g // eslint-disable-line no-control-regex
+
+/**
+ * RegExp to match percent encoding escape.
+ * @private
+ */
+
+var HEX_ESCAPE_REGEXP = /%[0-9A-Fa-f]{2}/
+var HEX_ESCAPE_REPLACE_REGEXP = /%([0-9A-Fa-f]{2})/g
+
+/**
+ * RegExp to match non-latin1 characters.
+ * @private
+ */
+
+var NON_LATIN1_REGEXP = /[^\x20-\x7e\xa0-\xff]/g
+
+/**
+ * RegExp to match quoted-pair in RFC 2616
+ *
+ * quoted-pair = "\" CHAR
+ * CHAR =
+ * @private
+ */
+
+var QESC_REGEXP = /\\([\u0000-\u007f])/g // eslint-disable-line no-control-regex
+
+/**
+ * RegExp to match chars that must be quoted-pair in RFC 2616
+ * @private
+ */
+
+var QUOTE_REGEXP = /([\\"])/g
+
+/**
+ * RegExp for various RFC 2616 grammar
+ *
+ * parameter = token "=" ( token | quoted-string )
+ * token = 1*
+ * separators = "(" | ")" | "<" | ">" | "@"
+ * | "," | ";" | ":" | "\" | <">
+ * | "/" | "[" | "]" | "?" | "="
+ * | "{" | "}" | SP | HT
+ * quoted-string = ( <"> *(qdtext | quoted-pair ) <"> )
+ * qdtext = >
+ * quoted-pair = "\" CHAR
+ * CHAR =
+ * TEXT =
+ * LWS = [CRLF] 1*( SP | HT )
+ * CRLF = CR LF
+ * CR =
+ * LF =
+ * SP =
+ * HT =
+ * CTL =
+ * OCTET =
+ * @private
+ */
+
+var PARAM_REGEXP = /;[\x09\x20]*([!#$%&'*+.0-9A-Z^_`a-z|~-]+)[\x09\x20]*=[\x09\x20]*("(?:[\x20!\x23-\x5b\x5d-\x7e\x80-\xff]|\\[\x20-\x7e])*"|[!#$%&'*+.0-9A-Z^_`a-z|~-]+)[\x09\x20]*/g // eslint-disable-line no-control-regex
+var TEXT_REGEXP = /^[\x20-\x7e\x80-\xff]+$/
+var TOKEN_REGEXP = /^[!#$%&'*+.0-9A-Z^_`a-z|~-]+$/
+
+/**
+ * RegExp for various RFC 5987 grammar
+ *
+ * ext-value = charset "'" [ language ] "'" value-chars
+ * charset = "UTF-8" / "ISO-8859-1" / mime-charset
+ * mime-charset = 1*mime-charsetc
+ * mime-charsetc = ALPHA / DIGIT
+ * / "!" / "#" / "$" / "%" / "&"
+ * / "+" / "-" / "^" / "_" / "`"
+ * / "{" / "}" / "~"
+ * language = ( 2*3ALPHA [ extlang ] )
+ * / 4ALPHA
+ * / 5*8ALPHA
+ * extlang = *3( "-" 3ALPHA )
+ * value-chars = *( pct-encoded / attr-char )
+ * pct-encoded = "%" HEXDIG HEXDIG
+ * attr-char = ALPHA / DIGIT
+ * / "!" / "#" / "$" / "&" / "+" / "-" / "."
+ * / "^" / "_" / "`" / "|" / "~"
+ * @private
+ */
+
+var EXT_VALUE_REGEXP = /^([A-Za-z0-9!#$%&+\-^_`{}~]+)'(?:[A-Za-z]{2,3}(?:-[A-Za-z]{3}){0,3}|[A-Za-z]{4,8}|)'((?:%[0-9A-Fa-f]{2}|[A-Za-z0-9!#$&+.^_`|~-])+)$/
+
+/**
+ * RegExp for various RFC 6266 grammar
+ *
+ * disposition-type = "inline" | "attachment" | disp-ext-type
+ * disp-ext-type = token
+ * disposition-parm = filename-parm | disp-ext-parm
+ * filename-parm = "filename" "=" value
+ * | "filename*" "=" ext-value
+ * disp-ext-parm = token "=" value
+ * | ext-token "=" ext-value
+ * ext-token =
+ * @private
+ */
+
+var DISPOSITION_TYPE_REGEXP = /^([!#$%&'*+.0-9A-Z^_`a-z|~-]+)[\x09\x20]*(?:$|;)/ // eslint-disable-line no-control-regex
+
+/**
+ * Create an attachment Content-Disposition header.
+ *
+ * @param {string} [filename]
+ * @param {object} [options]
+ * @param {string} [options.type=attachment]
+ * @param {string|boolean} [options.fallback=true]
+ * @return {string}
+ * @public
+ */
+
+function contentDisposition (filename, options) {
+ var opts = options || {}
+
+ // get type
+ var type = opts.type || 'attachment'
+
+ // get parameters
+ var params = createparams(filename, opts.fallback)
+
+ // format into string
+ return format(new ContentDisposition(type, params))
+}
+
+/**
+ * Create parameters object from filename and fallback.
+ *
+ * @param {string} [filename]
+ * @param {string|boolean} [fallback=true]
+ * @return {object}
+ * @private
+ */
+
+function createparams (filename, fallback) {
+ if (filename === undefined) {
+ return
+ }
+
+ var params = {}
+
+ if (typeof filename !== 'string') {
+ throw new TypeError('filename must be a string')
+ }
+
+ // fallback defaults to true
+ if (fallback === undefined) {
+ fallback = true
+ }
+
+ if (typeof fallback !== 'string' && typeof fallback !== 'boolean') {
+ throw new TypeError('fallback must be a string or boolean')
+ }
+
+ if (typeof fallback === 'string' && NON_LATIN1_REGEXP.test(fallback)) {
+ throw new TypeError('fallback must be ISO-8859-1 string')
+ }
+
+ // restrict to file base name
+ var name = basename(filename)
+
+ // determine if name is suitable for quoted string
+ var isQuotedString = TEXT_REGEXP.test(name)
+
+ // generate fallback name
+ var fallbackName = typeof fallback !== 'string'
+ ? fallback && getlatin1(name)
+ : basename(fallback)
+ var hasFallback = typeof fallbackName === 'string' && fallbackName !== name
+
+ // set extended filename parameter
+ if (hasFallback || !isQuotedString || HEX_ESCAPE_REGEXP.test(name)) {
+ params['filename*'] = name
+ }
+
+ // set filename parameter
+ if (isQuotedString || hasFallback) {
+ params.filename = hasFallback
+ ? fallbackName
+ : name
+ }
+
+ return params
+}
+
+/**
+ * Format object to Content-Disposition header.
+ *
+ * @param {object} obj
+ * @param {string} obj.type
+ * @param {object} [obj.parameters]
+ * @return {string}
+ * @private
+ */
+
+function format (obj) {
+ var parameters = obj.parameters
+ var type = obj.type
+
+ if (!type || typeof type !== 'string' || !TOKEN_REGEXP.test(type)) {
+ throw new TypeError('invalid type')
+ }
+
+ // start with normalized type
+ var string = String(type).toLowerCase()
+
+ // append parameters
+ if (parameters && typeof parameters === 'object') {
+ var param
+ var params = Object.keys(parameters).sort()
+
+ for (var i = 0; i < params.length; i++) {
+ param = params[i]
+
+ var val = param.substr(-1) === '*'
+ ? ustring(parameters[param])
+ : qstring(parameters[param])
+
+ string += '; ' + param + '=' + val
+ }
+ }
+
+ return string
+}
+
+/**
+ * Decode a RFC 5987 field value (gracefully).
+ *
+ * @param {string} str
+ * @return {string}
+ * @private
+ */
+
+function decodefield (str) {
+ var match = EXT_VALUE_REGEXP.exec(str)
+
+ if (!match) {
+ throw new TypeError('invalid extended field value')
+ }
+
+ var charset = match[1].toLowerCase()
+ var encoded = match[2]
+ var value
+
+ // to binary string
+ var binary = encoded.replace(HEX_ESCAPE_REPLACE_REGEXP, pdecode)
+
+ switch (charset) {
+ case 'iso-8859-1':
+ value = getlatin1(binary)
+ break
+ case 'utf-8':
+ value = Buffer.from(binary, 'binary').toString('utf8')
+ break
+ default:
+ throw new TypeError('unsupported charset in extended field')
+ }
+
+ return value
+}
+
+/**
+ * Get ISO-8859-1 version of string.
+ *
+ * @param {string} val
+ * @return {string}
+ * @private
+ */
+
+function getlatin1 (val) {
+ // simple Unicode -> ISO-8859-1 transformation
+ return String(val).replace(NON_LATIN1_REGEXP, '?')
+}
+
+/**
+ * Parse Content-Disposition header string.
+ *
+ * @param {string} string
+ * @return {object}
+ * @public
+ */
+
+function parse (string) {
+ if (!string || typeof string !== 'string') {
+ throw new TypeError('argument string is required')
+ }
+
+ var match = DISPOSITION_TYPE_REGEXP.exec(string)
+
+ if (!match) {
+ throw new TypeError('invalid type format')
+ }
+
+ // normalize type
+ var index = match[0].length
+ var type = match[1].toLowerCase()
+
+ var key
+ var names = []
+ var params = {}
+ var value
+
+ // calculate index to start at
+ index = PARAM_REGEXP.lastIndex = match[0].substr(-1) === ';'
+ ? index - 1
+ : index
+
+ // match parameters
+ while ((match = PARAM_REGEXP.exec(string))) {
+ if (match.index !== index) {
+ throw new TypeError('invalid parameter format')
+ }
+
+ index += match[0].length
+ key = match[1].toLowerCase()
+ value = match[2]
+
+ if (names.indexOf(key) !== -1) {
+ throw new TypeError('invalid duplicate parameter')
+ }
+
+ names.push(key)
+
+ if (key.indexOf('*') + 1 === key.length) {
+ // decode extended value
+ key = key.slice(0, -1)
+ value = decodefield(value)
+
+ // overwrite existing value
+ params[key] = value
+ continue
+ }
+
+ if (typeof params[key] === 'string') {
+ continue
+ }
+
+ if (value[0] === '"') {
+ // remove quotes and escapes
+ value = value
+ .substr(1, value.length - 2)
+ .replace(QESC_REGEXP, '$1')
+ }
+
+ params[key] = value
+ }
+
+ if (index !== -1 && index !== string.length) {
+ throw new TypeError('invalid parameter format')
+ }
+
+ return new ContentDisposition(type, params)
+}
+
+/**
+ * Percent decode a single character.
+ *
+ * @param {string} str
+ * @param {string} hex
+ * @return {string}
+ * @private
+ */
+
+function pdecode (str, hex) {
+ return String.fromCharCode(parseInt(hex, 16))
+}
+
+/**
+ * Percent encode a single character.
+ *
+ * @param {string} char
+ * @return {string}
+ * @private
+ */
+
+function pencode (char) {
+ return '%' + String(char)
+ .charCodeAt(0)
+ .toString(16)
+ .toUpperCase()
+}
+
+/**
+ * Quote a string for HTTP.
+ *
+ * @param {string} val
+ * @return {string}
+ * @private
+ */
+
+function qstring (val) {
+ var str = String(val)
+
+ return '"' + str.replace(QUOTE_REGEXP, '\\$1') + '"'
+}
+
+/**
+ * Encode a Unicode string for HTTP (RFC 5987).
+ *
+ * @param {string} val
+ * @return {string}
+ * @private
+ */
+
+function ustring (val) {
+ var str = String(val)
+
+ // percent encode as UTF-8
+ var encoded = encodeURIComponent(str)
+ .replace(ENCODE_URL_ATTR_CHAR_REGEXP, pencode)
+
+ return 'UTF-8\'\'' + encoded
+}
+
+/**
+ * Class for parsed Content-Disposition header for v8 optimization
+ *
+ * @public
+ * @param {string} type
+ * @param {object} parameters
+ * @constructor
+ */
+
+function ContentDisposition (type, parameters) {
+ this.type = type
+ this.parameters = parameters
+}
diff --git a/nginx-nodejs-redis/web/node_modules/content-disposition/package.json b/nginx-nodejs-redis/web/node_modules/content-disposition/package.json
new file mode 100644
index 0000000..6ac8558
--- /dev/null
+++ b/nginx-nodejs-redis/web/node_modules/content-disposition/package.json
@@ -0,0 +1,79 @@
+{
+ "_from": "content-disposition@0.5.4",
+ "_id": "content-disposition@0.5.4",
+ "_inBundle": false,
+ "_integrity": "sha512-FveZTNuGw04cxlAiWbzi6zTAL/lhehaWbTtgluJh4/E95DqMwTmha3KZN1aAWA8cFIhHzMZUvLevkw5Rqk+tSQ==",
+ "_location": "/content-disposition",
+ "_phantomChildren": {},
+ "_requested": {
+ "type": "version",
+ "registry": true,
+ "raw": "content-disposition@0.5.4",
+ "name": "content-disposition",
+ "escapedName": "content-disposition",
+ "rawSpec": "0.5.4",
+ "saveSpec": null,
+ "fetchSpec": "0.5.4"
+ },
+ "_requiredBy": [
+ "/express"
+ ],
+ "_resolved": "https://registry.npmjs.org/content-disposition/-/content-disposition-0.5.4.tgz",
+ "_shasum": "8b82b4efac82512a02bb0b1dcec9d2c5e8eb5bfe",
+ "_spec": "content-disposition@0.5.4",
+ "_where": "/Users/ajeetraina/projects/13march/awesome-compose/nginx-nodejs-redis/web/node_modules/express",
+ "author": {
+ "name": "Douglas Christopher Wilson",
+ "email": "doug@somethingdoug.com"
+ },
+ "bugs": {
+ "url": "https://github.com/jshttp/content-disposition/issues"
+ },
+ "bundleDependencies": false,
+ "dependencies": {
+ "safe-buffer": "5.2.1"
+ },
+ "deprecated": false,
+ "description": "Create and parse Content-Disposition header",
+ "devDependencies": {
+ "deep-equal": "1.0.1",
+ "eslint": "7.32.0",
+ "eslint-config-standard": "13.0.1",
+ "eslint-plugin-import": "2.25.3",
+ "eslint-plugin-markdown": "2.2.1",
+ "eslint-plugin-node": "11.1.0",
+ "eslint-plugin-promise": "5.2.0",
+ "eslint-plugin-standard": "4.1.0",
+ "istanbul": "0.4.5",
+ "mocha": "9.1.3"
+ },
+ "engines": {
+ "node": ">= 0.6"
+ },
+ "files": [
+ "LICENSE",
+ "HISTORY.md",
+ "README.md",
+ "index.js"
+ ],
+ "homepage": "https://github.com/jshttp/content-disposition#readme",
+ "keywords": [
+ "content-disposition",
+ "http",
+ "rfc6266",
+ "res"
+ ],
+ "license": "MIT",
+ "name": "content-disposition",
+ "repository": {
+ "type": "git",
+ "url": "git+https://github.com/jshttp/content-disposition.git"
+ },
+ "scripts": {
+ "lint": "eslint .",
+ "test": "mocha --reporter spec --bail --check-leaks test/",
+ "test-ci": "istanbul cover node_modules/mocha/bin/_mocha --report lcovonly -- --reporter spec --check-leaks test/",
+ "test-cov": "istanbul cover node_modules/mocha/bin/_mocha -- --reporter dot --check-leaks test/"
+ },
+ "version": "0.5.4"
+}
diff --git a/nginx-nodejs-redis/web/node_modules/content-type/HISTORY.md b/nginx-nodejs-redis/web/node_modules/content-type/HISTORY.md
new file mode 100644
index 0000000..8f5cb70
--- /dev/null
+++ b/nginx-nodejs-redis/web/node_modules/content-type/HISTORY.md
@@ -0,0 +1,24 @@
+1.0.4 / 2017-09-11
+==================
+
+ * perf: skip parameter parsing when no parameters
+
+1.0.3 / 2017-09-10
+==================
+
+ * perf: remove argument reassignment
+
+1.0.2 / 2016-05-09
+==================
+
+ * perf: enable strict mode
+
+1.0.1 / 2015-02-13
+==================
+
+ * Improve missing `Content-Type` header error message
+
+1.0.0 / 2015-02-01
+==================
+
+ * Initial implementation, derived from `media-typer@0.3.0`
diff --git a/nginx-nodejs-redis/web/node_modules/content-type/LICENSE b/nginx-nodejs-redis/web/node_modules/content-type/LICENSE
new file mode 100644
index 0000000..34b1a2d
--- /dev/null
+++ b/nginx-nodejs-redis/web/node_modules/content-type/LICENSE
@@ -0,0 +1,22 @@
+(The MIT License)
+
+Copyright (c) 2015 Douglas Christopher Wilson
+
+Permission is hereby granted, free of charge, to any person obtaining
+a copy of this software and associated documentation files (the
+'Software'), to deal in the Software without restriction, including
+without limitation the rights to use, copy, modify, merge, publish,
+distribute, sublicense, and/or sell copies of the Software, and to
+permit persons to whom the Software is furnished to do so, subject to
+the following conditions:
+
+The above copyright notice and this permission notice shall be
+included in all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND,
+EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.
+IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY
+CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT,
+TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE
+SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
diff --git a/nginx-nodejs-redis/web/node_modules/content-type/README.md b/nginx-nodejs-redis/web/node_modules/content-type/README.md
new file mode 100644
index 0000000..3ed6741
--- /dev/null
+++ b/nginx-nodejs-redis/web/node_modules/content-type/README.md
@@ -0,0 +1,92 @@
+# content-type
+
+[![NPM Version][npm-image]][npm-url]
+[![NPM Downloads][downloads-image]][downloads-url]
+[![Node.js Version][node-version-image]][node-version-url]
+[![Build Status][travis-image]][travis-url]
+[![Test Coverage][coveralls-image]][coveralls-url]
+
+Create and parse HTTP Content-Type header according to RFC 7231
+
+## Installation
+
+```sh
+$ npm install content-type
+```
+
+## API
+
+```js
+var contentType = require('content-type')
+```
+
+### contentType.parse(string)
+
+```js
+var obj = contentType.parse('image/svg+xml; charset=utf-8')
+```
+
+Parse a content type string. This will return an object with the following
+properties (examples are shown for the string `'image/svg+xml; charset=utf-8'`):
+
+ - `type`: The media type (the type and subtype, always lower case).
+ Example: `'image/svg+xml'`
+
+ - `parameters`: An object of the parameters in the media type (name of parameter
+ always lower case). Example: `{charset: 'utf-8'}`
+
+Throws a `TypeError` if the string is missing or invalid.
+
+### contentType.parse(req)
+
+```js
+var obj = contentType.parse(req)
+```
+
+Parse the `content-type` header from the given `req`. Short-cut for
+`contentType.parse(req.headers['content-type'])`.
+
+Throws a `TypeError` if the `Content-Type` header is missing or invalid.
+
+### contentType.parse(res)
+
+```js
+var obj = contentType.parse(res)
+```
+
+Parse the `content-type` header set on the given `res`. Short-cut for
+`contentType.parse(res.getHeader('content-type'))`.
+
+Throws a `TypeError` if the `Content-Type` header is missing or invalid.
+
+### contentType.format(obj)
+
+```js
+var str = contentType.format({type: 'image/svg+xml'})
+```
+
+Format an object into a content type string. This will return a string of the
+content type for the given object with the following properties (examples are
+shown that produce the string `'image/svg+xml; charset=utf-8'`):
+
+ - `type`: The media type (will be lower-cased). Example: `'image/svg+xml'`
+
+ - `parameters`: An object of the parameters in the media type (name of the
+ parameter will be lower-cased). Example: `{charset: 'utf-8'}`
+
+Throws a `TypeError` if the object contains an invalid type or parameter names.
+
+## License
+
+[MIT](LICENSE)
+
+[npm-image]: https://img.shields.io/npm/v/content-type.svg
+[npm-url]: https://npmjs.org/package/content-type
+[node-version-image]: https://img.shields.io/node/v/content-type.svg
+[node-version-url]: http://nodejs.org/download/
+[travis-image]: https://img.shields.io/travis/jshttp/content-type/master.svg
+[travis-url]: https://travis-ci.org/jshttp/content-type
+[coveralls-image]: https://img.shields.io/coveralls/jshttp/content-type/master.svg
+[coveralls-url]: https://coveralls.io/r/jshttp/content-type
+[downloads-image]: https://img.shields.io/npm/dm/content-type.svg
+[downloads-url]: https://npmjs.org/package/content-type
diff --git a/nginx-nodejs-redis/web/node_modules/content-type/index.js b/nginx-nodejs-redis/web/node_modules/content-type/index.js
new file mode 100644
index 0000000..6ce03f2
--- /dev/null
+++ b/nginx-nodejs-redis/web/node_modules/content-type/index.js
@@ -0,0 +1,222 @@
+/*!
+ * content-type
+ * Copyright(c) 2015 Douglas Christopher Wilson
+ * MIT Licensed
+ */
+
+'use strict'
+
+/**
+ * RegExp to match *( ";" parameter ) in RFC 7231 sec 3.1.1.1
+ *
+ * parameter = token "=" ( token / quoted-string )
+ * token = 1*tchar
+ * tchar = "!" / "#" / "$" / "%" / "&" / "'" / "*"
+ * / "+" / "-" / "." / "^" / "_" / "`" / "|" / "~"
+ * / DIGIT / ALPHA
+ * ; any VCHAR, except delimiters
+ * quoted-string = DQUOTE *( qdtext / quoted-pair ) DQUOTE
+ * qdtext = HTAB / SP / %x21 / %x23-5B / %x5D-7E / obs-text
+ * obs-text = %x80-FF
+ * quoted-pair = "\" ( HTAB / SP / VCHAR / obs-text )
+ */
+var PARAM_REGEXP = /; *([!#$%&'*+.^_`|~0-9A-Za-z-]+) *= *("(?:[\u000b\u0020\u0021\u0023-\u005b\u005d-\u007e\u0080-\u00ff]|\\[\u000b\u0020-\u00ff])*"|[!#$%&'*+.^_`|~0-9A-Za-z-]+) */g
+var TEXT_REGEXP = /^[\u000b\u0020-\u007e\u0080-\u00ff]+$/
+var TOKEN_REGEXP = /^[!#$%&'*+.^_`|~0-9A-Za-z-]+$/
+
+/**
+ * RegExp to match quoted-pair in RFC 7230 sec 3.2.6
+ *
+ * quoted-pair = "\" ( HTAB / SP / VCHAR / obs-text )
+ * obs-text = %x80-FF
+ */
+var QESC_REGEXP = /\\([\u000b\u0020-\u00ff])/g
+
+/**
+ * RegExp to match chars that must be quoted-pair in RFC 7230 sec 3.2.6
+ */
+var QUOTE_REGEXP = /([\\"])/g
+
+/**
+ * RegExp to match type in RFC 7231 sec 3.1.1.1
+ *
+ * media-type = type "/" subtype
+ * type = token
+ * subtype = token
+ */
+var TYPE_REGEXP = /^[!#$%&'*+.^_`|~0-9A-Za-z-]+\/[!#$%&'*+.^_`|~0-9A-Za-z-]+$/
+
+/**
+ * Module exports.
+ * @public
+ */
+
+exports.format = format
+exports.parse = parse
+
+/**
+ * Format object to media type.
+ *
+ * @param {object} obj
+ * @return {string}
+ * @public
+ */
+
+function format (obj) {
+ if (!obj || typeof obj !== 'object') {
+ throw new TypeError('argument obj is required')
+ }
+
+ var parameters = obj.parameters
+ var type = obj.type
+
+ if (!type || !TYPE_REGEXP.test(type)) {
+ throw new TypeError('invalid type')
+ }
+
+ var string = type
+
+ // append parameters
+ if (parameters && typeof parameters === 'object') {
+ var param
+ var params = Object.keys(parameters).sort()
+
+ for (var i = 0; i < params.length; i++) {
+ param = params[i]
+
+ if (!TOKEN_REGEXP.test(param)) {
+ throw new TypeError('invalid parameter name')
+ }
+
+ string += '; ' + param + '=' + qstring(parameters[param])
+ }
+ }
+
+ return string
+}
+
+/**
+ * Parse media type to object.
+ *
+ * @param {string|object} string
+ * @return {Object}
+ * @public
+ */
+
+function parse (string) {
+ if (!string) {
+ throw new TypeError('argument string is required')
+ }
+
+ // support req/res-like objects as argument
+ var header = typeof string === 'object'
+ ? getcontenttype(string)
+ : string
+
+ if (typeof header !== 'string') {
+ throw new TypeError('argument string is required to be a string')
+ }
+
+ var index = header.indexOf(';')
+ var type = index !== -1
+ ? header.substr(0, index).trim()
+ : header.trim()
+
+ if (!TYPE_REGEXP.test(type)) {
+ throw new TypeError('invalid media type')
+ }
+
+ var obj = new ContentType(type.toLowerCase())
+
+ // parse parameters
+ if (index !== -1) {
+ var key
+ var match
+ var value
+
+ PARAM_REGEXP.lastIndex = index
+
+ while ((match = PARAM_REGEXP.exec(header))) {
+ if (match.index !== index) {
+ throw new TypeError('invalid parameter format')
+ }
+
+ index += match[0].length
+ key = match[1].toLowerCase()
+ value = match[2]
+
+ if (value[0] === '"') {
+ // remove quotes and escapes
+ value = value
+ .substr(1, value.length - 2)
+ .replace(QESC_REGEXP, '$1')
+ }
+
+ obj.parameters[key] = value
+ }
+
+ if (index !== header.length) {
+ throw new TypeError('invalid parameter format')
+ }
+ }
+
+ return obj
+}
+
+/**
+ * Get content-type from req/res objects.
+ *
+ * @param {object}
+ * @return {Object}
+ * @private
+ */
+
+function getcontenttype (obj) {
+ var header
+
+ if (typeof obj.getHeader === 'function') {
+ // res-like
+ header = obj.getHeader('content-type')
+ } else if (typeof obj.headers === 'object') {
+ // req-like
+ header = obj.headers && obj.headers['content-type']
+ }
+
+ if (typeof header !== 'string') {
+ throw new TypeError('content-type header is missing from object')
+ }
+
+ return header
+}
+
+/**
+ * Quote a string if necessary.
+ *
+ * @param {string} val
+ * @return {string}
+ * @private
+ */
+
+function qstring (val) {
+ var str = String(val)
+
+ // no need to quote tokens
+ if (TOKEN_REGEXP.test(str)) {
+ return str
+ }
+
+ if (str.length > 0 && !TEXT_REGEXP.test(str)) {
+ throw new TypeError('invalid parameter value')
+ }
+
+ return '"' + str.replace(QUOTE_REGEXP, '\\$1') + '"'
+}
+
+/**
+ * Class to represent a content type.
+ * @private
+ */
+function ContentType (type) {
+ this.parameters = Object.create(null)
+ this.type = type
+}
diff --git a/nginx-nodejs-redis/web/node_modules/content-type/package.json b/nginx-nodejs-redis/web/node_modules/content-type/package.json
new file mode 100644
index 0000000..f0675f9
--- /dev/null
+++ b/nginx-nodejs-redis/web/node_modules/content-type/package.json
@@ -0,0 +1,76 @@
+{
+ "_from": "content-type@~1.0.4",
+ "_id": "content-type@1.0.4",
+ "_inBundle": false,
+ "_integrity": "sha512-hIP3EEPs8tB9AT1L+NUqtwOAps4mk2Zob89MWXMHjHWg9milF/j4osnnQLXBCBFBk/tvIG/tUc9mOUJiPBhPXA==",
+ "_location": "/content-type",
+ "_phantomChildren": {},
+ "_requested": {
+ "type": "range",
+ "registry": true,
+ "raw": "content-type@~1.0.4",
+ "name": "content-type",
+ "escapedName": "content-type",
+ "rawSpec": "~1.0.4",
+ "saveSpec": null,
+ "fetchSpec": "~1.0.4"
+ },
+ "_requiredBy": [
+ "/body-parser",
+ "/express"
+ ],
+ "_resolved": "https://registry.npmjs.org/content-type/-/content-type-1.0.4.tgz",
+ "_shasum": "e138cc75e040c727b1966fe5e5f8c9aee256fe3b",
+ "_spec": "content-type@~1.0.4",
+ "_where": "/Users/ajeetraina/projects/13march/awesome-compose/nginx-nodejs-redis/web/node_modules/express",
+ "author": {
+ "name": "Douglas Christopher Wilson",
+ "email": "doug@somethingdoug.com"
+ },
+ "bugs": {
+ "url": "https://github.com/jshttp/content-type/issues"
+ },
+ "bundleDependencies": false,
+ "deprecated": false,
+ "description": "Create and parse HTTP Content-Type header",
+ "devDependencies": {
+ "eslint": "3.19.0",
+ "eslint-config-standard": "10.2.1",
+ "eslint-plugin-import": "2.7.0",
+ "eslint-plugin-node": "5.1.1",
+ "eslint-plugin-promise": "3.5.0",
+ "eslint-plugin-standard": "3.0.1",
+ "istanbul": "0.4.5",
+ "mocha": "~1.21.5"
+ },
+ "engines": {
+ "node": ">= 0.6"
+ },
+ "files": [
+ "LICENSE",
+ "HISTORY.md",
+ "README.md",
+ "index.js"
+ ],
+ "homepage": "https://github.com/jshttp/content-type#readme",
+ "keywords": [
+ "content-type",
+ "http",
+ "req",
+ "res",
+ "rfc7231"
+ ],
+ "license": "MIT",
+ "name": "content-type",
+ "repository": {
+ "type": "git",
+ "url": "git+https://github.com/jshttp/content-type.git"
+ },
+ "scripts": {
+ "lint": "eslint .",
+ "test": "mocha --reporter spec --check-leaks --bail test/",
+ "test-ci": "istanbul cover node_modules/mocha/bin/_mocha --report lcovonly -- --reporter spec --check-leaks test/",
+ "test-cov": "istanbul cover node_modules/mocha/bin/_mocha -- --reporter dot --check-leaks test/"
+ },
+ "version": "1.0.4"
+}
diff --git a/nginx-nodejs-redis/web/node_modules/cookie-signature/.npmignore b/nginx-nodejs-redis/web/node_modules/cookie-signature/.npmignore
new file mode 100644
index 0000000..f1250e5
--- /dev/null
+++ b/nginx-nodejs-redis/web/node_modules/cookie-signature/.npmignore
@@ -0,0 +1,4 @@
+support
+test
+examples
+*.sock
diff --git a/nginx-nodejs-redis/web/node_modules/cookie-signature/History.md b/nginx-nodejs-redis/web/node_modules/cookie-signature/History.md
new file mode 100644
index 0000000..78513cc
--- /dev/null
+++ b/nginx-nodejs-redis/web/node_modules/cookie-signature/History.md
@@ -0,0 +1,38 @@
+1.0.6 / 2015-02-03
+==================
+
+* use `npm test` instead of `make test` to run tests
+* clearer assertion messages when checking input
+
+
+1.0.5 / 2014-09-05
+==================
+
+* add license to package.json
+
+1.0.4 / 2014-06-25
+==================
+
+ * corrected avoidance of timing attacks (thanks @tenbits!)
+
+1.0.3 / 2014-01-28
+==================
+
+ * [incorrect] fix for timing attacks
+
+1.0.2 / 2014-01-28
+==================
+
+ * fix missing repository warning
+ * fix typo in test
+
+1.0.1 / 2013-04-15
+==================
+
+ * Revert "Changed underlying HMAC algo. to sha512."
+ * Revert "Fix for timing attacks on MAC verification."
+
+0.0.1 / 2010-01-03
+==================
+
+ * Initial release
diff --git a/nginx-nodejs-redis/web/node_modules/cookie-signature/Readme.md b/nginx-nodejs-redis/web/node_modules/cookie-signature/Readme.md
new file mode 100644
index 0000000..2559e84
--- /dev/null
+++ b/nginx-nodejs-redis/web/node_modules/cookie-signature/Readme.md
@@ -0,0 +1,42 @@
+
+# cookie-signature
+
+ Sign and unsign cookies.
+
+## Example
+
+```js
+var cookie = require('cookie-signature');
+
+var val = cookie.sign('hello', 'tobiiscool');
+val.should.equal('hello.DGDUkGlIkCzPz+C0B064FNgHdEjox7ch8tOBGslZ5QI');
+
+var val = cookie.sign('hello', 'tobiiscool');
+cookie.unsign(val, 'tobiiscool').should.equal('hello');
+cookie.unsign(val, 'luna').should.be.false;
+```
+
+## License
+
+(The MIT License)
+
+Copyright (c) 2012 LearnBoost <tj@learnboost.com>
+
+Permission is hereby granted, free of charge, to any person obtaining
+a copy of this software and associated documentation files (the
+'Software'), to deal in the Software without restriction, including
+without limitation the rights to use, copy, modify, merge, publish,
+distribute, sublicense, and/or sell copies of the Software, and to
+permit persons to whom the Software is furnished to do so, subject to
+the following conditions:
+
+The above copyright notice and this permission notice shall be
+included in all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND,
+EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.
+IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY
+CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT,
+TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE
+SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
\ No newline at end of file
diff --git a/nginx-nodejs-redis/web/node_modules/cookie-signature/index.js b/nginx-nodejs-redis/web/node_modules/cookie-signature/index.js
new file mode 100644
index 0000000..b8c9463
--- /dev/null
+++ b/nginx-nodejs-redis/web/node_modules/cookie-signature/index.js
@@ -0,0 +1,51 @@
+/**
+ * Module dependencies.
+ */
+
+var crypto = require('crypto');
+
+/**
+ * Sign the given `val` with `secret`.
+ *
+ * @param {String} val
+ * @param {String} secret
+ * @return {String}
+ * @api private
+ */
+
+exports.sign = function(val, secret){
+ if ('string' != typeof val) throw new TypeError("Cookie value must be provided as a string.");
+ if ('string' != typeof secret) throw new TypeError("Secret string must be provided.");
+ return val + '.' + crypto
+ .createHmac('sha256', secret)
+ .update(val)
+ .digest('base64')
+ .replace(/\=+$/, '');
+};
+
+/**
+ * Unsign and decode the given `val` with `secret`,
+ * returning `false` if the signature is invalid.
+ *
+ * @param {String} val
+ * @param {String} secret
+ * @return {String|Boolean}
+ * @api private
+ */
+
+exports.unsign = function(val, secret){
+ if ('string' != typeof val) throw new TypeError("Signed cookie string must be provided.");
+ if ('string' != typeof secret) throw new TypeError("Secret string must be provided.");
+ var str = val.slice(0, val.lastIndexOf('.'))
+ , mac = exports.sign(str, secret);
+
+ return sha1(mac) == sha1(val) ? str : false;
+};
+
+/**
+ * Private
+ */
+
+function sha1(str){
+ return crypto.createHash('sha1').update(str).digest('hex');
+}
diff --git a/nginx-nodejs-redis/web/node_modules/cookie-signature/package.json b/nginx-nodejs-redis/web/node_modules/cookie-signature/package.json
new file mode 100644
index 0000000..5607152
--- /dev/null
+++ b/nginx-nodejs-redis/web/node_modules/cookie-signature/package.json
@@ -0,0 +1,57 @@
+{
+ "_from": "cookie-signature@1.0.6",
+ "_id": "cookie-signature@1.0.6",
+ "_inBundle": false,
+ "_integrity": "sha1-4wOogrNCzD7oylE6eZmXNNqzriw=",
+ "_location": "/cookie-signature",
+ "_phantomChildren": {},
+ "_requested": {
+ "type": "version",
+ "registry": true,
+ "raw": "cookie-signature@1.0.6",
+ "name": "cookie-signature",
+ "escapedName": "cookie-signature",
+ "rawSpec": "1.0.6",
+ "saveSpec": null,
+ "fetchSpec": "1.0.6"
+ },
+ "_requiredBy": [
+ "/express"
+ ],
+ "_resolved": "https://registry.npmjs.org/cookie-signature/-/cookie-signature-1.0.6.tgz",
+ "_shasum": "e303a882b342cc3ee8ca513a79999734dab3ae2c",
+ "_spec": "cookie-signature@1.0.6",
+ "_where": "/Users/ajeetraina/projects/13march/awesome-compose/nginx-nodejs-redis/web/node_modules/express",
+ "author": {
+ "name": "TJ Holowaychuk",
+ "email": "tj@learnboost.com"
+ },
+ "bugs": {
+ "url": "https://github.com/visionmedia/node-cookie-signature/issues"
+ },
+ "bundleDependencies": false,
+ "dependencies": {},
+ "deprecated": false,
+ "description": "Sign and unsign cookies",
+ "devDependencies": {
+ "mocha": "*",
+ "should": "*"
+ },
+ "homepage": "https://github.com/visionmedia/node-cookie-signature#readme",
+ "keywords": [
+ "cookie",
+ "sign",
+ "unsign"
+ ],
+ "license": "MIT",
+ "main": "index",
+ "name": "cookie-signature",
+ "repository": {
+ "type": "git",
+ "url": "git+https://github.com/visionmedia/node-cookie-signature.git"
+ },
+ "scripts": {
+ "test": "mocha --require should --reporter spec"
+ },
+ "version": "1.0.6"
+}
diff --git a/nginx-nodejs-redis/web/node_modules/cookie/HISTORY.md b/nginx-nodejs-redis/web/node_modules/cookie/HISTORY.md
new file mode 100644
index 0000000..2d21760
--- /dev/null
+++ b/nginx-nodejs-redis/web/node_modules/cookie/HISTORY.md
@@ -0,0 +1,134 @@
+0.4.2 / 2022-02-02
+==================
+
+ * pref: read value only when assigning in parse
+ * pref: remove unnecessary regexp in parse
+
+0.4.1 / 2020-04-21
+==================
+
+ * Fix `maxAge` option to reject invalid values
+
+0.4.0 / 2019-05-15
+==================
+
+ * Add `SameSite=None` support
+
+0.3.1 / 2016-05-26
+==================
+
+ * Fix `sameSite: true` to work with draft-7 clients
+ - `true` now sends `SameSite=Strict` instead of `SameSite`
+
+0.3.0 / 2016-05-26
+==================
+
+ * Add `sameSite` option
+ - Replaces `firstPartyOnly` option, never implemented by browsers
+ * Improve error message when `encode` is not a function
+ * Improve error message when `expires` is not a `Date`
+
+0.2.4 / 2016-05-20
+==================
+
+ * perf: enable strict mode
+ * perf: use for loop in parse
+ * perf: use string concatination for serialization
+
+0.2.3 / 2015-10-25
+==================
+
+ * Fix cookie `Max-Age` to never be a floating point number
+
+0.2.2 / 2015-09-17
+==================
+
+ * Fix regression when setting empty cookie value
+ - Ease the new restriction, which is just basic header-level validation
+ * Fix typo in invalid value errors
+
+0.2.1 / 2015-09-17
+==================
+
+ * Throw on invalid values provided to `serialize`
+ - Ensures the resulting string is a valid HTTP header value
+
+0.2.0 / 2015-08-13
+==================
+
+ * Add `firstPartyOnly` option
+ * Throw better error for invalid argument to parse
+ * perf: hoist regular expression
+
+0.1.5 / 2015-09-17
+==================
+
+ * Fix regression when setting empty cookie value
+ - Ease the new restriction, which is just basic header-level validation
+ * Fix typo in invalid value errors
+
+0.1.4 / 2015-09-17
+==================
+
+ * Throw better error for invalid argument to parse
+ * Throw on invalid values provided to `serialize`
+ - Ensures the resulting string is a valid HTTP header value
+
+0.1.3 / 2015-05-19
+==================
+
+ * Reduce the scope of try-catch deopt
+ * Remove argument reassignments
+
+0.1.2 / 2014-04-16
+==================
+
+ * Remove unnecessary files from npm package
+
+0.1.1 / 2014-02-23
+==================
+
+ * Fix bad parse when cookie value contained a comma
+ * Fix support for `maxAge` of `0`
+
+0.1.0 / 2013-05-01
+==================
+
+ * Add `decode` option
+ * Add `encode` option
+
+0.0.6 / 2013-04-08
+==================
+
+ * Ignore cookie parts missing `=`
+
+0.0.5 / 2012-10-29
+==================
+
+ * Return raw cookie value if value unescape errors
+
+0.0.4 / 2012-06-21
+==================
+
+ * Use encode/decodeURIComponent for cookie encoding/decoding
+ - Improve server/client interoperability
+
+0.0.3 / 2012-06-06
+==================
+
+ * Only escape special characters per the cookie RFC
+
+0.0.2 / 2012-06-01
+==================
+
+ * Fix `maxAge` option to not throw error
+
+0.0.1 / 2012-05-28
+==================
+
+ * Add more tests
+
+0.0.0 / 2012-05-28
+==================
+
+ * Initial release
diff --git a/nginx-nodejs-redis/web/node_modules/cookie/LICENSE b/nginx-nodejs-redis/web/node_modules/cookie/LICENSE
new file mode 100644
index 0000000..058b6b4
--- /dev/null
+++ b/nginx-nodejs-redis/web/node_modules/cookie/LICENSE
@@ -0,0 +1,24 @@
+(The MIT License)
+
+Copyright (c) 2012-2014 Roman Shtylman
+Copyright (c) 2015 Douglas Christopher Wilson
+
+Permission is hereby granted, free of charge, to any person obtaining
+a copy of this software and associated documentation files (the
+'Software'), to deal in the Software without restriction, including
+without limitation the rights to use, copy, modify, merge, publish,
+distribute, sublicense, and/or sell copies of the Software, and to
+permit persons to whom the Software is furnished to do so, subject to
+the following conditions:
+
+The above copyright notice and this permission notice shall be
+included in all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND,
+EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.
+IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY
+CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT,
+TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE
+SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
+
diff --git a/nginx-nodejs-redis/web/node_modules/cookie/README.md b/nginx-nodejs-redis/web/node_modules/cookie/README.md
new file mode 100644
index 0000000..e275c70
--- /dev/null
+++ b/nginx-nodejs-redis/web/node_modules/cookie/README.md
@@ -0,0 +1,286 @@
+# cookie
+
+[![NPM Version][npm-version-image]][npm-url]
+[![NPM Downloads][npm-downloads-image]][npm-url]
+[![Node.js Version][node-version-image]][node-version-url]
+[![Build Status][github-actions-ci-image]][github-actions-ci-url]
+[![Test Coverage][coveralls-image]][coveralls-url]
+
+Basic HTTP cookie parser and serializer for HTTP servers.
+
+## Installation
+
+This is a [Node.js](https://nodejs.org/en/) module available through the
+[npm registry](https://www.npmjs.com/). Installation is done using the
+[`npm install` command](https://docs.npmjs.com/getting-started/installing-npm-packages-locally):
+
+```sh
+$ npm install cookie
+```
+
+## API
+
+```js
+var cookie = require('cookie');
+```
+
+### cookie.parse(str, options)
+
+Parse an HTTP `Cookie` header string and returning an object of all cookie name-value pairs.
+The `str` argument is the string representing a `Cookie` header value and `options` is an
+optional object containing additional parsing options.
+
+```js
+var cookies = cookie.parse('foo=bar; equation=E%3Dmc%5E2');
+// { foo: 'bar', equation: 'E=mc^2' }
+```
+
+#### Options
+
+`cookie.parse` accepts these properties in the options object.
+
+##### decode
+
+Specifies a function that will be used to decode a cookie's value. Since the value of a cookie
+has a limited character set (and must be a simple string), this function can be used to decode
+a previously-encoded cookie value into a JavaScript string or other object.
+
+The default function is the global `decodeURIComponent`, which will decode any URL-encoded
+sequences into their byte representations.
+
+**note** if an error is thrown from this function, the original, non-decoded cookie value will
+be returned as the cookie's value.
+
+### cookie.serialize(name, value, options)
+
+Serialize a cookie name-value pair into a `Set-Cookie` header string. The `name` argument is the
+name for the cookie, the `value` argument is the value to set the cookie to, and the `options`
+argument is an optional object containing additional serialization options.
+
+```js
+var setCookie = cookie.serialize('foo', 'bar');
+// foo=bar
+```
+
+#### Options
+
+`cookie.serialize` accepts these properties in the options object.
+
+##### domain
+
+Specifies the value for the [`Domain` `Set-Cookie` attribute][rfc-6265-5.2.3]. By default, no
+domain is set, and most clients will consider the cookie to apply to only the current domain.
+
+##### encode
+
+Specifies a function that will be used to encode a cookie's value. Since value of a cookie
+has a limited character set (and must be a simple string), this function can be used to encode
+a value into a string suited for a cookie's value.
+
+The default function is the global `encodeURIComponent`, which will encode a JavaScript string
+into UTF-8 byte sequences and then URL-encode any that fall outside of the cookie range.
+
+##### expires
+
+Specifies the `Date` object to be the value for the [`Expires` `Set-Cookie` attribute][rfc-6265-5.2.1].
+By default, no expiration is set, and most clients will consider this a "non-persistent cookie" and
+will delete it on a condition like exiting a web browser application.
+
+**note** the [cookie storage model specification][rfc-6265-5.3] states that if both `expires` and
+`maxAge` are set, then `maxAge` takes precedence, but it is possible not all clients by obey this,
+so if both are set, they should point to the same date and time.
+
+##### httpOnly
+
+Specifies the `boolean` value for the [`HttpOnly` `Set-Cookie` attribute][rfc-6265-5.2.6]. When truthy,
+the `HttpOnly` attribute is set, otherwise it is not. By default, the `HttpOnly` attribute is not set.
+
+**note** be careful when setting this to `true`, as compliant clients will not allow client-side
+JavaScript to see the cookie in `document.cookie`.
+
+##### maxAge
+
+Specifies the `number` (in seconds) to be the value for the [`Max-Age` `Set-Cookie` attribute][rfc-6265-5.2.2].
+The given number will be converted to an integer by rounding down. By default, no maximum age is set.
+
+**note** the [cookie storage model specification][rfc-6265-5.3] states that if both `expires` and
+`maxAge` are set, then `maxAge` takes precedence, but it is possible not all clients by obey this,
+so if both are set, they should point to the same date and time.
+
+##### path
+
+Specifies the value for the [`Path` `Set-Cookie` attribute][rfc-6265-5.2.4]. By default, the path
+is considered the ["default path"][rfc-6265-5.1.4].
+
+##### sameSite
+
+Specifies the `boolean` or `string` to be the value for the [`SameSite` `Set-Cookie` attribute][rfc-6265bis-03-4.1.2.7].
+
+ - `true` will set the `SameSite` attribute to `Strict` for strict same site enforcement.
+ - `false` will not set the `SameSite` attribute.
+ - `'lax'` will set the `SameSite` attribute to `Lax` for lax same site enforcement.
+ - `'none'` will set the `SameSite` attribute to `None` for an explicit cross-site cookie.
+ - `'strict'` will set the `SameSite` attribute to `Strict` for strict same site enforcement.
+
+More information about the different enforcement levels can be found in
+[the specification][rfc-6265bis-03-4.1.2.7].
+
+**note** This is an attribute that has not yet been fully standardized, and may change in the future.
+This also means many clients may ignore this attribute until they understand it.
+
+##### secure
+
+Specifies the `boolean` value for the [`Secure` `Set-Cookie` attribute][rfc-6265-5.2.5]. When truthy,
+the `Secure` attribute is set, otherwise it is not. By default, the `Secure` attribute is not set.
+
+**note** be careful when setting this to `true`, as compliant clients will not send the cookie back to
+the server in the future if the browser does not have an HTTPS connection.
+
+## Example
+
+The following example uses this module in conjunction with the Node.js core HTTP server
+to prompt a user for their name and display it back on future visits.
+
+```js
+var cookie = require('cookie');
+var escapeHtml = require('escape-html');
+var http = require('http');
+var url = require('url');
+
+function onRequest(req, res) {
+ // Parse the query string
+ var query = url.parse(req.url, true, true).query;
+
+ if (query && query.name) {
+ // Set a new cookie with the name
+ res.setHeader('Set-Cookie', cookie.serialize('name', String(query.name), {
+ httpOnly: true,
+ maxAge: 60 * 60 * 24 * 7 // 1 week
+ }));
+
+ // Redirect back after setting cookie
+ res.statusCode = 302;
+ res.setHeader('Location', req.headers.referer || '/');
+ res.end();
+ return;
+ }
+
+ // Parse the cookies on the request
+ var cookies = cookie.parse(req.headers.cookie || '');
+
+ // Get the visitor name set in the cookie
+ var name = cookies.name;
+
+ res.setHeader('Content-Type', 'text/html; charset=UTF-8');
+
+ if (name) {
+ res.write('Welcome back, ' + escapeHtml(name) + '!
');
+ } else {
+ res.write('Hello, new visitor!
');
+ }
+
+ res.write('');
+}
+
+http.createServer(onRequest).listen(3000);
+```
+
+## Testing
+
+```sh
+$ npm test
+```
+
+## Benchmark
+
+```
+$ npm run bench
+
+> cookie@0.4.1 bench
+> node benchmark/index.js
+
+ node@16.13.1
+ v8@9.4.146.24-node.14
+ uv@1.42.0
+ zlib@1.2.11
+ brotli@1.0.9
+ ares@1.18.1
+ modules@93
+ nghttp2@1.45.1
+ napi@8
+ llhttp@6.0.4
+ openssl@1.1.1l+quic
+ cldr@39.0
+ icu@69.1
+ tz@2021a
+ unicode@13.0
+ ngtcp2@0.1.0-DEV
+ nghttp3@0.1.0-DEV
+
+> node benchmark/parse-top.js
+
+ cookie.parse - top sites
+
+ 15 tests completed.
+
+ parse accounts.google.com x 504,358 ops/sec ±6.55% (171 runs sampled)
+ parse apple.com x 1,369,991 ops/sec ±0.84% (189 runs sampled)
+ parse cloudflare.com x 360,669 ops/sec ±3.75% (182 runs sampled)
+ parse docs.google.com x 521,496 ops/sec ±4.90% (180 runs sampled)
+ parse drive.google.com x 553,514 ops/sec ±0.59% (189 runs sampled)
+ parse en.wikipedia.org x 286,052 ops/sec ±0.62% (188 runs sampled)
+ parse linkedin.com x 178,817 ops/sec ±0.61% (192 runs sampled)
+ parse maps.google.com x 284,585 ops/sec ±0.68% (188 runs sampled)
+ parse microsoft.com x 161,230 ops/sec ±0.56% (192 runs sampled)
+ parse play.google.com x 352,144 ops/sec ±1.01% (181 runs sampled)
+ parse plus.google.com x 275,204 ops/sec ±7.78% (156 runs sampled)
+ parse support.google.com x 339,493 ops/sec ±1.02% (191 runs sampled)
+ parse www.google.com x 286,110 ops/sec ±0.90% (191 runs sampled)
+ parse youtu.be x 548,557 ops/sec ±0.60% (184 runs sampled)
+ parse youtube.com x 545,293 ops/sec ±0.65% (191 runs sampled)
+
+> node benchmark/parse.js
+
+ cookie.parse - generic
+
+ 6 tests completed.
+
+ simple x 1,266,646 ops/sec ±0.65% (191 runs sampled)
+ decode x 838,413 ops/sec ±0.60% (191 runs sampled)
+ unquote x 877,820 ops/sec ±0.72% (189 runs sampled)
+ duplicates x 516,680 ops/sec ±0.61% (191 runs sampled)
+ 10 cookies x 156,874 ops/sec ±0.52% (189 runs sampled)
+ 100 cookies x 14,663 ops/sec ±0.53% (191 runs sampled)
+```
+
+## References
+
+- [RFC 6265: HTTP State Management Mechanism][rfc-6265]
+- [Same-site Cookies][rfc-6265bis-03-4.1.2.7]
+
+[rfc-6265bis-03-4.1.2.7]: https://tools.ietf.org/html/draft-ietf-httpbis-rfc6265bis-03#section-4.1.2.7
+[rfc-6265]: https://tools.ietf.org/html/rfc6265
+[rfc-6265-5.1.4]: https://tools.ietf.org/html/rfc6265#section-5.1.4
+[rfc-6265-5.2.1]: https://tools.ietf.org/html/rfc6265#section-5.2.1
+[rfc-6265-5.2.2]: https://tools.ietf.org/html/rfc6265#section-5.2.2
+[rfc-6265-5.2.3]: https://tools.ietf.org/html/rfc6265#section-5.2.3
+[rfc-6265-5.2.4]: https://tools.ietf.org/html/rfc6265#section-5.2.4
+[rfc-6265-5.2.5]: https://tools.ietf.org/html/rfc6265#section-5.2.5
+[rfc-6265-5.2.6]: https://tools.ietf.org/html/rfc6265#section-5.2.6
+[rfc-6265-5.3]: https://tools.ietf.org/html/rfc6265#section-5.3
+
+## License
+
+[MIT](LICENSE)
+
+[coveralls-image]: https://badgen.net/coveralls/c/github/jshttp/cookie/master
+[coveralls-url]: https://coveralls.io/r/jshttp/cookie?branch=master
+[github-actions-ci-image]: https://img.shields.io/github/workflow/status/jshttp/cookie/ci/master?label=ci
+[github-actions-ci-url]: https://github.com/jshttp/cookie/actions/workflows/ci.yml
+[node-version-image]: https://badgen.net/npm/node/cookie
+[node-version-url]: https://nodejs.org/en/download
+[npm-downloads-image]: https://badgen.net/npm/dm/cookie
+[npm-url]: https://npmjs.org/package/cookie
+[npm-version-image]: https://badgen.net/npm/v/cookie
diff --git a/nginx-nodejs-redis/web/node_modules/cookie/index.js b/nginx-nodejs-redis/web/node_modules/cookie/index.js
new file mode 100644
index 0000000..55331d9
--- /dev/null
+++ b/nginx-nodejs-redis/web/node_modules/cookie/index.js
@@ -0,0 +1,202 @@
+/*!
+ * cookie
+ * Copyright(c) 2012-2014 Roman Shtylman
+ * Copyright(c) 2015 Douglas Christopher Wilson
+ * MIT Licensed
+ */
+
+'use strict';
+
+/**
+ * Module exports.
+ * @public
+ */
+
+exports.parse = parse;
+exports.serialize = serialize;
+
+/**
+ * Module variables.
+ * @private
+ */
+
+var decode = decodeURIComponent;
+var encode = encodeURIComponent;
+
+/**
+ * RegExp to match field-content in RFC 7230 sec 3.2
+ *
+ * field-content = field-vchar [ 1*( SP / HTAB ) field-vchar ]
+ * field-vchar = VCHAR / obs-text
+ * obs-text = %x80-FF
+ */
+
+var fieldContentRegExp = /^[\u0009\u0020-\u007e\u0080-\u00ff]+$/;
+
+/**
+ * Parse a cookie header.
+ *
+ * Parse the given cookie header string into an object
+ * The object has the various cookies as keys(names) => values
+ *
+ * @param {string} str
+ * @param {object} [options]
+ * @return {object}
+ * @public
+ */
+
+function parse(str, options) {
+ if (typeof str !== 'string') {
+ throw new TypeError('argument str must be a string');
+ }
+
+ var obj = {}
+ var opt = options || {};
+ var pairs = str.split(';')
+ var dec = opt.decode || decode;
+
+ for (var i = 0; i < pairs.length; i++) {
+ var pair = pairs[i];
+ var index = pair.indexOf('=')
+
+ // skip things that don't look like key=value
+ if (index < 0) {
+ continue;
+ }
+
+ var key = pair.substring(0, index).trim()
+
+ // only assign once
+ if (undefined == obj[key]) {
+ var val = pair.substring(index + 1, pair.length).trim()
+
+ // quoted values
+ if (val[0] === '"') {
+ val = val.slice(1, -1)
+ }
+
+ obj[key] = tryDecode(val, dec);
+ }
+ }
+
+ return obj;
+}
+
+/**
+ * Serialize data into a cookie header.
+ *
+ * Serialize the a name value pair into a cookie string suitable for
+ * http headers. An optional options object specified cookie parameters.
+ *
+ * serialize('foo', 'bar', { httpOnly: true })
+ * => "foo=bar; httpOnly"
+ *
+ * @param {string} name
+ * @param {string} val
+ * @param {object} [options]
+ * @return {string}
+ * @public
+ */
+
+function serialize(name, val, options) {
+ var opt = options || {};
+ var enc = opt.encode || encode;
+
+ if (typeof enc !== 'function') {
+ throw new TypeError('option encode is invalid');
+ }
+
+ if (!fieldContentRegExp.test(name)) {
+ throw new TypeError('argument name is invalid');
+ }
+
+ var value = enc(val);
+
+ if (value && !fieldContentRegExp.test(value)) {
+ throw new TypeError('argument val is invalid');
+ }
+
+ var str = name + '=' + value;
+
+ if (null != opt.maxAge) {
+ var maxAge = opt.maxAge - 0;
+
+ if (isNaN(maxAge) || !isFinite(maxAge)) {
+ throw new TypeError('option maxAge is invalid')
+ }
+
+ str += '; Max-Age=' + Math.floor(maxAge);
+ }
+
+ if (opt.domain) {
+ if (!fieldContentRegExp.test(opt.domain)) {
+ throw new TypeError('option domain is invalid');
+ }
+
+ str += '; Domain=' + opt.domain;
+ }
+
+ if (opt.path) {
+ if (!fieldContentRegExp.test(opt.path)) {
+ throw new TypeError('option path is invalid');
+ }
+
+ str += '; Path=' + opt.path;
+ }
+
+ if (opt.expires) {
+ if (typeof opt.expires.toUTCString !== 'function') {
+ throw new TypeError('option expires is invalid');
+ }
+
+ str += '; Expires=' + opt.expires.toUTCString();
+ }
+
+ if (opt.httpOnly) {
+ str += '; HttpOnly';
+ }
+
+ if (opt.secure) {
+ str += '; Secure';
+ }
+
+ if (opt.sameSite) {
+ var sameSite = typeof opt.sameSite === 'string'
+ ? opt.sameSite.toLowerCase() : opt.sameSite;
+
+ switch (sameSite) {
+ case true:
+ str += '; SameSite=Strict';
+ break;
+ case 'lax':
+ str += '; SameSite=Lax';
+ break;
+ case 'strict':
+ str += '; SameSite=Strict';
+ break;
+ case 'none':
+ str += '; SameSite=None';
+ break;
+ default:
+ throw new TypeError('option sameSite is invalid');
+ }
+ }
+
+ return str;
+}
+
+/**
+ * Try decoding a string using a decoding function.
+ *
+ * @param {string} str
+ * @param {function} decode
+ * @private
+ */
+
+function tryDecode(str, decode) {
+ try {
+ return decode(str);
+ } catch (e) {
+ return str;
+ }
+}
diff --git a/nginx-nodejs-redis/web/node_modules/cookie/package.json b/nginx-nodejs-redis/web/node_modules/cookie/package.json
new file mode 100644
index 0000000..27612d1
--- /dev/null
+++ b/nginx-nodejs-redis/web/node_modules/cookie/package.json
@@ -0,0 +1,80 @@
+{
+ "_from": "cookie@0.4.2",
+ "_id": "cookie@0.4.2",
+ "_inBundle": false,
+ "_integrity": "sha512-aSWTXFzaKWkvHO1Ny/s+ePFpvKsPnjc551iI41v3ny/ow6tBG5Vd+FuqGNhh1LxOmVzOlGUriIlOaokOvhaStA==",
+ "_location": "/cookie",
+ "_phantomChildren": {},
+ "_requested": {
+ "type": "version",
+ "registry": true,
+ "raw": "cookie@0.4.2",
+ "name": "cookie",
+ "escapedName": "cookie",
+ "rawSpec": "0.4.2",
+ "saveSpec": null,
+ "fetchSpec": "0.4.2"
+ },
+ "_requiredBy": [
+ "/express"
+ ],
+ "_resolved": "https://registry.npmjs.org/cookie/-/cookie-0.4.2.tgz",
+ "_shasum": "0e41f24de5ecf317947c82fc789e06a884824432",
+ "_spec": "cookie@0.4.2",
+ "_where": "/Users/ajeetraina/projects/13march/awesome-compose/nginx-nodejs-redis/web/node_modules/express",
+ "author": {
+ "name": "Roman Shtylman",
+ "email": "shtylman@gmail.com"
+ },
+ "bugs": {
+ "url": "https://github.com/jshttp/cookie/issues"
+ },
+ "bundleDependencies": false,
+ "contributors": [
+ {
+ "name": "Douglas Christopher Wilson",
+ "email": "doug@somethingdoug.com"
+ }
+ ],
+ "deprecated": false,
+ "description": "HTTP server cookie parsing and serialization",
+ "devDependencies": {
+ "beautify-benchmark": "0.2.4",
+ "benchmark": "2.1.4",
+ "eslint": "7.32.0",
+ "eslint-plugin-markdown": "2.2.1",
+ "mocha": "9.2.0",
+ "nyc": "15.1.0",
+ "top-sites": "1.1.85"
+ },
+ "engines": {
+ "node": ">= 0.6"
+ },
+ "files": [
+ "HISTORY.md",
+ "LICENSE",
+ "README.md",
+ "index.js"
+ ],
+ "homepage": "https://github.com/jshttp/cookie#readme",
+ "keywords": [
+ "cookie",
+ "cookies"
+ ],
+ "license": "MIT",
+ "name": "cookie",
+ "repository": {
+ "type": "git",
+ "url": "git+https://github.com/jshttp/cookie.git"
+ },
+ "scripts": {
+ "bench": "node benchmark/index.js",
+ "lint": "eslint .",
+ "test": "mocha --reporter spec --bail --check-leaks --ui qunit test/",
+ "test-ci": "nyc --reporter=lcov --reporter=text npm test",
+ "test-cov": "nyc --reporter=html --reporter=text npm test",
+ "update-bench": "node scripts/update-benchmark.js",
+ "version": "node scripts/version-history.js && git add HISTORY.md"
+ },
+ "version": "0.4.2"
+}
diff --git a/nginx-nodejs-redis/web/node_modules/debug/.coveralls.yml b/nginx-nodejs-redis/web/node_modules/debug/.coveralls.yml
new file mode 100644
index 0000000..20a7068
--- /dev/null
+++ b/nginx-nodejs-redis/web/node_modules/debug/.coveralls.yml
@@ -0,0 +1 @@
+repo_token: SIAeZjKYlHK74rbcFvNHMUzjRiMpflxve
diff --git a/nginx-nodejs-redis/web/node_modules/debug/.eslintrc b/nginx-nodejs-redis/web/node_modules/debug/.eslintrc
new file mode 100644
index 0000000..8a37ae2
--- /dev/null
+++ b/nginx-nodejs-redis/web/node_modules/debug/.eslintrc
@@ -0,0 +1,11 @@
+{
+ "env": {
+ "browser": true,
+ "node": true
+ },
+ "rules": {
+ "no-console": 0,
+ "no-empty": [1, { "allowEmptyCatch": true }]
+ },
+ "extends": "eslint:recommended"
+}
diff --git a/nginx-nodejs-redis/web/node_modules/debug/.npmignore b/nginx-nodejs-redis/web/node_modules/debug/.npmignore
new file mode 100644
index 0000000..5f60eec
--- /dev/null
+++ b/nginx-nodejs-redis/web/node_modules/debug/.npmignore
@@ -0,0 +1,9 @@
+support
+test
+examples
+example
+*.sock
+dist
+yarn.lock
+coverage
+bower.json
diff --git a/nginx-nodejs-redis/web/node_modules/debug/.travis.yml b/nginx-nodejs-redis/web/node_modules/debug/.travis.yml
new file mode 100644
index 0000000..6c6090c
--- /dev/null
+++ b/nginx-nodejs-redis/web/node_modules/debug/.travis.yml
@@ -0,0 +1,14 @@
+
+language: node_js
+node_js:
+ - "6"
+ - "5"
+ - "4"
+
+install:
+ - make node_modules
+
+script:
+ - make lint
+ - make test
+ - make coveralls
diff --git a/nginx-nodejs-redis/web/node_modules/debug/CHANGELOG.md b/nginx-nodejs-redis/web/node_modules/debug/CHANGELOG.md
new file mode 100644
index 0000000..eadaa18
--- /dev/null
+++ b/nginx-nodejs-redis/web/node_modules/debug/CHANGELOG.md
@@ -0,0 +1,362 @@
+
+2.6.9 / 2017-09-22
+==================
+
+ * remove ReDoS regexp in %o formatter (#504)
+
+2.6.8 / 2017-05-18
+==================
+
+ * Fix: Check for undefined on browser globals (#462, @marbemac)
+
+2.6.7 / 2017-05-16
+==================
+
+ * Fix: Update ms to 2.0.0 to fix regular expression denial of service vulnerability (#458, @hubdotcom)
+ * Fix: Inline extend function in node implementation (#452, @dougwilson)
+ * Docs: Fix typo (#455, @msasad)
+
+2.6.5 / 2017-04-27
+==================
+
+ * Fix: null reference check on window.documentElement.style.WebkitAppearance (#447, @thebigredgeek)
+ * Misc: clean up browser reference checks (#447, @thebigredgeek)
+ * Misc: add npm-debug.log to .gitignore (@thebigredgeek)
+
+
+2.6.4 / 2017-04-20
+==================
+
+ * Fix: bug that would occure if process.env.DEBUG is a non-string value. (#444, @LucianBuzzo)
+ * Chore: ignore bower.json in npm installations. (#437, @joaovieira)
+ * Misc: update "ms" to v0.7.3 (@tootallnate)
+
+2.6.3 / 2017-03-13
+==================
+
+ * Fix: Electron reference to `process.env.DEBUG` (#431, @paulcbetts)
+ * Docs: Changelog fix (@thebigredgeek)
+
+2.6.2 / 2017-03-10
+==================
+
+ * Fix: DEBUG_MAX_ARRAY_LENGTH (#420, @slavaGanzin)
+ * Docs: Add backers and sponsors from Open Collective (#422, @piamancini)
+ * Docs: Add Slackin invite badge (@tootallnate)
+
+2.6.1 / 2017-02-10
+==================
+
+ * Fix: Module's `export default` syntax fix for IE8 `Expected identifier` error
+ * Fix: Whitelist DEBUG_FD for values 1 and 2 only (#415, @pi0)
+ * Fix: IE8 "Expected identifier" error (#414, @vgoma)
+ * Fix: Namespaces would not disable once enabled (#409, @musikov)
+
+2.6.0 / 2016-12-28
+==================
+
+ * Fix: added better null pointer checks for browser useColors (@thebigredgeek)
+ * Improvement: removed explicit `window.debug` export (#404, @tootallnate)
+ * Improvement: deprecated `DEBUG_FD` environment variable (#405, @tootallnate)
+
+2.5.2 / 2016-12-25
+==================
+
+ * Fix: reference error on window within webworkers (#393, @KlausTrainer)
+ * Docs: fixed README typo (#391, @lurch)
+ * Docs: added notice about v3 api discussion (@thebigredgeek)
+
+2.5.1 / 2016-12-20
+==================
+
+ * Fix: babel-core compatibility
+
+2.5.0 / 2016-12-20
+==================
+
+ * Fix: wrong reference in bower file (@thebigredgeek)
+ * Fix: webworker compatibility (@thebigredgeek)
+ * Fix: output formatting issue (#388, @kribblo)
+ * Fix: babel-loader compatibility (#383, @escwald)
+ * Misc: removed built asset from repo and publications (@thebigredgeek)
+ * Misc: moved source files to /src (#378, @yamikuronue)
+ * Test: added karma integration and replaced babel with browserify for browser tests (#378, @yamikuronue)
+ * Test: coveralls integration (#378, @yamikuronue)
+ * Docs: simplified language in the opening paragraph (#373, @yamikuronue)
+
+2.4.5 / 2016-12-17
+==================
+
+ * Fix: `navigator` undefined in Rhino (#376, @jochenberger)
+ * Fix: custom log function (#379, @hsiliev)
+ * Improvement: bit of cleanup + linting fixes (@thebigredgeek)
+ * Improvement: rm non-maintainted `dist/` dir (#375, @freewil)
+ * Docs: simplified language in the opening paragraph. (#373, @yamikuronue)
+
+2.4.4 / 2016-12-14
+==================
+
+ * Fix: work around debug being loaded in preload scripts for electron (#368, @paulcbetts)
+
+2.4.3 / 2016-12-14
+==================
+
+ * Fix: navigation.userAgent error for react native (#364, @escwald)
+
+2.4.2 / 2016-12-14
+==================
+
+ * Fix: browser colors (#367, @tootallnate)
+ * Misc: travis ci integration (@thebigredgeek)
+ * Misc: added linting and testing boilerplate with sanity check (@thebigredgeek)
+
+2.4.1 / 2016-12-13
+==================
+
+ * Fix: typo that broke the package (#356)
+
+2.4.0 / 2016-12-13
+==================
+
+ * Fix: bower.json references unbuilt src entry point (#342, @justmatt)
+ * Fix: revert "handle regex special characters" (@tootallnate)
+ * Feature: configurable util.inspect()`options for NodeJS (#327, @tootallnate)
+ * Feature: %O`(big O) pretty-prints objects (#322, @tootallnate)
+ * Improvement: allow colors in workers (#335, @botverse)
+ * Improvement: use same color for same namespace. (#338, @lchenay)
+
+2.3.3 / 2016-11-09
+==================
+
+ * Fix: Catch `JSON.stringify()` errors (#195, Jovan Alleyne)
+ * Fix: Returning `localStorage` saved values (#331, Levi Thomason)
+ * Improvement: Don't create an empty object when no `process` (Nathan Rajlich)
+
+2.3.2 / 2016-11-09
+==================
+
+ * Fix: be super-safe in index.js as well (@TooTallNate)
+ * Fix: should check whether process exists (Tom Newby)
+
+2.3.1 / 2016-11-09
+==================
+
+ * Fix: Added electron compatibility (#324, @paulcbetts)
+ * Improvement: Added performance optimizations (@tootallnate)
+ * Readme: Corrected PowerShell environment variable example (#252, @gimre)
+ * Misc: Removed yarn lock file from source control (#321, @fengmk2)
+
+2.3.0 / 2016-11-07
+==================
+
+ * Fix: Consistent placement of ms diff at end of output (#215, @gorangajic)
+ * Fix: Escaping of regex special characters in namespace strings (#250, @zacronos)
+ * Fix: Fixed bug causing crash on react-native (#282, @vkarpov15)
+ * Feature: Enabled ES6+ compatible import via default export (#212 @bucaran)
+ * Feature: Added %O formatter to reflect Chrome's console.log capability (#279, @oncletom)
+ * Package: Update "ms" to 0.7.2 (#315, @DevSide)
+ * Package: removed superfluous version property from bower.json (#207 @kkirsche)
+ * Readme: fix USE_COLORS to DEBUG_COLORS
+ * Readme: Doc fixes for format string sugar (#269, @mlucool)
+ * Readme: Updated docs for DEBUG_FD and DEBUG_COLORS environment variables (#232, @mattlyons0)
+ * Readme: doc fixes for PowerShell (#271 #243, @exoticknight @unreadable)
+ * Readme: better docs for browser support (#224, @matthewmueller)
+ * Tooling: Added yarn integration for development (#317, @thebigredgeek)
+ * Misc: Renamed History.md to CHANGELOG.md (@thebigredgeek)
+ * Misc: Added license file (#226 #274, @CantemoInternal @sdaitzman)
+ * Misc: Updated contributors (@thebigredgeek)
+
+2.2.0 / 2015-05-09
+==================
+
+ * package: update "ms" to v0.7.1 (#202, @dougwilson)
+ * README: add logging to file example (#193, @DanielOchoa)
+ * README: fixed a typo (#191, @amir-s)
+ * browser: expose `storage` (#190, @stephenmathieson)
+ * Makefile: add a `distclean` target (#189, @stephenmathieson)
+
+2.1.3 / 2015-03-13
+==================
+
+ * Updated stdout/stderr example (#186)
+ * Updated example/stdout.js to match debug current behaviour
+ * Renamed example/stderr.js to stdout.js
+ * Update Readme.md (#184)
+ * replace high intensity foreground color for bold (#182, #183)
+
+2.1.2 / 2015-03-01
+==================
+
+ * dist: recompile
+ * update "ms" to v0.7.0
+ * package: update "browserify" to v9.0.3
+ * component: fix "ms.js" repo location
+ * changed bower package name
+ * updated documentation about using debug in a browser
+ * fix: security error on safari (#167, #168, @yields)
+
+2.1.1 / 2014-12-29
+==================
+
+ * browser: use `typeof` to check for `console` existence
+ * browser: check for `console.log` truthiness (fix IE 8/9)
+ * browser: add support for Chrome apps
+ * Readme: added Windows usage remarks
+ * Add `bower.json` to properly support bower install
+
+2.1.0 / 2014-10-15
+==================
+
+ * node: implement `DEBUG_FD` env variable support
+ * package: update "browserify" to v6.1.0
+ * package: add "license" field to package.json (#135, @panuhorsmalahti)
+
+2.0.0 / 2014-09-01
+==================
+
+ * package: update "browserify" to v5.11.0
+ * node: use stderr rather than stdout for logging (#29, @stephenmathieson)
+
+1.0.4 / 2014-07-15
+==================
+
+ * dist: recompile
+ * example: remove `console.info()` log usage
+ * example: add "Content-Type" UTF-8 header to browser example
+ * browser: place %c marker after the space character
+ * browser: reset the "content" color via `color: inherit`
+ * browser: add colors support for Firefox >= v31
+ * debug: prefer an instance `log()` function over the global one (#119)
+ * Readme: update documentation about styled console logs for FF v31 (#116, @wryk)
+
+1.0.3 / 2014-07-09
+==================
+
+ * Add support for multiple wildcards in namespaces (#122, @seegno)
+ * browser: fix lint
+
+1.0.2 / 2014-06-10
+==================
+
+ * browser: update color palette (#113, @gscottolson)
+ * common: make console logging function configurable (#108, @timoxley)
+ * node: fix %o colors on old node <= 0.8.x
+ * Makefile: find node path using shell/which (#109, @timoxley)
+
+1.0.1 / 2014-06-06
+==================
+
+ * browser: use `removeItem()` to clear localStorage
+ * browser, node: don't set DEBUG if namespaces is undefined (#107, @leedm777)
+ * package: add "contributors" section
+ * node: fix comment typo
+ * README: list authors
+
+1.0.0 / 2014-06-04
+==================
+
+ * make ms diff be global, not be scope
+ * debug: ignore empty strings in enable()
+ * node: make DEBUG_COLORS able to disable coloring
+ * *: export the `colors` array
+ * npmignore: don't publish the `dist` dir
+ * Makefile: refactor to use browserify
+ * package: add "browserify" as a dev dependency
+ * Readme: add Web Inspector Colors section
+ * node: reset terminal color for the debug content
+ * node: map "%o" to `util.inspect()`
+ * browser: map "%j" to `JSON.stringify()`
+ * debug: add custom "formatters"
+ * debug: use "ms" module for humanizing the diff
+ * Readme: add "bash" syntax highlighting
+ * browser: add Firebug color support
+ * browser: add colors for WebKit browsers
+ * node: apply log to `console`
+ * rewrite: abstract common logic for Node & browsers
+ * add .jshintrc file
+
+0.8.1 / 2014-04-14
+==================
+
+ * package: re-add the "component" section
+
+0.8.0 / 2014-03-30
+==================
+
+ * add `enable()` method for nodejs. Closes #27
+ * change from stderr to stdout
+ * remove unnecessary index.js file
+
+0.7.4 / 2013-11-13
+==================
+
+ * remove "browserify" key from package.json (fixes something in browserify)
+
+0.7.3 / 2013-10-30
+==================
+
+ * fix: catch localStorage security error when cookies are blocked (Chrome)
+ * add debug(err) support. Closes #46
+ * add .browser prop to package.json. Closes #42
+
+0.7.2 / 2013-02-06
+==================
+
+ * fix package.json
+ * fix: Mobile Safari (private mode) is broken with debug
+ * fix: Use unicode to send escape character to shell instead of octal to work with strict mode javascript
+
+0.7.1 / 2013-02-05
+==================
+
+ * add repository URL to package.json
+ * add DEBUG_COLORED to force colored output
+ * add browserify support
+ * fix component. Closes #24
+
+0.7.0 / 2012-05-04
+==================
+
+ * Added .component to package.json
+ * Added debug.component.js build
+
+0.6.0 / 2012-03-16
+==================
+
+ * Added support for "-" prefix in DEBUG [Vinay Pulim]
+ * Added `.enabled` flag to the node version [TooTallNate]
+
+0.5.0 / 2012-02-02
+==================
+
+ * Added: humanize diffs. Closes #8
+ * Added `debug.disable()` to the CS variant
+ * Removed padding. Closes #10
+ * Fixed: persist client-side variant again. Closes #9
+
+0.4.0 / 2012-02-01
+==================
+
+ * Added browser variant support for older browsers [TooTallNate]
+ * Added `debug.enable('project:*')` to browser variant [TooTallNate]
+ * Added padding to diff (moved it to the right)
+
+0.3.0 / 2012-01-26
+==================
+
+ * Added millisecond diff when isatty, otherwise UTC string
+
+0.2.0 / 2012-01-22
+==================
+
+ * Added wildcard support
+
+0.1.0 / 2011-12-02
+==================
+
+ * Added: remove colors unless stderr isatty [TooTallNate]
+
+0.0.1 / 2010-01-03
+==================
+
+ * Initial release
diff --git a/nginx-nodejs-redis/web/node_modules/debug/LICENSE b/nginx-nodejs-redis/web/node_modules/debug/LICENSE
new file mode 100644
index 0000000..658c933
--- /dev/null
+++ b/nginx-nodejs-redis/web/node_modules/debug/LICENSE
@@ -0,0 +1,19 @@
+(The MIT License)
+
+Copyright (c) 2014 TJ Holowaychuk
+
+Permission is hereby granted, free of charge, to any person obtaining a copy of this software
+and associated documentation files (the 'Software'), to deal in the Software without restriction,
+including without limitation the rights to use, copy, modify, merge, publish, distribute, sublicense,
+and/or sell copies of the Software, and to permit persons to whom the Software is furnished to do so,
+subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in all copies or substantial
+portions of the Software.
+
+THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED, INCLUDING BUT NOT
+LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.
+IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY,
+WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE
+SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
+
diff --git a/nginx-nodejs-redis/web/node_modules/debug/Makefile b/nginx-nodejs-redis/web/node_modules/debug/Makefile
new file mode 100644
index 0000000..584da8b
--- /dev/null
+++ b/nginx-nodejs-redis/web/node_modules/debug/Makefile
@@ -0,0 +1,50 @@
+# get Makefile directory name: http://stackoverflow.com/a/5982798/376773
+THIS_MAKEFILE_PATH:=$(word $(words $(MAKEFILE_LIST)),$(MAKEFILE_LIST))
+THIS_DIR:=$(shell cd $(dir $(THIS_MAKEFILE_PATH));pwd)
+
+# BIN directory
+BIN := $(THIS_DIR)/node_modules/.bin
+
+# Path
+PATH := node_modules/.bin:$(PATH)
+SHELL := /bin/bash
+
+# applications
+NODE ?= $(shell which node)
+YARN ?= $(shell which yarn)
+PKG ?= $(if $(YARN),$(YARN),$(NODE) $(shell which npm))
+BROWSERIFY ?= $(NODE) $(BIN)/browserify
+
+.FORCE:
+
+install: node_modules
+
+node_modules: package.json
+ @NODE_ENV= $(PKG) install
+ @touch node_modules
+
+lint: .FORCE
+ eslint browser.js debug.js index.js node.js
+
+test-node: .FORCE
+ istanbul cover node_modules/mocha/bin/_mocha -- test/**.js
+
+test-browser: .FORCE
+ mkdir -p dist
+
+ @$(BROWSERIFY) \
+ --standalone debug \
+ . > dist/debug.js
+
+ karma start --single-run
+ rimraf dist
+
+test: .FORCE
+ concurrently \
+ "make test-node" \
+ "make test-browser"
+
+coveralls:
+ cat ./coverage/lcov.info | ./node_modules/coveralls/bin/coveralls.js
+
+.PHONY: all install clean distclean
diff --git a/nginx-nodejs-redis/web/node_modules/debug/README.md b/nginx-nodejs-redis/web/node_modules/debug/README.md
new file mode 100644
index 0000000..f67be6b
--- /dev/null
+++ b/nginx-nodejs-redis/web/node_modules/debug/README.md
@@ -0,0 +1,312 @@
+# debug
+[](https://travis-ci.org/visionmedia/debug) [](https://coveralls.io/github/visionmedia/debug?branch=master) [](https://visionmedia-community-slackin.now.sh/) [](#backers)
+[](#sponsors)
+
+
+
+A tiny node.js debugging utility modelled after node core's debugging technique.
+
+**Discussion around the V3 API is under way [here](https://github.com/visionmedia/debug/issues/370)**
+
+## Installation
+
+```bash
+$ npm install debug
+```
+
+## Usage
+
+`debug` exposes a function; simply pass this function the name of your module, and it will return a decorated version of `console.error` for you to pass debug statements to. This will allow you to toggle the debug output for different parts of your module as well as the module as a whole.
+
+Example _app.js_:
+
+```js
+var debug = require('debug')('http')
+ , http = require('http')
+ , name = 'My App';
+
+// fake app
+
+debug('booting %s', name);
+
+http.createServer(function(req, res){
+ debug(req.method + ' ' + req.url);
+ res.end('hello\n');
+}).listen(3000, function(){
+ debug('listening');
+});
+
+// fake worker of some kind
+
+require('./worker');
+```
+
+Example _worker.js_:
+
+```js
+var debug = require('debug')('worker');
+
+setInterval(function(){
+ debug('doing some work');
+}, 1000);
+```
+
+ The __DEBUG__ environment variable is then used to enable these based on space or comma-delimited names. Here are some examples:
+
+ 
+
+ 
+
+#### Windows note
+
+ On Windows the environment variable is set using the `set` command.
+
+ ```cmd
+ set DEBUG=*,-not_this
+ ```
+
+ Note that PowerShell uses different syntax to set environment variables.
+
+ ```cmd
+ $env:DEBUG = "*,-not_this"
+ ```
+
+Then, run the program to be debugged as usual.
+
+## Millisecond diff
+
+ When actively developing an application it can be useful to see when the time spent between one `debug()` call and the next. Suppose for example you invoke `debug()` before requesting a resource, and after as well, the "+NNNms" will show you how much time was spent between calls.
+
+ 
+
+ When stdout is not a TTY, `Date#toUTCString()` is used, making it more useful for logging the debug information as shown below:
+
+ 
+
+## Conventions
+
+ If you're using this in one or more of your libraries, you _should_ use the name of your library so that developers may toggle debugging as desired without guessing names. If you have more than one debuggers you _should_ prefix them with your library name and use ":" to separate features. For example "bodyParser" from Connect would then be "connect:bodyParser".
+
+## Wildcards
+
+ The `*` character may be used as a wildcard. Suppose for example your library has debuggers named "connect:bodyParser", "connect:compress", "connect:session", instead of listing all three with `DEBUG=connect:bodyParser,connect:compress,connect:session`, you may simply do `DEBUG=connect:*`, or to run everything using this module simply use `DEBUG=*`.
+
+ You can also exclude specific debuggers by prefixing them with a "-" character. For example, `DEBUG=*,-connect:*` would include all debuggers except those starting with "connect:".
+
+## Environment Variables
+
+ When running through Node.js, you can set a few environment variables that will
+ change the behavior of the debug logging:
+
+| Name | Purpose |
+|-----------|-------------------------------------------------|
+| `DEBUG` | Enables/disables specific debugging namespaces. |
+| `DEBUG_COLORS`| Whether or not to use colors in the debug output. |
+| `DEBUG_DEPTH` | Object inspection depth. |
+| `DEBUG_SHOW_HIDDEN` | Shows hidden properties on inspected objects. |
+
+
+ __Note:__ The environment variables beginning with `DEBUG_` end up being
+ converted into an Options object that gets used with `%o`/`%O` formatters.
+ See the Node.js documentation for
+ [`util.inspect()`](https://nodejs.org/api/util.html#util_util_inspect_object_options)
+ for the complete list.
+
+## Formatters
+
+
+ Debug uses [printf-style](https://wikipedia.org/wiki/Printf_format_string) formatting. Below are the officially supported formatters:
+
+| Formatter | Representation |
+|-----------|----------------|
+| `%O` | Pretty-print an Object on multiple lines. |
+| `%o` | Pretty-print an Object all on a single line. |
+| `%s` | String. |
+| `%d` | Number (both integer and float). |
+| `%j` | JSON. Replaced with the string '[Circular]' if the argument contains circular references. |
+| `%%` | Single percent sign ('%'). This does not consume an argument. |
+
+### Custom formatters
+
+ You can add custom formatters by extending the `debug.formatters` object. For example, if you wanted to add support for rendering a Buffer as hex with `%h`, you could do something like:
+
+```js
+const createDebug = require('debug')
+createDebug.formatters.h = (v) => {
+ return v.toString('hex')
+}
+
+// …elsewhere
+const debug = createDebug('foo')
+debug('this is hex: %h', new Buffer('hello world'))
+// foo this is hex: 68656c6c6f20776f726c6421 +0ms
+```
+
+## Browser support
+ You can build a browser-ready script using [browserify](https://github.com/substack/node-browserify),
+ or just use the [browserify-as-a-service](https://wzrd.in/) [build](https://wzrd.in/standalone/debug@latest),
+ if you don't want to build it yourself.
+
+ Debug's enable state is currently persisted by `localStorage`.
+ Consider the situation shown below where you have `worker:a` and `worker:b`,
+ and wish to debug both. You can enable this using `localStorage.debug`:
+
+```js
+localStorage.debug = 'worker:*'
+```
+
+And then refresh the page.
+
+```js
+a = debug('worker:a');
+b = debug('worker:b');
+
+setInterval(function(){
+ a('doing some work');
+}, 1000);
+
+setInterval(function(){
+ b('doing some work');
+}, 1200);
+```
+
+#### Web Inspector Colors
+
+ Colors are also enabled on "Web Inspectors" that understand the `%c` formatting
+ option. These are WebKit web inspectors, Firefox ([since version
+ 31](https://hacks.mozilla.org/2014/05/editable-box-model-multiple-selection-sublime-text-keys-much-more-firefox-developer-tools-episode-31/))
+ and the Firebug plugin for Firefox (any version).
+
+ Colored output looks something like:
+
+ 
+
+
+## Output streams
+
+ By default `debug` will log to stderr, however this can be configured per-namespace by overriding the `log` method:
+
+Example _stdout.js_:
+
+```js
+var debug = require('debug');
+var error = debug('app:error');
+
+// by default stderr is used
+error('goes to stderr!');
+
+var log = debug('app:log');
+// set this namespace to log via console.log
+log.log = console.log.bind(console); // don't forget to bind to console!
+log('goes to stdout');
+error('still goes to stderr!');
+
+// set all output to go via console.info
+// overrides all per-namespace log settings
+debug.log = console.info.bind(console);
+error('now goes to stdout via console.info');
+log('still goes to stdout, but via console.info now');
+```
+
+
+## Authors
+
+ - TJ Holowaychuk
+ - Nathan Rajlich
+ - Andrew Rhyne
+
+## Backers
+
+Support us with a monthly donation and help us continue our activities. [[Become a backer](https://opencollective.com/debug#backer)]
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+## Sponsors
+
+Become a sponsor and get your logo on our README on Github with a link to your site. [[Become a sponsor](https://opencollective.com/debug#sponsor)]
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+## License
+
+(The MIT License)
+
+Copyright (c) 2014-2016 TJ Holowaychuk <tj@vision-media.ca>
+
+Permission is hereby granted, free of charge, to any person obtaining
+a copy of this software and associated documentation files (the
+'Software'), to deal in the Software without restriction, including
+without limitation the rights to use, copy, modify, merge, publish,
+distribute, sublicense, and/or sell copies of the Software, and to
+permit persons to whom the Software is furnished to do so, subject to
+the following conditions:
+
+The above copyright notice and this permission notice shall be
+included in all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND,
+EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.
+IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY
+CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT,
+TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE
+SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
diff --git a/nginx-nodejs-redis/web/node_modules/debug/component.json b/nginx-nodejs-redis/web/node_modules/debug/component.json
new file mode 100644
index 0000000..9de2641
--- /dev/null
+++ b/nginx-nodejs-redis/web/node_modules/debug/component.json
@@ -0,0 +1,19 @@
+{
+ "name": "debug",
+ "repo": "visionmedia/debug",
+ "description": "small debugging utility",
+ "version": "2.6.9",
+ "keywords": [
+ "debug",
+ "log",
+ "debugger"
+ ],
+ "main": "src/browser.js",
+ "scripts": [
+ "src/browser.js",
+ "src/debug.js"
+ ],
+ "dependencies": {
+ "rauchg/ms.js": "0.7.1"
+ }
+}
diff --git a/nginx-nodejs-redis/web/node_modules/debug/karma.conf.js b/nginx-nodejs-redis/web/node_modules/debug/karma.conf.js
new file mode 100644
index 0000000..103a82d
--- /dev/null
+++ b/nginx-nodejs-redis/web/node_modules/debug/karma.conf.js
@@ -0,0 +1,70 @@
+// Karma configuration
+// Generated on Fri Dec 16 2016 13:09:51 GMT+0000 (UTC)
+
+module.exports = function(config) {
+ config.set({
+
+ // base path that will be used to resolve all patterns (eg. files, exclude)
+ basePath: '',
+
+
+ // frameworks to use
+ // available frameworks: https://npmjs.org/browse/keyword/karma-adapter
+ frameworks: ['mocha', 'chai', 'sinon'],
+
+
+ // list of files / patterns to load in the browser
+ files: [
+ 'dist/debug.js',
+ 'test/*spec.js'
+ ],
+
+
+ // list of files to exclude
+ exclude: [
+ 'src/node.js'
+ ],
+
+
+ // preprocess matching files before serving them to the browser
+ // available preprocessors: https://npmjs.org/browse/keyword/karma-preprocessor
+ preprocessors: {
+ },
+
+ // test results reporter to use
+ // possible values: 'dots', 'progress'
+ // available reporters: https://npmjs.org/browse/keyword/karma-reporter
+ reporters: ['progress'],
+
+
+ // web server port
+ port: 9876,
+
+
+ // enable / disable colors in the output (reporters and logs)
+ colors: true,
+
+
+ // level of logging
+ // possible values: config.LOG_DISABLE || config.LOG_ERROR || config.LOG_WARN || config.LOG_INFO || config.LOG_DEBUG
+ logLevel: config.LOG_INFO,
+
+
+ // enable / disable watching file and executing tests whenever any file changes
+ autoWatch: true,
+
+
+ // start these browsers
+ // available browser launchers: https://npmjs.org/browse/keyword/karma-launcher
+ browsers: ['PhantomJS'],
+
+
+ // Continuous Integration mode
+ // if true, Karma captures browsers, runs the tests and exits
+ singleRun: false,
+
+ // Concurrency level
+ // how many browser should be started simultaneous
+ concurrency: Infinity
+ })
+}
diff --git a/nginx-nodejs-redis/web/node_modules/debug/node.js b/nginx-nodejs-redis/web/node_modules/debug/node.js
new file mode 100644
index 0000000..7fc36fe
--- /dev/null
+++ b/nginx-nodejs-redis/web/node_modules/debug/node.js
@@ -0,0 +1 @@
+module.exports = require('./src/node');
diff --git a/nginx-nodejs-redis/web/node_modules/debug/package.json b/nginx-nodejs-redis/web/node_modules/debug/package.json
new file mode 100644
index 0000000..4469ff6
--- /dev/null
+++ b/nginx-nodejs-redis/web/node_modules/debug/package.json
@@ -0,0 +1,91 @@
+{
+ "_from": "debug@2.6.9",
+ "_id": "debug@2.6.9",
+ "_inBundle": false,
+ "_integrity": "sha512-bC7ElrdJaJnPbAP+1EotYvqZsb3ecl5wi6Bfi6BJTUcNowp6cvspg0jXznRTKDjm/E7AdgFBVeAPVMNcKGsHMA==",
+ "_location": "/debug",
+ "_phantomChildren": {},
+ "_requested": {
+ "type": "version",
+ "registry": true,
+ "raw": "debug@2.6.9",
+ "name": "debug",
+ "escapedName": "debug",
+ "rawSpec": "2.6.9",
+ "saveSpec": null,
+ "fetchSpec": "2.6.9"
+ },
+ "_requiredBy": [
+ "/body-parser",
+ "/express",
+ "/finalhandler",
+ "/send"
+ ],
+ "_resolved": "https://registry.npmjs.org/debug/-/debug-2.6.9.tgz",
+ "_shasum": "5d128515df134ff327e90a4c93f4e077a536341f",
+ "_spec": "debug@2.6.9",
+ "_where": "/Users/ajeetraina/projects/13march/awesome-compose/nginx-nodejs-redis/web/node_modules/express",
+ "author": {
+ "name": "TJ Holowaychuk",
+ "email": "tj@vision-media.ca"
+ },
+ "browser": "./src/browser.js",
+ "bugs": {
+ "url": "https://github.com/visionmedia/debug/issues"
+ },
+ "bundleDependencies": false,
+ "component": {
+ "scripts": {
+ "debug/index.js": "browser.js",
+ "debug/debug.js": "debug.js"
+ }
+ },
+ "contributors": [
+ {
+ "name": "Nathan Rajlich",
+ "email": "nathan@tootallnate.net",
+ "url": "http://n8.io"
+ },
+ {
+ "name": "Andrew Rhyne",
+ "email": "rhyneandrew@gmail.com"
+ }
+ ],
+ "dependencies": {
+ "ms": "2.0.0"
+ },
+ "deprecated": false,
+ "description": "small debugging utility",
+ "devDependencies": {
+ "browserify": "9.0.3",
+ "chai": "^3.5.0",
+ "concurrently": "^3.1.0",
+ "coveralls": "^2.11.15",
+ "eslint": "^3.12.1",
+ "istanbul": "^0.4.5",
+ "karma": "^1.3.0",
+ "karma-chai": "^0.1.0",
+ "karma-mocha": "^1.3.0",
+ "karma-phantomjs-launcher": "^1.0.2",
+ "karma-sinon": "^1.0.5",
+ "mocha": "^3.2.0",
+ "mocha-lcov-reporter": "^1.2.0",
+ "rimraf": "^2.5.4",
+ "sinon": "^1.17.6",
+ "sinon-chai": "^2.8.0"
+ },
+ "homepage": "https://github.com/visionmedia/debug#readme",
+ "keywords": [
+ "debug",
+ "log",
+ "debugger"
+ ],
+ "license": "MIT",
+ "main": "./src/index.js",
+ "name": "debug",
+ "repository": {
+ "type": "git",
+ "url": "git://github.com/visionmedia/debug.git"
+ },
+ "version": "2.6.9"
+}
diff --git a/nginx-nodejs-redis/web/node_modules/debug/src/browser.js b/nginx-nodejs-redis/web/node_modules/debug/src/browser.js
new file mode 100644
index 0000000..7106924
--- /dev/null
+++ b/nginx-nodejs-redis/web/node_modules/debug/src/browser.js
@@ -0,0 +1,185 @@
+/**
+ * This is the web browser implementation of `debug()`.
+ *
+ * Expose `debug()` as the module.
+ */
+
+exports = module.exports = require('./debug');
+exports.log = log;
+exports.formatArgs = formatArgs;
+exports.save = save;
+exports.load = load;
+exports.useColors = useColors;
+exports.storage = 'undefined' != typeof chrome
+ && 'undefined' != typeof chrome.storage
+ ? chrome.storage.local
+ : localstorage();
+
+/**
+ * Colors.
+ */
+
+exports.colors = [
+ 'lightseagreen',
+ 'forestgreen',
+ 'goldenrod',
+ 'dodgerblue',
+ 'darkorchid',
+ 'crimson'
+];
+
+/**
+ * Currently only WebKit-based Web Inspectors, Firefox >= v31,
+ * and the Firebug extension (any Firefox version) are known
+ * to support "%c" CSS customizations.
+ *
+ * TODO: add a `localStorage` variable to explicitly enable/disable colors
+ */
+
+function useColors() {
+ // NB: In an Electron preload script, document will be defined but not fully
+ // initialized. Since we know we're in Chrome, we'll just detect this case
+ // explicitly
+ if (typeof window !== 'undefined' && window.process && window.process.type === 'renderer') {
+ return true;
+ }
+
+ // is webkit? http://stackoverflow.com/a/16459606/376773
+ // document is undefined in react-native: https://github.com/facebook/react-native/pull/1632
+ return (typeof document !== 'undefined' && document.documentElement && document.documentElement.style && document.documentElement.style.WebkitAppearance) ||
+ // is firebug? http://stackoverflow.com/a/398120/376773
+ (typeof window !== 'undefined' && window.console && (window.console.firebug || (window.console.exception && window.console.table))) ||
+ // is firefox >= v31?
+ // https://developer.mozilla.org/en-US/docs/Tools/Web_Console#Styling_messages
+ (typeof navigator !== 'undefined' && navigator.userAgent && navigator.userAgent.toLowerCase().match(/firefox\/(\d+)/) && parseInt(RegExp.$1, 10) >= 31) ||
+ // double check webkit in userAgent just in case we are in a worker
+ (typeof navigator !== 'undefined' && navigator.userAgent && navigator.userAgent.toLowerCase().match(/applewebkit\/(\d+)/));
+}
+
+/**
+ * Map %j to `JSON.stringify()`, since no Web Inspectors do that by default.
+ */
+
+exports.formatters.j = function(v) {
+ try {
+ return JSON.stringify(v);
+ } catch (err) {
+ return '[UnexpectedJSONParseError]: ' + err.message;
+ }
+};
+
+
+/**
+ * Colorize log arguments if enabled.
+ *
+ * @api public
+ */
+
+function formatArgs(args) {
+ var useColors = this.useColors;
+
+ args[0] = (useColors ? '%c' : '')
+ + this.namespace
+ + (useColors ? ' %c' : ' ')
+ + args[0]
+ + (useColors ? '%c ' : ' ')
+ + '+' + exports.humanize(this.diff);
+
+ if (!useColors) return;
+
+ var c = 'color: ' + this.color;
+ args.splice(1, 0, c, 'color: inherit')
+
+ // the final "%c" is somewhat tricky, because there could be other
+ // arguments passed either before or after the %c, so we need to
+ // figure out the correct index to insert the CSS into
+ var index = 0;
+ var lastC = 0;
+ args[0].replace(/%[a-zA-Z%]/g, function(match) {
+ if ('%%' === match) return;
+ index++;
+ if ('%c' === match) {
+ // we only are interested in the *last* %c
+ // (the user may have provided their own)
+ lastC = index;
+ }
+ });
+
+ args.splice(lastC, 0, c);
+}
+
+/**
+ * Invokes `console.log()` when available.
+ * No-op when `console.log` is not a "function".
+ *
+ * @api public
+ */
+
+function log() {
+ // this hackery is required for IE8/9, where
+ // the `console.log` function doesn't have 'apply'
+ return 'object' === typeof console
+ && console.log
+ && Function.prototype.apply.call(console.log, console, arguments);
+}
+
+/**
+ * Save `namespaces`.
+ *
+ * @param {String} namespaces
+ * @api private
+ */
+
+function save(namespaces) {
+ try {
+ if (null == namespaces) {
+ exports.storage.removeItem('debug');
+ } else {
+ exports.storage.debug = namespaces;
+ }
+ } catch(e) {}
+}
+
+/**
+ * Load `namespaces`.
+ *
+ * @return {String} returns the previously persisted debug modes
+ * @api private
+ */
+
+function load() {
+ var r;
+ try {
+ r = exports.storage.debug;
+ } catch(e) {}
+
+ // If debug isn't set in LS, and we're in Electron, try to load $DEBUG
+ if (!r && typeof process !== 'undefined' && 'env' in process) {
+ r = process.env.DEBUG;
+ }
+
+ return r;
+}
+
+/**
+ * Enable namespaces listed in `localStorage.debug` initially.
+ */
+
+exports.enable(load());
+
+/**
+ * Localstorage attempts to return the localstorage.
+ *
+ * This is necessary because safari throws
+ * when a user disables cookies/localstorage
+ * and you attempt to access it.
+ *
+ * @return {LocalStorage}
+ * @api private
+ */
+
+function localstorage() {
+ try {
+ return window.localStorage;
+ } catch (e) {}
+}
diff --git a/nginx-nodejs-redis/web/node_modules/debug/src/debug.js b/nginx-nodejs-redis/web/node_modules/debug/src/debug.js
new file mode 100644
index 0000000..6a5e3fc
--- /dev/null
+++ b/nginx-nodejs-redis/web/node_modules/debug/src/debug.js
@@ -0,0 +1,202 @@
+
+/**
+ * This is the common logic for both the Node.js and web browser
+ * implementations of `debug()`.
+ *
+ * Expose `debug()` as the module.
+ */
+
+exports = module.exports = createDebug.debug = createDebug['default'] = createDebug;
+exports.coerce = coerce;
+exports.disable = disable;
+exports.enable = enable;
+exports.enabled = enabled;
+exports.humanize = require('ms');
+
+/**
+ * The currently active debug mode names, and names to skip.
+ */
+
+exports.names = [];
+exports.skips = [];
+
+/**
+ * Map of special "%n" handling functions, for the debug "format" argument.
+ *
+ * Valid key names are a single, lower or upper-case letter, i.e. "n" and "N".
+ */
+
+exports.formatters = {};
+
+/**
+ * Previous log timestamp.
+ */
+
+var prevTime;
+
+/**
+ * Select a color.
+ * @param {String} namespace
+ * @return {Number}
+ * @api private
+ */
+
+function selectColor(namespace) {
+ var hash = 0, i;
+
+ for (i in namespace) {
+ hash = ((hash << 5) - hash) + namespace.charCodeAt(i);
+ hash |= 0; // Convert to 32bit integer
+ }
+
+ return exports.colors[Math.abs(hash) % exports.colors.length];
+}
+
+/**
+ * Create a debugger with the given `namespace`.
+ *
+ * @param {String} namespace
+ * @return {Function}
+ * @api public
+ */
+
+function createDebug(namespace) {
+
+ function debug() {
+ // disabled?
+ if (!debug.enabled) return;
+
+ var self = debug;
+
+ // set `diff` timestamp
+ var curr = +new Date();
+ var ms = curr - (prevTime || curr);
+ self.diff = ms;
+ self.prev = prevTime;
+ self.curr = curr;
+ prevTime = curr;
+
+ // turn the `arguments` into a proper Array
+ var args = new Array(arguments.length);
+ for (var i = 0; i < args.length; i++) {
+ args[i] = arguments[i];
+ }
+
+ args[0] = exports.coerce(args[0]);
+
+ if ('string' !== typeof args[0]) {
+ // anything else let's inspect with %O
+ args.unshift('%O');
+ }
+
+ // apply any `formatters` transformations
+ var index = 0;
+ args[0] = args[0].replace(/%([a-zA-Z%])/g, function(match, format) {
+ // if we encounter an escaped % then don't increase the array index
+ if (match === '%%') return match;
+ index++;
+ var formatter = exports.formatters[format];
+ if ('function' === typeof formatter) {
+ var val = args[index];
+ match = formatter.call(self, val);
+
+ // now we need to remove `args[index]` since it's inlined in the `format`
+ args.splice(index, 1);
+ index--;
+ }
+ return match;
+ });
+
+ // apply env-specific formatting (colors, etc.)
+ exports.formatArgs.call(self, args);
+
+ var logFn = debug.log || exports.log || console.log.bind(console);
+ logFn.apply(self, args);
+ }
+
+ debug.namespace = namespace;
+ debug.enabled = exports.enabled(namespace);
+ debug.useColors = exports.useColors();
+ debug.color = selectColor(namespace);
+
+ // env-specific initialization logic for debug instances
+ if ('function' === typeof exports.init) {
+ exports.init(debug);
+ }
+
+ return debug;
+}
+
+/**
+ * Enables a debug mode by namespaces. This can include modes
+ * separated by a colon and wildcards.
+ *
+ * @param {String} namespaces
+ * @api public
+ */
+
+function enable(namespaces) {
+ exports.save(namespaces);
+
+ exports.names = [];
+ exports.skips = [];
+
+ var split = (typeof namespaces === 'string' ? namespaces : '').split(/[\s,]+/);
+ var len = split.length;
+
+ for (var i = 0; i < len; i++) {
+ if (!split[i]) continue; // ignore empty strings
+ namespaces = split[i].replace(/\*/g, '.*?');
+ if (namespaces[0] === '-') {
+ exports.skips.push(new RegExp('^' + namespaces.substr(1) + '$'));
+ } else {
+ exports.names.push(new RegExp('^' + namespaces + '$'));
+ }
+ }
+}
+
+/**
+ * Disable debug output.
+ *
+ * @api public
+ */
+
+function disable() {
+ exports.enable('');
+}
+
+/**
+ * Returns true if the given mode name is enabled, false otherwise.
+ *
+ * @param {String} name
+ * @return {Boolean}
+ * @api public
+ */
+
+function enabled(name) {
+ var i, len;
+ for (i = 0, len = exports.skips.length; i < len; i++) {
+ if (exports.skips[i].test(name)) {
+ return false;
+ }
+ }
+ for (i = 0, len = exports.names.length; i < len; i++) {
+ if (exports.names[i].test(name)) {
+ return true;
+ }
+ }
+ return false;
+}
+
+/**
+ * Coerce `val`.
+ *
+ * @param {Mixed} val
+ * @return {Mixed}
+ * @api private
+ */
+
+function coerce(val) {
+ if (val instanceof Error) return val.stack || val.message;
+ return val;
+}
diff --git a/nginx-nodejs-redis/web/node_modules/debug/src/index.js b/nginx-nodejs-redis/web/node_modules/debug/src/index.js
new file mode 100644
index 0000000..e12cf4d
--- /dev/null
+++ b/nginx-nodejs-redis/web/node_modules/debug/src/index.js
@@ -0,0 +1,10 @@
+/**
+ * Detect Electron renderer process, which is node, but we should
+ * treat as a browser.
+ */
+
+if (typeof process !== 'undefined' && process.type === 'renderer') {
+ module.exports = require('./browser.js');
+} else {
+ module.exports = require('./node.js');
+}
diff --git a/nginx-nodejs-redis/web/node_modules/debug/src/inspector-log.js b/nginx-nodejs-redis/web/node_modules/debug/src/inspector-log.js
new file mode 100644
index 0000000..60ea6c0
--- /dev/null
+++ b/nginx-nodejs-redis/web/node_modules/debug/src/inspector-log.js
@@ -0,0 +1,15 @@
+module.exports = inspectorLog;
+
+// black hole
+const nullStream = new (require('stream').Writable)();
+nullStream._write = () => {};
+
+/**
+ * Outputs a `console.log()` to the Node.js Inspector console *only*.
+ */
+function inspectorLog() {
+ const stdout = console._stdout;
+ console._stdout = nullStream;
+ console.log.apply(console, arguments);
+ console._stdout = stdout;
+}
diff --git a/nginx-nodejs-redis/web/node_modules/debug/src/node.js b/nginx-nodejs-redis/web/node_modules/debug/src/node.js
new file mode 100644
index 0000000..b15109c
--- /dev/null
+++ b/nginx-nodejs-redis/web/node_modules/debug/src/node.js
@@ -0,0 +1,248 @@
+/**
+ * Module dependencies.
+ */
+
+var tty = require('tty');
+var util = require('util');
+
+/**
+ * This is the Node.js implementation of `debug()`.
+ *
+ * Expose `debug()` as the module.
+ */
+
+exports = module.exports = require('./debug');
+exports.init = init;
+exports.log = log;
+exports.formatArgs = formatArgs;
+exports.save = save;
+exports.load = load;
+exports.useColors = useColors;
+
+/**
+ * Colors.
+ */
+
+exports.colors = [6, 2, 3, 4, 5, 1];
+
+/**
+ * Build up the default `inspectOpts` object from the environment variables.
+ *
+ * $ DEBUG_COLORS=no DEBUG_DEPTH=10 DEBUG_SHOW_HIDDEN=enabled node script.js
+ */
+
+exports.inspectOpts = Object.keys(process.env).filter(function (key) {
+ return /^debug_/i.test(key);
+}).reduce(function (obj, key) {
+ // camel-case
+ var prop = key
+ .substring(6)
+ .toLowerCase()
+ .replace(/_([a-z])/g, function (_, k) { return k.toUpperCase() });
+
+ // coerce string value into JS value
+ var val = process.env[key];
+ if (/^(yes|on|true|enabled)$/i.test(val)) val = true;
+ else if (/^(no|off|false|disabled)$/i.test(val)) val = false;
+ else if (val === 'null') val = null;
+ else val = Number(val);
+
+ obj[prop] = val;
+ return obj;
+}, {});
+
+/**
+ * The file descriptor to write the `debug()` calls to.
+ * Set the `DEBUG_FD` env variable to override with another value. i.e.:
+ *
+ * $ DEBUG_FD=3 node script.js 3>debug.log
+ */
+
+var fd = parseInt(process.env.DEBUG_FD, 10) || 2;
+
+if (1 !== fd && 2 !== fd) {
+ util.deprecate(function(){}, 'except for stderr(2) and stdout(1), any other usage of DEBUG_FD is deprecated. Override debug.log if you want to use a different log function (https://git.io/debug_fd)')()
+}
+
+var stream = 1 === fd ? process.stdout :
+ 2 === fd ? process.stderr :
+ createWritableStdioStream(fd);
+
+/**
+ * Is stdout a TTY? Colored output is enabled when `true`.
+ */
+
+function useColors() {
+ return 'colors' in exports.inspectOpts
+ ? Boolean(exports.inspectOpts.colors)
+ : tty.isatty(fd);
+}
+
+/**
+ * Map %o to `util.inspect()`, all on a single line.
+ */
+
+exports.formatters.o = function(v) {
+ this.inspectOpts.colors = this.useColors;
+ return util.inspect(v, this.inspectOpts)
+ .split('\n').map(function(str) {
+ return str.trim()
+ }).join(' ');
+};
+
+/**
+ * Map %o to `util.inspect()`, allowing multiple lines if needed.
+ */
+
+exports.formatters.O = function(v) {
+ this.inspectOpts.colors = this.useColors;
+ return util.inspect(v, this.inspectOpts);
+};
+
+/**
+ * Adds ANSI color escape codes if enabled.
+ *
+ * @api public
+ */
+
+function formatArgs(args) {
+ var name = this.namespace;
+ var useColors = this.useColors;
+
+ if (useColors) {
+ var c = this.color;
+ var prefix = ' \u001b[3' + c + ';1m' + name + ' ' + '\u001b[0m';
+
+ args[0] = prefix + args[0].split('\n').join('\n' + prefix);
+ args.push('\u001b[3' + c + 'm+' + exports.humanize(this.diff) + '\u001b[0m');
+ } else {
+ args[0] = new Date().toUTCString()
+ + ' ' + name + ' ' + args[0];
+ }
+}
+
+/**
+ * Invokes `util.format()` with the specified arguments and writes to `stream`.
+ */
+
+function log() {
+ return stream.write(util.format.apply(util, arguments) + '\n');
+}
+
+/**
+ * Save `namespaces`.
+ *
+ * @param {String} namespaces
+ * @api private
+ */
+
+function save(namespaces) {
+ if (null == namespaces) {
+ // If you set a process.env field to null or undefined, it gets cast to the
+ // string 'null' or 'undefined'. Just delete instead.
+ delete process.env.DEBUG;
+ } else {
+ process.env.DEBUG = namespaces;
+ }
+}
+
+/**
+ * Load `namespaces`.
+ *
+ * @return {String} returns the previously persisted debug modes
+ * @api private
+ */
+
+function load() {
+ return process.env.DEBUG;
+}
+
+/**
+ * Copied from `node/src/node.js`.
+ *
+ * XXX: It's lame that node doesn't expose this API out-of-the-box. It also
+ * relies on the undocumented `tty_wrap.guessHandleType()` which is also lame.
+ */
+
+function createWritableStdioStream (fd) {
+ var stream;
+ var tty_wrap = process.binding('tty_wrap');
+
+ // Note stream._type is used for test-module-load-list.js
+
+ switch (tty_wrap.guessHandleType(fd)) {
+ case 'TTY':
+ stream = new tty.WriteStream(fd);
+ stream._type = 'tty';
+
+ // Hack to have stream not keep the event loop alive.
+ // See https://github.com/joyent/node/issues/1726
+ if (stream._handle && stream._handle.unref) {
+ stream._handle.unref();
+ }
+ break;
+
+ case 'FILE':
+ var fs = require('fs');
+ stream = new fs.SyncWriteStream(fd, { autoClose: false });
+ stream._type = 'fs';
+ break;
+
+ case 'PIPE':
+ case 'TCP':
+ var net = require('net');
+ stream = new net.Socket({
+ fd: fd,
+ readable: false,
+ writable: true
+ });
+
+ // FIXME Should probably have an option in net.Socket to create a
+ // stream from an existing fd which is writable only. But for now
+ // we'll just add this hack and set the `readable` member to false.
+ // Test: ./node test/fixtures/echo.js < /etc/passwd
+ stream.readable = false;
+ stream.read = null;
+ stream._type = 'pipe';
+
+ // FIXME Hack to have stream not keep the event loop alive.
+ // See https://github.com/joyent/node/issues/1726
+ if (stream._handle && stream._handle.unref) {
+ stream._handle.unref();
+ }
+ break;
+
+ default:
+ // Probably an error on in uv_guess_handle()
+ throw new Error('Implement me. Unknown stream file type!');
+ }
+
+ // For supporting legacy API we put the FD here.
+ stream.fd = fd;
+
+ stream._isStdio = true;
+
+ return stream;
+}
+
+/**
+ * Init logic for `debug` instances.
+ *
+ * Create a new `inspectOpts` object in case `useColors` is set
+ * differently for a particular `debug` instance.
+ */
+
+function init (debug) {
+ debug.inspectOpts = {};
+
+ var keys = Object.keys(exports.inspectOpts);
+ for (var i = 0; i < keys.length; i++) {
+ debug.inspectOpts[keys[i]] = exports.inspectOpts[keys[i]];
+ }
+}
+
+/**
+ * Enable namespaces listed in `process.env.DEBUG` initially.
+ */
+
+exports.enable(load());
diff --git a/nginx-nodejs-redis/web/node_modules/denque/CHANGELOG.md b/nginx-nodejs-redis/web/node_modules/denque/CHANGELOG.md
new file mode 100644
index 0000000..123d6ef
--- /dev/null
+++ b/nginx-nodejs-redis/web/node_modules/denque/CHANGELOG.md
@@ -0,0 +1,8 @@
+## 1.5.1
+
+ - perf: minor performance tweak when growing queue size (#29)
+
+## 1.5.0
+
+ - feat: adds capacity option for circular buffers (#27)
+
diff --git a/nginx-nodejs-redis/web/node_modules/denque/LICENSE b/nginx-nodejs-redis/web/node_modules/denque/LICENSE
new file mode 100644
index 0000000..fd22a2d
--- /dev/null
+++ b/nginx-nodejs-redis/web/node_modules/denque/LICENSE
@@ -0,0 +1,13 @@
+Copyright (c) 2018 Mike Diarmid (Salakar)
+
+Licensed under the Apache License, Version 2.0 (the "License");
+you may not use this library except in compliance with the License.
+You may obtain a copy of the License at
+
+ http://www.apache.org/licenses/LICENSE-2.0
+
+Unless required by applicable law or agreed to in writing, software
+distributed under the License is distributed on an "AS IS" BASIS,
+WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+See the License for the specific language governing permissions and
+limitations under the License.
diff --git a/nginx-nodejs-redis/web/node_modules/denque/README.md b/nginx-nodejs-redis/web/node_modules/denque/README.md
new file mode 100644
index 0000000..886d2dd
--- /dev/null
+++ b/nginx-nodejs-redis/web/node_modules/denque/README.md
@@ -0,0 +1,77 @@
+
+
Denque
+
+
+
+
+
+
+
+
+
+
+
+Denque is a well tested, extremely fast and lightweight [double-ended queue](http://en.wikipedia.org/wiki/Double-ended_queue)
+implementation with zero dependencies and includes TypeScript types.
+
+Double-ended queues can also be used as a:
+
+- [Stack](http://en.wikipedia.org/wiki/Stack_\(abstract_data_type\))
+- [Queue](http://en.wikipedia.org/wiki/Queue_\(data_structure\))
+
+This implementation is currently the fastest available, even faster than `double-ended-queue`, see the [benchmarks](https://docs.page/invertase/denque/benchmarks).
+
+Every queue operation is done at a constant `O(1)` - including random access from `.peekAt(index)`.
+
+**Works on all node versions >= v0.10**
+
+## Quick Start
+
+Install the package:
+
+```bash
+npm install denque
+```
+
+Create and consume a queue:
+
+```js
+const Denque = require("denque");
+
+const denque = new Denque([1,2,3,4]);
+denque.shift(); // 1
+denque.pop(); // 4
+```
+
+
+See the [API reference documentation](https://docs.page/invertase/denque/api) for more examples.
+
+---
+
+## Who's using it?
+
+- [Kafka Node.js client](https://www.npmjs.com/package/kafka-node)
+- [MariaDB Node.js client](https://www.npmjs.com/package/mariadb)
+- [MongoDB Node.js client](https://www.npmjs.com/package/mongodb)
+- [MySQL Node.js client](https://www.npmjs.com/package/mysql2)
+- [Redis Node.js clients](https://www.npmjs.com/package/redis)
+
+... and [many more](https://www.npmjs.com/browse/depended/denque).
+
+
+---
+
+## License
+
+- See [LICENSE](/LICENSE)
+
+---
+
+
+
+
+
+
+ Built and maintained by Invertase.
+
+
diff --git a/nginx-nodejs-redis/web/node_modules/denque/index.d.ts b/nginx-nodejs-redis/web/node_modules/denque/index.d.ts
new file mode 100644
index 0000000..05d7123
--- /dev/null
+++ b/nginx-nodejs-redis/web/node_modules/denque/index.d.ts
@@ -0,0 +1,31 @@
+declare class Denque {
+ constructor();
+ constructor(array: T[]);
+ constructor(array: T[], options: IDenqueOptions);
+
+ push(item: T): number;
+ unshift(item: T): number;
+ pop(): T | undefined;
+ removeBack(): T | undefined;
+ shift(): T | undefined;
+ peekBack(): T | undefined;
+ peekFront(): T | undefined;
+ peekAt(index: number): T | undefined;
+ get(index: number): T | undefined;
+ remove(index: number, count: number): T[];
+ removeOne(index: number): T | undefined;
+ splice(index: number, count: number, ...item: T[]): T[] | undefined;
+ isEmpty(): boolean;
+ clear(): void;
+
+ toString(): string;
+ toArray(): T[];
+
+ length: number;
+}
+
+interface IDenqueOptions {
+ capacity?: number
+}
+
+export = Denque;
diff --git a/nginx-nodejs-redis/web/node_modules/denque/index.js b/nginx-nodejs-redis/web/node_modules/denque/index.js
new file mode 100644
index 0000000..c809f08
--- /dev/null
+++ b/nginx-nodejs-redis/web/node_modules/denque/index.js
@@ -0,0 +1,443 @@
+'use strict';
+
+/**
+ * Custom implementation of a double ended queue.
+ */
+function Denque(array, options) {
+ var options = options || {};
+
+ this._head = 0;
+ this._tail = 0;
+ this._capacity = options.capacity;
+ this._capacityMask = 0x3;
+ this._list = new Array(4);
+ if (Array.isArray(array)) {
+ this._fromArray(array);
+ }
+}
+
+/**
+ * -------------
+ * PUBLIC API
+ * -------------
+ */
+
+/**
+ * Returns the item at the specified index from the list.
+ * 0 is the first element, 1 is the second, and so on...
+ * Elements at negative values are that many from the end: -1 is one before the end
+ * (the last element), -2 is two before the end (one before last), etc.
+ * @param index
+ * @returns {*}
+ */
+Denque.prototype.peekAt = function peekAt(index) {
+ var i = index;
+ // expect a number or return undefined
+ if ((i !== (i | 0))) {
+ return void 0;
+ }
+ var len = this.size();
+ if (i >= len || i < -len) return undefined;
+ if (i < 0) i += len;
+ i = (this._head + i) & this._capacityMask;
+ return this._list[i];
+};
+
+/**
+ * Alias for peekAt()
+ * @param i
+ * @returns {*}
+ */
+Denque.prototype.get = function get(i) {
+ return this.peekAt(i);
+};
+
+/**
+ * Returns the first item in the list without removing it.
+ * @returns {*}
+ */
+Denque.prototype.peek = function peek() {
+ if (this._head === this._tail) return undefined;
+ return this._list[this._head];
+};
+
+/**
+ * Alias for peek()
+ * @returns {*}
+ */
+Denque.prototype.peekFront = function peekFront() {
+ return this.peek();
+};
+
+/**
+ * Returns the item that is at the back of the queue without removing it.
+ * Uses peekAt(-1)
+ */
+Denque.prototype.peekBack = function peekBack() {
+ return this.peekAt(-1);
+};
+
+/**
+ * Returns the current length of the queue
+ * @return {Number}
+ */
+Object.defineProperty(Denque.prototype, 'length', {
+ get: function length() {
+ return this.size();
+ }
+});
+
+/**
+ * Return the number of items on the list, or 0 if empty.
+ * @returns {number}
+ */
+Denque.prototype.size = function size() {
+ if (this._head === this._tail) return 0;
+ if (this._head < this._tail) return this._tail - this._head;
+ else return this._capacityMask + 1 - (this._head - this._tail);
+};
+
+/**
+ * Add an item at the beginning of the list.
+ * @param item
+ */
+Denque.prototype.unshift = function unshift(item) {
+ if (item === undefined) return this.size();
+ var len = this._list.length;
+ this._head = (this._head - 1 + len) & this._capacityMask;
+ this._list[this._head] = item;
+ if (this._tail === this._head) this._growArray();
+ if (this._capacity && this.size() > this._capacity) this.pop();
+ if (this._head < this._tail) return this._tail - this._head;
+ else return this._capacityMask + 1 - (this._head - this._tail);
+};
+
+/**
+ * Remove and return the first item on the list,
+ * Returns undefined if the list is empty.
+ * @returns {*}
+ */
+Denque.prototype.shift = function shift() {
+ var head = this._head;
+ if (head === this._tail) return undefined;
+ var item = this._list[head];
+ this._list[head] = undefined;
+ this._head = (head + 1) & this._capacityMask;
+ if (head < 2 && this._tail > 10000 && this._tail <= this._list.length >>> 2) this._shrinkArray();
+ return item;
+};
+
+/**
+ * Add an item to the bottom of the list.
+ * @param item
+ */
+Denque.prototype.push = function push(item) {
+ if (item === undefined) return this.size();
+ var tail = this._tail;
+ this._list[tail] = item;
+ this._tail = (tail + 1) & this._capacityMask;
+ if (this._tail === this._head) {
+ this._growArray();
+ }
+ if (this._capacity && this.size() > this._capacity) {
+ this.shift();
+ }
+ if (this._head < this._tail) return this._tail - this._head;
+ else return this._capacityMask + 1 - (this._head - this._tail);
+};
+
+/**
+ * Remove and return the last item on the list.
+ * Returns undefined if the list is empty.
+ * @returns {*}
+ */
+Denque.prototype.pop = function pop() {
+ var tail = this._tail;
+ if (tail === this._head) return undefined;
+ var len = this._list.length;
+ this._tail = (tail - 1 + len) & this._capacityMask;
+ var item = this._list[this._tail];
+ this._list[this._tail] = undefined;
+ if (this._head < 2 && tail > 10000 && tail <= len >>> 2) this._shrinkArray();
+ return item;
+};
+
+/**
+ * Remove and return the item at the specified index from the list.
+ * Returns undefined if the list is empty.
+ * @param index
+ * @returns {*}
+ */
+Denque.prototype.removeOne = function removeOne(index) {
+ var i = index;
+ // expect a number or return undefined
+ if ((i !== (i | 0))) {
+ return void 0;
+ }
+ if (this._head === this._tail) return void 0;
+ var size = this.size();
+ var len = this._list.length;
+ if (i >= size || i < -size) return void 0;
+ if (i < 0) i += size;
+ i = (this._head + i) & this._capacityMask;
+ var item = this._list[i];
+ var k;
+ if (index < size / 2) {
+ for (k = index; k > 0; k--) {
+ this._list[i] = this._list[i = (i - 1 + len) & this._capacityMask];
+ }
+ this._list[i] = void 0;
+ this._head = (this._head + 1 + len) & this._capacityMask;
+ } else {
+ for (k = size - 1 - index; k > 0; k--) {
+ this._list[i] = this._list[i = ( i + 1 + len) & this._capacityMask];
+ }
+ this._list[i] = void 0;
+ this._tail = (this._tail - 1 + len) & this._capacityMask;
+ }
+ return item;
+};
+
+/**
+ * Remove number of items from the specified index from the list.
+ * Returns array of removed items.
+ * Returns undefined if the list is empty.
+ * @param index
+ * @param count
+ * @returns {array}
+ */
+Denque.prototype.remove = function remove(index, count) {
+ var i = index;
+ var removed;
+ var del_count = count;
+ // expect a number or return undefined
+ if ((i !== (i | 0))) {
+ return void 0;
+ }
+ if (this._head === this._tail) return void 0;
+ var size = this.size();
+ var len = this._list.length;
+ if (i >= size || i < -size || count < 1) return void 0;
+ if (i < 0) i += size;
+ if (count === 1 || !count) {
+ removed = new Array(1);
+ removed[0] = this.removeOne(i);
+ return removed;
+ }
+ if (i === 0 && i + count >= size) {
+ removed = this.toArray();
+ this.clear();
+ return removed;
+ }
+ if (i + count > size) count = size - i;
+ var k;
+ removed = new Array(count);
+ for (k = 0; k < count; k++) {
+ removed[k] = this._list[(this._head + i + k) & this._capacityMask];
+ }
+ i = (this._head + i) & this._capacityMask;
+ if (index + count === size) {
+ this._tail = (this._tail - count + len) & this._capacityMask;
+ for (k = count; k > 0; k--) {
+ this._list[i = (i + 1 + len) & this._capacityMask] = void 0;
+ }
+ return removed;
+ }
+ if (index === 0) {
+ this._head = (this._head + count + len) & this._capacityMask;
+ for (k = count - 1; k > 0; k--) {
+ this._list[i = (i + 1 + len) & this._capacityMask] = void 0;
+ }
+ return removed;
+ }
+ if (i < size / 2) {
+ this._head = (this._head + index + count + len) & this._capacityMask;
+ for (k = index; k > 0; k--) {
+ this.unshift(this._list[i = (i - 1 + len) & this._capacityMask]);
+ }
+ i = (this._head - 1 + len) & this._capacityMask;
+ while (del_count > 0) {
+ this._list[i = (i - 1 + len) & this._capacityMask] = void 0;
+ del_count--;
+ }
+ if (index < 0) this._tail = i;
+ } else {
+ this._tail = i;
+ i = (i + count + len) & this._capacityMask;
+ for (k = size - (count + index); k > 0; k--) {
+ this.push(this._list[i++]);
+ }
+ i = this._tail;
+ while (del_count > 0) {
+ this._list[i = (i + 1 + len) & this._capacityMask] = void 0;
+ del_count--;
+ }
+ }
+ if (this._head < 2 && this._tail > 10000 && this._tail <= len >>> 2) this._shrinkArray();
+ return removed;
+};
+
+/**
+ * Native splice implementation.
+ * Remove number of items from the specified index from the list and/or add new elements.
+ * Returns array of removed items or empty array if count == 0.
+ * Returns undefined if the list is empty.
+ *
+ * @param index
+ * @param count
+ * @param {...*} [elements]
+ * @returns {array}
+ */
+Denque.prototype.splice = function splice(index, count) {
+ var i = index;
+ // expect a number or return undefined
+ if ((i !== (i | 0))) {
+ return void 0;
+ }
+ var size = this.size();
+ if (i < 0) i += size;
+ if (i > size) return void 0;
+ if (arguments.length > 2) {
+ var k;
+ var temp;
+ var removed;
+ var arg_len = arguments.length;
+ var len = this._list.length;
+ var arguments_index = 2;
+ if (!size || i < size / 2) {
+ temp = new Array(i);
+ for (k = 0; k < i; k++) {
+ temp[k] = this._list[(this._head + k) & this._capacityMask];
+ }
+ if (count === 0) {
+ removed = [];
+ if (i > 0) {
+ this._head = (this._head + i + len) & this._capacityMask;
+ }
+ } else {
+ removed = this.remove(i, count);
+ this._head = (this._head + i + len) & this._capacityMask;
+ }
+ while (arg_len > arguments_index) {
+ this.unshift(arguments[--arg_len]);
+ }
+ for (k = i; k > 0; k--) {
+ this.unshift(temp[k - 1]);
+ }
+ } else {
+ temp = new Array(size - (i + count));
+ var leng = temp.length;
+ for (k = 0; k < leng; k++) {
+ temp[k] = this._list[(this._head + i + count + k) & this._capacityMask];
+ }
+ if (count === 0) {
+ removed = [];
+ if (i != size) {
+ this._tail = (this._head + i + len) & this._capacityMask;
+ }
+ } else {
+ removed = this.remove(i, count);
+ this._tail = (this._tail - leng + len) & this._capacityMask;
+ }
+ while (arguments_index < arg_len) {
+ this.push(arguments[arguments_index++]);
+ }
+ for (k = 0; k < leng; k++) {
+ this.push(temp[k]);
+ }
+ }
+ return removed;
+ } else {
+ return this.remove(i, count);
+ }
+};
+
+/**
+ * Soft clear - does not reset capacity.
+ */
+Denque.prototype.clear = function clear() {
+ this._head = 0;
+ this._tail = 0;
+};
+
+/**
+ * Returns true or false whether the list is empty.
+ * @returns {boolean}
+ */
+Denque.prototype.isEmpty = function isEmpty() {
+ return this._head === this._tail;
+};
+
+/**
+ * Returns an array of all queue items.
+ * @returns {Array}
+ */
+Denque.prototype.toArray = function toArray() {
+ return this._copyArray(false);
+};
+
+/**
+ * -------------
+ * INTERNALS
+ * -------------
+ */
+
+/**
+ * Fills the queue with items from an array
+ * For use in the constructor
+ * @param array
+ * @private
+ */
+Denque.prototype._fromArray = function _fromArray(array) {
+ for (var i = 0; i < array.length; i++) this.push(array[i]);
+};
+
+/**
+ *
+ * @param fullCopy
+ * @returns {Array}
+ * @private
+ */
+Denque.prototype._copyArray = function _copyArray(fullCopy) {
+ var newArray = [];
+ var list = this._list;
+ var len = list.length;
+ var i;
+ if (fullCopy || this._head > this._tail) {
+ for (i = this._head; i < len; i++) newArray.push(list[i]);
+ for (i = 0; i < this._tail; i++) newArray.push(list[i]);
+ } else {
+ for (i = this._head; i < this._tail; i++) newArray.push(list[i]);
+ }
+ return newArray;
+};
+
+/**
+ * Grows the internal list array.
+ * @private
+ */
+Denque.prototype._growArray = function _growArray() {
+ if (this._head) {
+ // copy existing data, head to end, then beginning to tail.
+ this._list = this._copyArray(true);
+ this._head = 0;
+ }
+
+ // head is at 0 and array is now full, safe to extend
+ this._tail = this._list.length;
+
+ this._list.length <<= 1;
+ this._capacityMask = (this._capacityMask << 1) | 1;
+};
+
+/**
+ * Shrinks the internal list array.
+ * @private
+ */
+Denque.prototype._shrinkArray = function _shrinkArray() {
+ this._list.length >>>= 1;
+ this._capacityMask >>>= 1;
+};
+
+
+module.exports = Denque;
diff --git a/nginx-nodejs-redis/web/node_modules/denque/package.json b/nginx-nodejs-redis/web/node_modules/denque/package.json
new file mode 100644
index 0000000..a709815
--- /dev/null
+++ b/nginx-nodejs-redis/web/node_modules/denque/package.json
@@ -0,0 +1,84 @@
+{
+ "_from": "denque@^1.5.0",
+ "_id": "denque@1.5.1",
+ "_inBundle": false,
+ "_integrity": "sha512-XwE+iZ4D6ZUB7mfYRMb5wByE8L74HCn30FBN7sWnXksWc1LO1bPDl67pBR9o/kC4z/xSNAwkMYcGgqDV3BE3Hw==",
+ "_location": "/denque",
+ "_phantomChildren": {},
+ "_requested": {
+ "type": "range",
+ "registry": true,
+ "raw": "denque@^1.5.0",
+ "name": "denque",
+ "escapedName": "denque",
+ "rawSpec": "^1.5.0",
+ "saveSpec": null,
+ "fetchSpec": "^1.5.0"
+ },
+ "_requiredBy": [
+ "/redis"
+ ],
+ "_resolved": "https://registry.npmjs.org/denque/-/denque-1.5.1.tgz",
+ "_shasum": "07f670e29c9a78f8faecb2566a1e2c11929c5cbf",
+ "_spec": "denque@^1.5.0",
+ "_where": "/Users/ajeetraina/projects/13march/awesome-compose/nginx-nodejs-redis/web/node_modules/redis",
+ "author": {
+ "name": "Invertase",
+ "email": "oss@invertase.io",
+ "url": "http://github.com/invertase/"
+ },
+ "bugs": {
+ "url": "https://github.com/invertase/denque/issues"
+ },
+ "bundleDependencies": false,
+ "contributors": [
+ {
+ "name": "Mike Diarmid",
+ "email": "mike@invertase.io",
+ "url": "Salakar"
+ }
+ ],
+ "deprecated": false,
+ "description": "The fastest javascript implementation of a double-ended queue. Used by the official Redis, MongoDB, MariaDB & MySQL libraries for Node.js and many other libraries. Maintains compatability with deque.",
+ "devDependencies": {
+ "benchmark": "^2.1.4",
+ "codecov": "^3.8.3",
+ "double-ended-queue": "^2.1.0-0",
+ "istanbul": "^0.4.5",
+ "mocha": "^3.5.3",
+ "typescript": "^3.4.1"
+ },
+ "engines": {
+ "node": ">=0.10"
+ },
+ "homepage": "https://docs.page/invertase/denque",
+ "keywords": [
+ "data-structure",
+ "data-structures",
+ "queue",
+ "double",
+ "end",
+ "ended",
+ "deque",
+ "denque",
+ "double-ended-queue"
+ ],
+ "license": "Apache-2.0",
+ "main": "index.js",
+ "name": "denque",
+ "repository": {
+ "type": "git",
+ "url": "git+https://github.com/invertase/denque.git"
+ },
+ "scripts": {
+ "benchmark_2mil": "node benchmark/two_million",
+ "benchmark_remove": "node benchmark/remove",
+ "benchmark_removeOne": "node benchmark/removeOne",
+ "benchmark_splice": "node benchmark/splice",
+ "benchmark_thousand": "node benchmark/thousand",
+ "coveralls": "cat ./coverage/lcov.info | coveralls",
+ "test": "istanbul cover --report lcov _mocha && npm run typescript",
+ "typescript": "tsc --project ./test/type/tsconfig.json"
+ },
+ "version": "1.5.1"
+}
diff --git a/nginx-nodejs-redis/web/node_modules/depd/History.md b/nginx-nodejs-redis/web/node_modules/depd/History.md
new file mode 100644
index 0000000..507ecb8
--- /dev/null
+++ b/nginx-nodejs-redis/web/node_modules/depd/History.md
@@ -0,0 +1,96 @@
+1.1.2 / 2018-01-11
+==================
+
+ * perf: remove argument reassignment
+ * Support Node.js 0.6 to 9.x
+
+1.1.1 / 2017-07-27
+==================
+
+ * Remove unnecessary `Buffer` loading
+ * Support Node.js 0.6 to 8.x
+
+1.1.0 / 2015-09-14
+==================
+
+ * Enable strict mode in more places
+ * Support io.js 3.x
+ * Support io.js 2.x
+ * Support web browser loading
+ - Requires bundler like Browserify or webpack
+
+1.0.1 / 2015-04-07
+==================
+
+ * Fix `TypeError`s when under `'use strict'` code
+ * Fix useless type name on auto-generated messages
+ * Support io.js 1.x
+ * Support Node.js 0.12
+
+1.0.0 / 2014-09-17
+==================
+
+ * No changes
+
+0.4.5 / 2014-09-09
+==================
+
+ * Improve call speed to functions using the function wrapper
+ * Support Node.js 0.6
+
+0.4.4 / 2014-07-27
+==================
+
+ * Work-around v8 generating empty stack traces
+
+0.4.3 / 2014-07-26
+==================
+
+ * Fix exception when global `Error.stackTraceLimit` is too low
+
+0.4.2 / 2014-07-19
+==================
+
+ * Correct call site for wrapped functions and properties
+
+0.4.1 / 2014-07-19
+==================
+
+ * Improve automatic message generation for function properties
+
+0.4.0 / 2014-07-19
+==================
+
+ * Add `TRACE_DEPRECATION` environment variable
+ * Remove non-standard grey color from color output
+ * Support `--no-deprecation` argument
+ * Support `--trace-deprecation` argument
+ * Support `deprecate.property(fn, prop, message)`
+
+0.3.0 / 2014-06-16
+==================
+
+ * Add `NO_DEPRECATION` environment variable
+
+0.2.0 / 2014-06-15
+==================
+
+ * Add `deprecate.property(obj, prop, message)`
+ * Remove `supports-color` dependency for node.js 0.8
+
+0.1.0 / 2014-06-15
+==================
+
+ * Add `deprecate.function(fn, message)`
+ * Add `process.on('deprecation', fn)` emitter
+ * Automatically generate message when omitted from `deprecate()`
+
+0.0.1 / 2014-06-15
+==================
+
+ * Fix warning for dynamic calls at singe call site
+
+0.0.0 / 2014-06-15
+==================
+
+ * Initial implementation
diff --git a/nginx-nodejs-redis/web/node_modules/depd/LICENSE b/nginx-nodejs-redis/web/node_modules/depd/LICENSE
new file mode 100644
index 0000000..84441fb
--- /dev/null
+++ b/nginx-nodejs-redis/web/node_modules/depd/LICENSE
@@ -0,0 +1,22 @@
+(The MIT License)
+
+Copyright (c) 2014-2017 Douglas Christopher Wilson
+
+Permission is hereby granted, free of charge, to any person obtaining
+a copy of this software and associated documentation files (the
+'Software'), to deal in the Software without restriction, including
+without limitation the rights to use, copy, modify, merge, publish,
+distribute, sublicense, and/or sell copies of the Software, and to
+permit persons to whom the Software is furnished to do so, subject to
+the following conditions:
+
+The above copyright notice and this permission notice shall be
+included in all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND,
+EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.
+IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY
+CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT,
+TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE
+SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
diff --git a/nginx-nodejs-redis/web/node_modules/depd/Readme.md b/nginx-nodejs-redis/web/node_modules/depd/Readme.md
new file mode 100644
index 0000000..7790670
--- /dev/null
+++ b/nginx-nodejs-redis/web/node_modules/depd/Readme.md
@@ -0,0 +1,280 @@
+# depd
+
+[![NPM Version][npm-version-image]][npm-url]
+[![NPM Downloads][npm-downloads-image]][npm-url]
+[![Node.js Version][node-image]][node-url]
+[![Linux Build][travis-image]][travis-url]
+[![Windows Build][appveyor-image]][appveyor-url]
+[![Coverage Status][coveralls-image]][coveralls-url]
+
+Deprecate all the things
+
+> With great modules comes great responsibility; mark things deprecated!
+
+## Install
+
+This module is installed directly using `npm`:
+
+```sh
+$ npm install depd
+```
+
+This module can also be bundled with systems like
+[Browserify](http://browserify.org/) or [webpack](https://webpack.github.io/),
+though by default this module will alter it's API to no longer display or
+track deprecations.
+
+## API
+
+
+
+```js
+var deprecate = require('depd')('my-module')
+```
+
+This library allows you to display deprecation messages to your users.
+This library goes above and beyond with deprecation warnings by
+introspection of the call stack (but only the bits that it is interested
+in).
+
+Instead of just warning on the first invocation of a deprecated
+function and never again, this module will warn on the first invocation
+of a deprecated function per unique call site, making it ideal to alert
+users of all deprecated uses across the code base, rather than just
+whatever happens to execute first.
+
+The deprecation warnings from this module also include the file and line
+information for the call into the module that the deprecated function was
+in.
+
+**NOTE** this library has a similar interface to the `debug` module, and
+this module uses the calling file to get the boundary for the call stacks,
+so you should always create a new `deprecate` object in each file and not
+within some central file.
+
+### depd(namespace)
+
+Create a new deprecate function that uses the given namespace name in the
+messages and will display the call site prior to the stack entering the
+file this function was called from. It is highly suggested you use the
+name of your module as the namespace.
+
+### deprecate(message)
+
+Call this function from deprecated code to display a deprecation message.
+This message will appear once per unique caller site. Caller site is the
+first call site in the stack in a different file from the caller of this
+function.
+
+If the message is omitted, a message is generated for you based on the site
+of the `deprecate()` call and will display the name of the function called,
+similar to the name displayed in a stack trace.
+
+### deprecate.function(fn, message)
+
+Call this function to wrap a given function in a deprecation message on any
+call to the function. An optional message can be supplied to provide a custom
+message.
+
+### deprecate.property(obj, prop, message)
+
+Call this function to wrap a given property on object in a deprecation message
+on any accessing or setting of the property. An optional message can be supplied
+to provide a custom message.
+
+The method must be called on the object where the property belongs (not
+inherited from the prototype).
+
+If the property is a data descriptor, it will be converted to an accessor
+descriptor in order to display the deprecation message.
+
+### process.on('deprecation', fn)
+
+This module will allow easy capturing of deprecation errors by emitting the
+errors as the type "deprecation" on the global `process`. If there are no
+listeners for this type, the errors are written to STDERR as normal, but if
+there are any listeners, nothing will be written to STDERR and instead only
+emitted. From there, you can write the errors in a different format or to a
+logging source.
+
+The error represents the deprecation and is emitted only once with the same
+rules as writing to STDERR. The error has the following properties:
+
+ - `message` - This is the message given by the library
+ - `name` - This is always `'DeprecationError'`
+ - `namespace` - This is the namespace the deprecation came from
+ - `stack` - This is the stack of the call to the deprecated thing
+
+Example `error.stack` output:
+
+```
+DeprecationError: my-cool-module deprecated oldfunction
+ at Object. ([eval]-wrapper:6:22)
+ at Module._compile (module.js:456:26)
+ at evalScript (node.js:532:25)
+ at startup (node.js:80:7)
+ at node.js:902:3
+```
+
+### process.env.NO_DEPRECATION
+
+As a user of modules that are deprecated, the environment variable `NO_DEPRECATION`
+is provided as a quick solution to silencing deprecation warnings from being
+output. The format of this is similar to that of `DEBUG`:
+
+```sh
+$ NO_DEPRECATION=my-module,othermod node app.js
+```
+
+This will suppress deprecations from being output for "my-module" and "othermod".
+The value is a list of comma-separated namespaces. To suppress every warning
+across all namespaces, use the value `*` for a namespace.
+
+Providing the argument `--no-deprecation` to the `node` executable will suppress
+all deprecations (only available in Node.js 0.8 or higher).
+
+**NOTE** This will not suppress the deperecations given to any "deprecation"
+event listeners, just the output to STDERR.
+
+### process.env.TRACE_DEPRECATION
+
+As a user of modules that are deprecated, the environment variable `TRACE_DEPRECATION`
+is provided as a solution to getting more detailed location information in deprecation
+warnings by including the entire stack trace. The format of this is the same as
+`NO_DEPRECATION`:
+
+```sh
+$ TRACE_DEPRECATION=my-module,othermod node app.js
+```
+
+This will include stack traces for deprecations being output for "my-module" and
+"othermod". The value is a list of comma-separated namespaces. To trace every
+warning across all namespaces, use the value `*` for a namespace.
+
+Providing the argument `--trace-deprecation` to the `node` executable will trace
+all deprecations (only available in Node.js 0.8 or higher).
+
+**NOTE** This will not trace the deperecations silenced by `NO_DEPRECATION`.
+
+## Display
+
+
+
+When a user calls a function in your library that you mark deprecated, they
+will see the following written to STDERR (in the given colors, similar colors
+and layout to the `debug` module):
+
+```
+bright cyan bright yellow
+| | reset cyan
+| | | |
+▼ ▼ ▼ ▼
+my-cool-module deprecated oldfunction [eval]-wrapper:6:22
+▲ ▲ ▲ ▲
+| | | |
+namespace | | location of mycoolmod.oldfunction() call
+ | deprecation message
+ the word "deprecated"
+```
+
+If the user redirects their STDERR to a file or somewhere that does not support
+colors, they see (similar layout to the `debug` module):
+
+```
+Sun, 15 Jun 2014 05:21:37 GMT my-cool-module deprecated oldfunction at [eval]-wrapper:6:22
+▲ ▲ ▲ ▲ ▲
+| | | | |
+timestamp of message namespace | | location of mycoolmod.oldfunction() call
+ | deprecation message
+ the word "deprecated"
+```
+
+## Examples
+
+### Deprecating all calls to a function
+
+This will display a deprecated message about "oldfunction" being deprecated
+from "my-module" on STDERR.
+
+```js
+var deprecate = require('depd')('my-cool-module')
+
+// message automatically derived from function name
+// Object.oldfunction
+exports.oldfunction = deprecate.function(function oldfunction () {
+ // all calls to function are deprecated
+})
+
+// specific message
+exports.oldfunction = deprecate.function(function () {
+ // all calls to function are deprecated
+}, 'oldfunction')
+```
+
+### Conditionally deprecating a function call
+
+This will display a deprecated message about "weirdfunction" being deprecated
+from "my-module" on STDERR when called with less than 2 arguments.
+
+```js
+var deprecate = require('depd')('my-cool-module')
+
+exports.weirdfunction = function () {
+ if (arguments.length < 2) {
+ // calls with 0 or 1 args are deprecated
+ deprecate('weirdfunction args < 2')
+ }
+}
+```
+
+When calling `deprecate` as a function, the warning is counted per call site
+within your own module, so you can display different deprecations depending
+on different situations and the users will still get all the warnings:
+
+```js
+var deprecate = require('depd')('my-cool-module')
+
+exports.weirdfunction = function () {
+ if (arguments.length < 2) {
+ // calls with 0 or 1 args are deprecated
+ deprecate('weirdfunction args < 2')
+ } else if (typeof arguments[0] !== 'string') {
+ // calls with non-string first argument are deprecated
+ deprecate('weirdfunction non-string first arg')
+ }
+}
+```
+
+### Deprecating property access
+
+This will display a deprecated message about "oldprop" being deprecated
+from "my-module" on STDERR when accessed. A deprecation will be displayed
+when setting the value and when getting the value.
+
+```js
+var deprecate = require('depd')('my-cool-module')
+
+exports.oldprop = 'something'
+
+// message automatically derives from property name
+deprecate.property(exports, 'oldprop')
+
+// explicit message
+deprecate.property(exports, 'oldprop', 'oldprop >= 0.10')
+```
+
+## License
+
+[MIT](LICENSE)
+
+[npm-version-image]: https://img.shields.io/npm/v/depd.svg
+[npm-downloads-image]: https://img.shields.io/npm/dm/depd.svg
+[npm-url]: https://npmjs.org/package/depd
+[travis-image]: https://img.shields.io/travis/dougwilson/nodejs-depd/master.svg?label=linux
+[travis-url]: https://travis-ci.org/dougwilson/nodejs-depd
+[appveyor-image]: https://img.shields.io/appveyor/ci/dougwilson/nodejs-depd/master.svg?label=windows
+[appveyor-url]: https://ci.appveyor.com/project/dougwilson/nodejs-depd
+[coveralls-image]: https://img.shields.io/coveralls/dougwilson/nodejs-depd/master.svg
+[coveralls-url]: https://coveralls.io/r/dougwilson/nodejs-depd?branch=master
+[node-image]: https://img.shields.io/node/v/depd.svg
+[node-url]: https://nodejs.org/en/download/
diff --git a/nginx-nodejs-redis/web/node_modules/depd/index.js b/nginx-nodejs-redis/web/node_modules/depd/index.js
new file mode 100644
index 0000000..d758d3c
--- /dev/null
+++ b/nginx-nodejs-redis/web/node_modules/depd/index.js
@@ -0,0 +1,522 @@
+/*!
+ * depd
+ * Copyright(c) 2014-2017 Douglas Christopher Wilson
+ * MIT Licensed
+ */
+
+/**
+ * Module dependencies.
+ */
+
+var callSiteToString = require('./lib/compat').callSiteToString
+var eventListenerCount = require('./lib/compat').eventListenerCount
+var relative = require('path').relative
+
+/**
+ * Module exports.
+ */
+
+module.exports = depd
+
+/**
+ * Get the path to base files on.
+ */
+
+var basePath = process.cwd()
+
+/**
+ * Determine if namespace is contained in the string.
+ */
+
+function containsNamespace (str, namespace) {
+ var vals = str.split(/[ ,]+/)
+ var ns = String(namespace).toLowerCase()
+
+ for (var i = 0; i < vals.length; i++) {
+ var val = vals[i]
+
+ // namespace contained
+ if (val && (val === '*' || val.toLowerCase() === ns)) {
+ return true
+ }
+ }
+
+ return false
+}
+
+/**
+ * Convert a data descriptor to accessor descriptor.
+ */
+
+function convertDataDescriptorToAccessor (obj, prop, message) {
+ var descriptor = Object.getOwnPropertyDescriptor(obj, prop)
+ var value = descriptor.value
+
+ descriptor.get = function getter () { return value }
+
+ if (descriptor.writable) {
+ descriptor.set = function setter (val) { return (value = val) }
+ }
+
+ delete descriptor.value
+ delete descriptor.writable
+
+ Object.defineProperty(obj, prop, descriptor)
+
+ return descriptor
+}
+
+/**
+ * Create arguments string to keep arity.
+ */
+
+function createArgumentsString (arity) {
+ var str = ''
+
+ for (var i = 0; i < arity; i++) {
+ str += ', arg' + i
+ }
+
+ return str.substr(2)
+}
+
+/**
+ * Create stack string from stack.
+ */
+
+function createStackString (stack) {
+ var str = this.name + ': ' + this.namespace
+
+ if (this.message) {
+ str += ' deprecated ' + this.message
+ }
+
+ for (var i = 0; i < stack.length; i++) {
+ str += '\n at ' + callSiteToString(stack[i])
+ }
+
+ return str
+}
+
+/**
+ * Create deprecate for namespace in caller.
+ */
+
+function depd (namespace) {
+ if (!namespace) {
+ throw new TypeError('argument namespace is required')
+ }
+
+ var stack = getStack()
+ var site = callSiteLocation(stack[1])
+ var file = site[0]
+
+ function deprecate (message) {
+ // call to self as log
+ log.call(deprecate, message)
+ }
+
+ deprecate._file = file
+ deprecate._ignored = isignored(namespace)
+ deprecate._namespace = namespace
+ deprecate._traced = istraced(namespace)
+ deprecate._warned = Object.create(null)
+
+ deprecate.function = wrapfunction
+ deprecate.property = wrapproperty
+
+ return deprecate
+}
+
+/**
+ * Determine if namespace is ignored.
+ */
+
+function isignored (namespace) {
+ /* istanbul ignore next: tested in a child processs */
+ if (process.noDeprecation) {
+ // --no-deprecation support
+ return true
+ }
+
+ var str = process.env.NO_DEPRECATION || ''
+
+ // namespace ignored
+ return containsNamespace(str, namespace)
+}
+
+/**
+ * Determine if namespace is traced.
+ */
+
+function istraced (namespace) {
+ /* istanbul ignore next: tested in a child processs */
+ if (process.traceDeprecation) {
+ // --trace-deprecation support
+ return true
+ }
+
+ var str = process.env.TRACE_DEPRECATION || ''
+
+ // namespace traced
+ return containsNamespace(str, namespace)
+}
+
+/**
+ * Display deprecation message.
+ */
+
+function log (message, site) {
+ var haslisteners = eventListenerCount(process, 'deprecation') !== 0
+
+ // abort early if no destination
+ if (!haslisteners && this._ignored) {
+ return
+ }
+
+ var caller
+ var callFile
+ var callSite
+ var depSite
+ var i = 0
+ var seen = false
+ var stack = getStack()
+ var file = this._file
+
+ if (site) {
+ // provided site
+ depSite = site
+ callSite = callSiteLocation(stack[1])
+ callSite.name = depSite.name
+ file = callSite[0]
+ } else {
+ // get call site
+ i = 2
+ depSite = callSiteLocation(stack[i])
+ callSite = depSite
+ }
+
+ // get caller of deprecated thing in relation to file
+ for (; i < stack.length; i++) {
+ caller = callSiteLocation(stack[i])
+ callFile = caller[0]
+
+ if (callFile === file) {
+ seen = true
+ } else if (callFile === this._file) {
+ file = this._file
+ } else if (seen) {
+ break
+ }
+ }
+
+ var key = caller
+ ? depSite.join(':') + '__' + caller.join(':')
+ : undefined
+
+ if (key !== undefined && key in this._warned) {
+ // already warned
+ return
+ }
+
+ this._warned[key] = true
+
+ // generate automatic message from call site
+ var msg = message
+ if (!msg) {
+ msg = callSite === depSite || !callSite.name
+ ? defaultMessage(depSite)
+ : defaultMessage(callSite)
+ }
+
+ // emit deprecation if listeners exist
+ if (haslisteners) {
+ var err = DeprecationError(this._namespace, msg, stack.slice(i))
+ process.emit('deprecation', err)
+ return
+ }
+
+ // format and write message
+ var format = process.stderr.isTTY
+ ? formatColor
+ : formatPlain
+ var output = format.call(this, msg, caller, stack.slice(i))
+ process.stderr.write(output + '\n', 'utf8')
+}
+
+/**
+ * Get call site location as array.
+ */
+
+function callSiteLocation (callSite) {
+ var file = callSite.getFileName() || ''
+ var line = callSite.getLineNumber()
+ var colm = callSite.getColumnNumber()
+
+ if (callSite.isEval()) {
+ file = callSite.getEvalOrigin() + ', ' + file
+ }
+
+ var site = [file, line, colm]
+
+ site.callSite = callSite
+ site.name = callSite.getFunctionName()
+
+ return site
+}
+
+/**
+ * Generate a default message from the site.
+ */
+
+function defaultMessage (site) {
+ var callSite = site.callSite
+ var funcName = site.name
+
+ // make useful anonymous name
+ if (!funcName) {
+ funcName = ''
+ }
+
+ var context = callSite.getThis()
+ var typeName = context && callSite.getTypeName()
+
+ // ignore useless type name
+ if (typeName === 'Object') {
+ typeName = undefined
+ }
+
+ // make useful type name
+ if (typeName === 'Function') {
+ typeName = context.name || typeName
+ }
+
+ return typeName && callSite.getMethodName()
+ ? typeName + '.' + funcName
+ : funcName
+}
+
+/**
+ * Format deprecation message without color.
+ */
+
+function formatPlain (msg, caller, stack) {
+ var timestamp = new Date().toUTCString()
+
+ var formatted = timestamp +
+ ' ' + this._namespace +
+ ' deprecated ' + msg
+
+ // add stack trace
+ if (this._traced) {
+ for (var i = 0; i < stack.length; i++) {
+ formatted += '\n at ' + callSiteToString(stack[i])
+ }
+
+ return formatted
+ }
+
+ if (caller) {
+ formatted += ' at ' + formatLocation(caller)
+ }
+
+ return formatted
+}
+
+/**
+ * Format deprecation message with color.
+ */
+
+function formatColor (msg, caller, stack) {
+ var formatted = '\x1b[36;1m' + this._namespace + '\x1b[22;39m' + // bold cyan
+ ' \x1b[33;1mdeprecated\x1b[22;39m' + // bold yellow
+ ' \x1b[0m' + msg + '\x1b[39m' // reset
+
+ // add stack trace
+ if (this._traced) {
+ for (var i = 0; i < stack.length; i++) {
+ formatted += '\n \x1b[36mat ' + callSiteToString(stack[i]) + '\x1b[39m' // cyan
+ }
+
+ return formatted
+ }
+
+ if (caller) {
+ formatted += ' \x1b[36m' + formatLocation(caller) + '\x1b[39m' // cyan
+ }
+
+ return formatted
+}
+
+/**
+ * Format call site location.
+ */
+
+function formatLocation (callSite) {
+ return relative(basePath, callSite[0]) +
+ ':' + callSite[1] +
+ ':' + callSite[2]
+}
+
+/**
+ * Get the stack as array of call sites.
+ */
+
+function getStack () {
+ var limit = Error.stackTraceLimit
+ var obj = {}
+ var prep = Error.prepareStackTrace
+
+ Error.prepareStackTrace = prepareObjectStackTrace
+ Error.stackTraceLimit = Math.max(10, limit)
+
+ // capture the stack
+ Error.captureStackTrace(obj)
+
+ // slice this function off the top
+ var stack = obj.stack.slice(1)
+
+ Error.prepareStackTrace = prep
+ Error.stackTraceLimit = limit
+
+ return stack
+}
+
+/**
+ * Capture call site stack from v8.
+ */
+
+function prepareObjectStackTrace (obj, stack) {
+ return stack
+}
+
+/**
+ * Return a wrapped function in a deprecation message.
+ */
+
+function wrapfunction (fn, message) {
+ if (typeof fn !== 'function') {
+ throw new TypeError('argument fn must be a function')
+ }
+
+ var args = createArgumentsString(fn.length)
+ var deprecate = this // eslint-disable-line no-unused-vars
+ var stack = getStack()
+ var site = callSiteLocation(stack[1])
+
+ site.name = fn.name
+
+ // eslint-disable-next-line no-eval
+ var deprecatedfn = eval('(function (' + args + ') {\n' +
+ '"use strict"\n' +
+ 'log.call(deprecate, message, site)\n' +
+ 'return fn.apply(this, arguments)\n' +
+ '})')
+
+ return deprecatedfn
+}
+
+/**
+ * Wrap property in a deprecation message.
+ */
+
+function wrapproperty (obj, prop, message) {
+ if (!obj || (typeof obj !== 'object' && typeof obj !== 'function')) {
+ throw new TypeError('argument obj must be object')
+ }
+
+ var descriptor = Object.getOwnPropertyDescriptor(obj, prop)
+
+ if (!descriptor) {
+ throw new TypeError('must call property on owner object')
+ }
+
+ if (!descriptor.configurable) {
+ throw new TypeError('property must be configurable')
+ }
+
+ var deprecate = this
+ var stack = getStack()
+ var site = callSiteLocation(stack[1])
+
+ // set site name
+ site.name = prop
+
+ // convert data descriptor
+ if ('value' in descriptor) {
+ descriptor = convertDataDescriptorToAccessor(obj, prop, message)
+ }
+
+ var get = descriptor.get
+ var set = descriptor.set
+
+ // wrap getter
+ if (typeof get === 'function') {
+ descriptor.get = function getter () {
+ log.call(deprecate, message, site)
+ return get.apply(this, arguments)
+ }
+ }
+
+ // wrap setter
+ if (typeof set === 'function') {
+ descriptor.set = function setter () {
+ log.call(deprecate, message, site)
+ return set.apply(this, arguments)
+ }
+ }
+
+ Object.defineProperty(obj, prop, descriptor)
+}
+
+/**
+ * Create DeprecationError for deprecation
+ */
+
+function DeprecationError (namespace, message, stack) {
+ var error = new Error()
+ var stackString
+
+ Object.defineProperty(error, 'constructor', {
+ value: DeprecationError
+ })
+
+ Object.defineProperty(error, 'message', {
+ configurable: true,
+ enumerable: false,
+ value: message,
+ writable: true
+ })
+
+ Object.defineProperty(error, 'name', {
+ enumerable: false,
+ configurable: true,
+ value: 'DeprecationError',
+ writable: true
+ })
+
+ Object.defineProperty(error, 'namespace', {
+ configurable: true,
+ enumerable: false,
+ value: namespace,
+ writable: true
+ })
+
+ Object.defineProperty(error, 'stack', {
+ configurable: true,
+ enumerable: false,
+ get: function () {
+ if (stackString !== undefined) {
+ return stackString
+ }
+
+ // prepare stack trace
+ return (stackString = createStackString.call(this, stack))
+ },
+ set: function setter (val) {
+ stackString = val
+ }
+ })
+
+ return error
+}
diff --git a/nginx-nodejs-redis/web/node_modules/depd/lib/browser/index.js b/nginx-nodejs-redis/web/node_modules/depd/lib/browser/index.js
new file mode 100644
index 0000000..6be45cc
--- /dev/null
+++ b/nginx-nodejs-redis/web/node_modules/depd/lib/browser/index.js
@@ -0,0 +1,77 @@
+/*!
+ * depd
+ * Copyright(c) 2015 Douglas Christopher Wilson
+ * MIT Licensed
+ */
+
+'use strict'
+
+/**
+ * Module exports.
+ * @public
+ */
+
+module.exports = depd
+
+/**
+ * Create deprecate for namespace in caller.
+ */
+
+function depd (namespace) {
+ if (!namespace) {
+ throw new TypeError('argument namespace is required')
+ }
+
+ function deprecate (message) {
+ // no-op in browser
+ }
+
+ deprecate._file = undefined
+ deprecate._ignored = true
+ deprecate._namespace = namespace
+ deprecate._traced = false
+ deprecate._warned = Object.create(null)
+
+ deprecate.function = wrapfunction
+ deprecate.property = wrapproperty
+
+ return deprecate
+}
+
+/**
+ * Return a wrapped function in a deprecation message.
+ *
+ * This is a no-op version of the wrapper, which does nothing but call
+ * validation.
+ */
+
+function wrapfunction (fn, message) {
+ if (typeof fn !== 'function') {
+ throw new TypeError('argument fn must be a function')
+ }
+
+ return fn
+}
+
+/**
+ * Wrap property in a deprecation message.
+ *
+ * This is a no-op version of the wrapper, which does nothing but call
+ * validation.
+ */
+
+function wrapproperty (obj, prop, message) {
+ if (!obj || (typeof obj !== 'object' && typeof obj !== 'function')) {
+ throw new TypeError('argument obj must be object')
+ }
+
+ var descriptor = Object.getOwnPropertyDescriptor(obj, prop)
+
+ if (!descriptor) {
+ throw new TypeError('must call property on owner object')
+ }
+
+ if (!descriptor.configurable) {
+ throw new TypeError('property must be configurable')
+ }
+}
diff --git a/nginx-nodejs-redis/web/node_modules/depd/lib/compat/callsite-tostring.js b/nginx-nodejs-redis/web/node_modules/depd/lib/compat/callsite-tostring.js
new file mode 100644
index 0000000..73186dc
--- /dev/null
+++ b/nginx-nodejs-redis/web/node_modules/depd/lib/compat/callsite-tostring.js
@@ -0,0 +1,103 @@
+/*!
+ * depd
+ * Copyright(c) 2014 Douglas Christopher Wilson
+ * MIT Licensed
+ */
+
+'use strict'
+
+/**
+ * Module exports.
+ */
+
+module.exports = callSiteToString
+
+/**
+ * Format a CallSite file location to a string.
+ */
+
+function callSiteFileLocation (callSite) {
+ var fileName
+ var fileLocation = ''
+
+ if (callSite.isNative()) {
+ fileLocation = 'native'
+ } else if (callSite.isEval()) {
+ fileName = callSite.getScriptNameOrSourceURL()
+ if (!fileName) {
+ fileLocation = callSite.getEvalOrigin()
+ }
+ } else {
+ fileName = callSite.getFileName()
+ }
+
+ if (fileName) {
+ fileLocation += fileName
+
+ var lineNumber = callSite.getLineNumber()
+ if (lineNumber != null) {
+ fileLocation += ':' + lineNumber
+
+ var columnNumber = callSite.getColumnNumber()
+ if (columnNumber) {
+ fileLocation += ':' + columnNumber
+ }
+ }
+ }
+
+ return fileLocation || 'unknown source'
+}
+
+/**
+ * Format a CallSite to a string.
+ */
+
+function callSiteToString (callSite) {
+ var addSuffix = true
+ var fileLocation = callSiteFileLocation(callSite)
+ var functionName = callSite.getFunctionName()
+ var isConstructor = callSite.isConstructor()
+ var isMethodCall = !(callSite.isToplevel() || isConstructor)
+ var line = ''
+
+ if (isMethodCall) {
+ var methodName = callSite.getMethodName()
+ var typeName = getConstructorName(callSite)
+
+ if (functionName) {
+ if (typeName && functionName.indexOf(typeName) !== 0) {
+ line += typeName + '.'
+ }
+
+ line += functionName
+
+ if (methodName && functionName.lastIndexOf('.' + methodName) !== functionName.length - methodName.length - 1) {
+ line += ' [as ' + methodName + ']'
+ }
+ } else {
+ line += typeName + '.' + (methodName || '')
+ }
+ } else if (isConstructor) {
+ line += 'new ' + (functionName || '')
+ } else if (functionName) {
+ line += functionName
+ } else {
+ addSuffix = false
+ line += fileLocation
+ }
+
+ if (addSuffix) {
+ line += ' (' + fileLocation + ')'
+ }
+
+ return line
+}
+
+/**
+ * Get constructor name of reviver.
+ */
+
+function getConstructorName (obj) {
+ var receiver = obj.receiver
+ return (receiver.constructor && receiver.constructor.name) || null
+}
diff --git a/nginx-nodejs-redis/web/node_modules/depd/lib/compat/event-listener-count.js b/nginx-nodejs-redis/web/node_modules/depd/lib/compat/event-listener-count.js
new file mode 100644
index 0000000..3a8925d
--- /dev/null
+++ b/nginx-nodejs-redis/web/node_modules/depd/lib/compat/event-listener-count.js
@@ -0,0 +1,22 @@
+/*!
+ * depd
+ * Copyright(c) 2015 Douglas Christopher Wilson
+ * MIT Licensed
+ */
+
+'use strict'
+
+/**
+ * Module exports.
+ * @public
+ */
+
+module.exports = eventListenerCount
+
+/**
+ * Get the count of listeners on an event emitter of a specific type.
+ */
+
+function eventListenerCount (emitter, type) {
+ return emitter.listeners(type).length
+}
diff --git a/nginx-nodejs-redis/web/node_modules/depd/lib/compat/index.js b/nginx-nodejs-redis/web/node_modules/depd/lib/compat/index.js
new file mode 100644
index 0000000..955b333
--- /dev/null
+++ b/nginx-nodejs-redis/web/node_modules/depd/lib/compat/index.js
@@ -0,0 +1,79 @@
+/*!
+ * depd
+ * Copyright(c) 2014-2015 Douglas Christopher Wilson
+ * MIT Licensed
+ */
+
+'use strict'
+
+/**
+ * Module dependencies.
+ * @private
+ */
+
+var EventEmitter = require('events').EventEmitter
+
+/**
+ * Module exports.
+ * @public
+ */
+
+lazyProperty(module.exports, 'callSiteToString', function callSiteToString () {
+ var limit = Error.stackTraceLimit
+ var obj = {}
+ var prep = Error.prepareStackTrace
+
+ function prepareObjectStackTrace (obj, stack) {
+ return stack
+ }
+
+ Error.prepareStackTrace = prepareObjectStackTrace
+ Error.stackTraceLimit = 2
+
+ // capture the stack
+ Error.captureStackTrace(obj)
+
+ // slice the stack
+ var stack = obj.stack.slice()
+
+ Error.prepareStackTrace = prep
+ Error.stackTraceLimit = limit
+
+ return stack[0].toString ? toString : require('./callsite-tostring')
+})
+
+lazyProperty(module.exports, 'eventListenerCount', function eventListenerCount () {
+ return EventEmitter.listenerCount || require('./event-listener-count')
+})
+
+/**
+ * Define a lazy property.
+ */
+
+function lazyProperty (obj, prop, getter) {
+ function get () {
+ var val = getter()
+
+ Object.defineProperty(obj, prop, {
+ configurable: true,
+ enumerable: true,
+ value: val
+ })
+
+ return val
+ }
+
+ Object.defineProperty(obj, prop, {
+ configurable: true,
+ enumerable: true,
+ get: get
+ })
+}
+
+/**
+ * Call toString() on the obj
+ */
+
+function toString (obj) {
+ return obj.toString()
+}
diff --git a/nginx-nodejs-redis/web/node_modules/depd/package.json b/nginx-nodejs-redis/web/node_modules/depd/package.json
new file mode 100644
index 0000000..99749a4
--- /dev/null
+++ b/nginx-nodejs-redis/web/node_modules/depd/package.json
@@ -0,0 +1,79 @@
+{
+ "_from": "depd@~1.1.2",
+ "_id": "depd@1.1.2",
+ "_inBundle": false,
+ "_integrity": "sha1-m81S4UwJd2PnSbJ0xDRu0uVgtak=",
+ "_location": "/depd",
+ "_phantomChildren": {},
+ "_requested": {
+ "type": "range",
+ "registry": true,
+ "raw": "depd@~1.1.2",
+ "name": "depd",
+ "escapedName": "depd",
+ "rawSpec": "~1.1.2",
+ "saveSpec": null,
+ "fetchSpec": "~1.1.2"
+ },
+ "_requiredBy": [
+ "/body-parser",
+ "/express",
+ "/http-errors",
+ "/send"
+ ],
+ "_resolved": "https://registry.npmjs.org/depd/-/depd-1.1.2.tgz",
+ "_shasum": "9bcd52e14c097763e749b274c4346ed2e560b5a9",
+ "_spec": "depd@~1.1.2",
+ "_where": "/Users/ajeetraina/projects/13march/awesome-compose/nginx-nodejs-redis/web/node_modules/express",
+ "author": {
+ "name": "Douglas Christopher Wilson",
+ "email": "doug@somethingdoug.com"
+ },
+ "browser": "lib/browser/index.js",
+ "bugs": {
+ "url": "https://github.com/dougwilson/nodejs-depd/issues"
+ },
+ "bundleDependencies": false,
+ "deprecated": false,
+ "description": "Deprecate all the things",
+ "devDependencies": {
+ "beautify-benchmark": "0.2.4",
+ "benchmark": "2.1.4",
+ "eslint": "3.19.0",
+ "eslint-config-standard": "7.1.0",
+ "eslint-plugin-markdown": "1.0.0-beta.7",
+ "eslint-plugin-promise": "3.6.0",
+ "eslint-plugin-standard": "3.0.1",
+ "istanbul": "0.4.5",
+ "mocha": "~1.21.5"
+ },
+ "engines": {
+ "node": ">= 0.6"
+ },
+ "files": [
+ "lib/",
+ "History.md",
+ "LICENSE",
+ "index.js",
+ "Readme.md"
+ ],
+ "homepage": "https://github.com/dougwilson/nodejs-depd#readme",
+ "keywords": [
+ "deprecate",
+ "deprecated"
+ ],
+ "license": "MIT",
+ "name": "depd",
+ "repository": {
+ "type": "git",
+ "url": "git+https://github.com/dougwilson/nodejs-depd.git"
+ },
+ "scripts": {
+ "bench": "node benchmark/index.js",
+ "lint": "eslint --plugin markdown --ext js,md .",
+ "test": "mocha --reporter spec --bail test/",
+ "test-ci": "istanbul cover node_modules/mocha/bin/_mocha --report lcovonly -- --reporter spec --no-exit test/",
+ "test-cov": "istanbul cover node_modules/mocha/bin/_mocha -- --reporter dot test/"
+ },
+ "version": "1.1.2"
+}
diff --git a/nginx-nodejs-redis/web/node_modules/destroy/LICENSE b/nginx-nodejs-redis/web/node_modules/destroy/LICENSE
new file mode 100644
index 0000000..a7ae8ee
--- /dev/null
+++ b/nginx-nodejs-redis/web/node_modules/destroy/LICENSE
@@ -0,0 +1,22 @@
+
+The MIT License (MIT)
+
+Copyright (c) 2014 Jonathan Ong me@jongleberry.com
+
+Permission is hereby granted, free of charge, to any person obtaining a copy
+of this software and associated documentation files (the "Software"), to deal
+in the Software without restriction, including without limitation the rights
+to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
+copies of the Software, and to permit persons to whom the Software is
+furnished to do so, subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in
+all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
+LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
+OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN
+THE SOFTWARE.
diff --git a/nginx-nodejs-redis/web/node_modules/destroy/README.md b/nginx-nodejs-redis/web/node_modules/destroy/README.md
new file mode 100644
index 0000000..6474bc3
--- /dev/null
+++ b/nginx-nodejs-redis/web/node_modules/destroy/README.md
@@ -0,0 +1,60 @@
+# Destroy
+
+[![NPM version][npm-image]][npm-url]
+[![Build status][travis-image]][travis-url]
+[![Test coverage][coveralls-image]][coveralls-url]
+[![License][license-image]][license-url]
+[![Downloads][downloads-image]][downloads-url]
+[![Gittip][gittip-image]][gittip-url]
+
+Destroy a stream.
+
+This module is meant to ensure a stream gets destroyed, handling different APIs
+and Node.js bugs.
+
+## API
+
+```js
+var destroy = require('destroy')
+```
+
+### destroy(stream)
+
+Destroy the given stream. In most cases, this is identical to a simple
+`stream.destroy()` call. The rules are as follows for a given stream:
+
+ 1. If the `stream` is an instance of `ReadStream`, then call `stream.destroy()`
+ and add a listener to the `open` event to call `stream.close()` if it is
+ fired. This is for a Node.js bug that will leak a file descriptor if
+ `.destroy()` is called before `open`.
+ 2. If the `stream` is not an instance of `Stream`, then nothing happens.
+ 3. If the `stream` has a `.destroy()` method, then call it.
+
+The function returns the `stream` passed in as the argument.
+
+## Example
+
+```js
+var destroy = require('destroy')
+
+var fs = require('fs')
+var stream = fs.createReadStream('package.json')
+
+// ... and later
+destroy(stream)
+```
+
+[npm-image]: https://img.shields.io/npm/v/destroy.svg?style=flat-square
+[npm-url]: https://npmjs.org/package/destroy
+[github-tag]: http://img.shields.io/github/tag/stream-utils/destroy.svg?style=flat-square
+[github-url]: https://github.com/stream-utils/destroy/tags
+[travis-image]: https://img.shields.io/travis/stream-utils/destroy.svg?style=flat-square
+[travis-url]: https://travis-ci.org/stream-utils/destroy
+[coveralls-image]: https://img.shields.io/coveralls/stream-utils/destroy.svg?style=flat-square
+[coveralls-url]: https://coveralls.io/r/stream-utils/destroy?branch=master
+[license-image]: http://img.shields.io/npm/l/destroy.svg?style=flat-square
+[license-url]: LICENSE.md
+[downloads-image]: http://img.shields.io/npm/dm/destroy.svg?style=flat-square
+[downloads-url]: https://npmjs.org/package/destroy
+[gittip-image]: https://img.shields.io/gittip/jonathanong.svg?style=flat-square
+[gittip-url]: https://www.gittip.com/jonathanong/
diff --git a/nginx-nodejs-redis/web/node_modules/destroy/index.js b/nginx-nodejs-redis/web/node_modules/destroy/index.js
new file mode 100644
index 0000000..6da2d26
--- /dev/null
+++ b/nginx-nodejs-redis/web/node_modules/destroy/index.js
@@ -0,0 +1,75 @@
+/*!
+ * destroy
+ * Copyright(c) 2014 Jonathan Ong
+ * MIT Licensed
+ */
+
+'use strict'
+
+/**
+ * Module dependencies.
+ * @private
+ */
+
+var ReadStream = require('fs').ReadStream
+var Stream = require('stream')
+
+/**
+ * Module exports.
+ * @public
+ */
+
+module.exports = destroy
+
+/**
+ * Destroy a stream.
+ *
+ * @param {object} stream
+ * @public
+ */
+
+function destroy(stream) {
+ if (stream instanceof ReadStream) {
+ return destroyReadStream(stream)
+ }
+
+ if (!(stream instanceof Stream)) {
+ return stream
+ }
+
+ if (typeof stream.destroy === 'function') {
+ stream.destroy()
+ }
+
+ return stream
+}
+
+/**
+ * Destroy a ReadStream.
+ *
+ * @param {object} stream
+ * @private
+ */
+
+function destroyReadStream(stream) {
+ stream.destroy()
+
+ if (typeof stream.close === 'function') {
+ // node.js core bug work-around
+ stream.on('open', onOpenClose)
+ }
+
+ return stream
+}
+
+/**
+ * On open handler to close stream.
+ * @private
+ */
+
+function onOpenClose() {
+ if (typeof this.fd === 'number') {
+ // actually close down the fd
+ this.close()
+ }
+}
diff --git a/nginx-nodejs-redis/web/node_modules/destroy/package.json b/nginx-nodejs-redis/web/node_modules/destroy/package.json
new file mode 100644
index 0000000..e428631
--- /dev/null
+++ b/nginx-nodejs-redis/web/node_modules/destroy/package.json
@@ -0,0 +1,71 @@
+{
+ "_from": "destroy@~1.0.4",
+ "_id": "destroy@1.0.4",
+ "_inBundle": false,
+ "_integrity": "sha1-l4hXRCxEdJ5CBmE+N5RiBYJqvYA=",
+ "_location": "/destroy",
+ "_phantomChildren": {},
+ "_requested": {
+ "type": "range",
+ "registry": true,
+ "raw": "destroy@~1.0.4",
+ "name": "destroy",
+ "escapedName": "destroy",
+ "rawSpec": "~1.0.4",
+ "saveSpec": null,
+ "fetchSpec": "~1.0.4"
+ },
+ "_requiredBy": [
+ "/send"
+ ],
+ "_resolved": "https://registry.npmjs.org/destroy/-/destroy-1.0.4.tgz",
+ "_shasum": "978857442c44749e4206613e37946205826abd80",
+ "_spec": "destroy@~1.0.4",
+ "_where": "/Users/ajeetraina/projects/13march/awesome-compose/nginx-nodejs-redis/web/node_modules/send",
+ "author": {
+ "name": "Jonathan Ong",
+ "email": "me@jongleberry.com",
+ "url": "http://jongleberry.com"
+ },
+ "bugs": {
+ "url": "https://github.com/stream-utils/destroy/issues"
+ },
+ "bundleDependencies": false,
+ "contributors": [
+ {
+ "name": "Douglas Christopher Wilson",
+ "email": "doug@somethingdoug.com"
+ }
+ ],
+ "deprecated": false,
+ "description": "destroy a stream if possible",
+ "devDependencies": {
+ "istanbul": "0.4.2",
+ "mocha": "2.3.4"
+ },
+ "files": [
+ "index.js",
+ "LICENSE"
+ ],
+ "homepage": "https://github.com/stream-utils/destroy#readme",
+ "keywords": [
+ "stream",
+ "streams",
+ "destroy",
+ "cleanup",
+ "leak",
+ "fd"
+ ],
+ "license": "MIT",
+ "name": "destroy",
+ "repository": {
+ "type": "git",
+ "url": "git+https://github.com/stream-utils/destroy.git"
+ },
+ "scripts": {
+ "test": "mocha --reporter spec",
+ "test-cov": "istanbul cover node_modules/mocha/bin/_mocha -- --reporter dot",
+ "test-travis": "istanbul cover node_modules/mocha/bin/_mocha --report lcovonly -- --reporter dot"
+ },
+ "version": "1.0.4"
+}
diff --git a/nginx-nodejs-redis/web/node_modules/ee-first/LICENSE b/nginx-nodejs-redis/web/node_modules/ee-first/LICENSE
new file mode 100644
index 0000000..a7ae8ee
--- /dev/null
+++ b/nginx-nodejs-redis/web/node_modules/ee-first/LICENSE
@@ -0,0 +1,22 @@
+
+The MIT License (MIT)
+
+Copyright (c) 2014 Jonathan Ong me@jongleberry.com
+
+Permission is hereby granted, free of charge, to any person obtaining a copy
+of this software and associated documentation files (the "Software"), to deal
+in the Software without restriction, including without limitation the rights
+to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
+copies of the Software, and to permit persons to whom the Software is
+furnished to do so, subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in
+all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
+LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
+OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN
+THE SOFTWARE.
diff --git a/nginx-nodejs-redis/web/node_modules/ee-first/README.md b/nginx-nodejs-redis/web/node_modules/ee-first/README.md
new file mode 100644
index 0000000..cbd2478
--- /dev/null
+++ b/nginx-nodejs-redis/web/node_modules/ee-first/README.md
@@ -0,0 +1,80 @@
+# EE First
+
+[![NPM version][npm-image]][npm-url]
+[![Build status][travis-image]][travis-url]
+[![Test coverage][coveralls-image]][coveralls-url]
+[![License][license-image]][license-url]
+[![Downloads][downloads-image]][downloads-url]
+[![Gittip][gittip-image]][gittip-url]
+
+Get the first event in a set of event emitters and event pairs,
+then clean up after itself.
+
+## Install
+
+```sh
+$ npm install ee-first
+```
+
+## API
+
+```js
+var first = require('ee-first')
+```
+
+### first(arr, listener)
+
+Invoke `listener` on the first event from the list specified in `arr`. `arr` is
+an array of arrays, with each array in the format `[ee, ...event]`. `listener`
+will be called only once, the first time any of the given events are emitted. If
+`error` is one of the listened events, then if that fires first, the `listener`
+will be given the `err` argument.
+
+The `listener` is invoked as `listener(err, ee, event, args)`, where `err` is the
+first argument emitted from an `error` event, if applicable; `ee` is the event
+emitter that fired; `event` is the string event name that fired; and `args` is an
+array of the arguments that were emitted on the event.
+
+```js
+var ee1 = new EventEmitter()
+var ee2 = new EventEmitter()
+
+first([
+ [ee1, 'close', 'end', 'error'],
+ [ee2, 'error']
+], function (err, ee, event, args) {
+ // listener invoked
+})
+```
+
+#### .cancel()
+
+The group of listeners can be cancelled before being invoked and have all the event
+listeners removed from the underlying event emitters.
+
+```js
+var thunk = first([
+ [ee1, 'close', 'end', 'error'],
+ [ee2, 'error']
+], function (err, ee, event, args) {
+ // listener invoked
+})
+
+// cancel and clean up
+thunk.cancel()
+```
+
+[npm-image]: https://img.shields.io/npm/v/ee-first.svg?style=flat-square
+[npm-url]: https://npmjs.org/package/ee-first
+[github-tag]: http://img.shields.io/github/tag/jonathanong/ee-first.svg?style=flat-square
+[github-url]: https://github.com/jonathanong/ee-first/tags
+[travis-image]: https://img.shields.io/travis/jonathanong/ee-first.svg?style=flat-square
+[travis-url]: https://travis-ci.org/jonathanong/ee-first
+[coveralls-image]: https://img.shields.io/coveralls/jonathanong/ee-first.svg?style=flat-square
+[coveralls-url]: https://coveralls.io/r/jonathanong/ee-first?branch=master
+[license-image]: http://img.shields.io/npm/l/ee-first.svg?style=flat-square
+[license-url]: LICENSE.md
+[downloads-image]: http://img.shields.io/npm/dm/ee-first.svg?style=flat-square
+[downloads-url]: https://npmjs.org/package/ee-first
+[gittip-image]: https://img.shields.io/gittip/jonathanong.svg?style=flat-square
+[gittip-url]: https://www.gittip.com/jonathanong/
diff --git a/nginx-nodejs-redis/web/node_modules/ee-first/index.js b/nginx-nodejs-redis/web/node_modules/ee-first/index.js
new file mode 100644
index 0000000..501287c
--- /dev/null
+++ b/nginx-nodejs-redis/web/node_modules/ee-first/index.js
@@ -0,0 +1,95 @@
+/*!
+ * ee-first
+ * Copyright(c) 2014 Jonathan Ong
+ * MIT Licensed
+ */
+
+'use strict'
+
+/**
+ * Module exports.
+ * @public
+ */
+
+module.exports = first
+
+/**
+ * Get the first event in a set of event emitters and event pairs.
+ *
+ * @param {array} stuff
+ * @param {function} done
+ * @public
+ */
+
+function first(stuff, done) {
+ if (!Array.isArray(stuff))
+ throw new TypeError('arg must be an array of [ee, events...] arrays')
+
+ var cleanups = []
+
+ for (var i = 0; i < stuff.length; i++) {
+ var arr = stuff[i]
+
+ if (!Array.isArray(arr) || arr.length < 2)
+ throw new TypeError('each array member must be [ee, events...]')
+
+ var ee = arr[0]
+
+ for (var j = 1; j < arr.length; j++) {
+ var event = arr[j]
+ var fn = listener(event, callback)
+
+ // listen to the event
+ ee.on(event, fn)
+ // push this listener to the list of cleanups
+ cleanups.push({
+ ee: ee,
+ event: event,
+ fn: fn,
+ })
+ }
+ }
+
+ function callback() {
+ cleanup()
+ done.apply(null, arguments)
+ }
+
+ function cleanup() {
+ var x
+ for (var i = 0; i < cleanups.length; i++) {
+ x = cleanups[i]
+ x.ee.removeListener(x.event, x.fn)
+ }
+ }
+
+ function thunk(fn) {
+ done = fn
+ }
+
+ thunk.cancel = cleanup
+
+ return thunk
+}
+
+/**
+ * Create the event listener.
+ * @private
+ */
+
+function listener(event, done) {
+ return function onevent(arg1) {
+ var args = new Array(arguments.length)
+ var ee = this
+ var err = event === 'error'
+ ? arg1
+ : null
+
+ // copy args to prevent arguments escaping scope
+ for (var i = 0; i < args.length; i++) {
+ args[i] = arguments[i]
+ }
+
+ done(err, ee, event, args)
+ }
+}
diff --git a/nginx-nodejs-redis/web/node_modules/ee-first/package.json b/nginx-nodejs-redis/web/node_modules/ee-first/package.json
new file mode 100644
index 0000000..d64c707
--- /dev/null
+++ b/nginx-nodejs-redis/web/node_modules/ee-first/package.json
@@ -0,0 +1,63 @@
+{
+ "_from": "ee-first@1.1.1",
+ "_id": "ee-first@1.1.1",
+ "_inBundle": false,
+ "_integrity": "sha1-WQxhFWsK4vTwJVcyoViyZrxWsh0=",
+ "_location": "/ee-first",
+ "_phantomChildren": {},
+ "_requested": {
+ "type": "version",
+ "registry": true,
+ "raw": "ee-first@1.1.1",
+ "name": "ee-first",
+ "escapedName": "ee-first",
+ "rawSpec": "1.1.1",
+ "saveSpec": null,
+ "fetchSpec": "1.1.1"
+ },
+ "_requiredBy": [
+ "/on-finished"
+ ],
+ "_resolved": "https://registry.npmjs.org/ee-first/-/ee-first-1.1.1.tgz",
+ "_shasum": "590c61156b0ae2f4f0255732a158b266bc56b21d",
+ "_spec": "ee-first@1.1.1",
+ "_where": "/Users/ajeetraina/projects/13march/awesome-compose/nginx-nodejs-redis/web/node_modules/on-finished",
+ "author": {
+ "name": "Jonathan Ong",
+ "email": "me@jongleberry.com",
+ "url": "http://jongleberry.com"
+ },
+ "bugs": {
+ "url": "https://github.com/jonathanong/ee-first/issues"
+ },
+ "bundleDependencies": false,
+ "contributors": [
+ {
+ "name": "Douglas Christopher Wilson",
+ "email": "doug@somethingdoug.com"
+ }
+ ],
+ "deprecated": false,
+ "description": "return the first event in a set of ee/event pairs",
+ "devDependencies": {
+ "istanbul": "0.3.9",
+ "mocha": "2.2.5"
+ },
+ "files": [
+ "index.js",
+ "LICENSE"
+ ],
+ "homepage": "https://github.com/jonathanong/ee-first#readme",
+ "license": "MIT",
+ "name": "ee-first",
+ "repository": {
+ "type": "git",
+ "url": "git+https://github.com/jonathanong/ee-first.git"
+ },
+ "scripts": {
+ "test": "mocha --reporter spec --bail --check-leaks test/",
+ "test-cov": "istanbul cover node_modules/mocha/bin/_mocha -- --reporter dot --check-leaks test/",
+ "test-travis": "istanbul cover node_modules/mocha/bin/_mocha --report lcovonly -- --reporter spec --check-leaks test/"
+ },
+ "version": "1.1.1"
+}
diff --git a/nginx-nodejs-redis/web/node_modules/encodeurl/HISTORY.md b/nginx-nodejs-redis/web/node_modules/encodeurl/HISTORY.md
new file mode 100644
index 0000000..41313b2
--- /dev/null
+++ b/nginx-nodejs-redis/web/node_modules/encodeurl/HISTORY.md
@@ -0,0 +1,14 @@
+1.0.2 / 2018-01-21
+==================
+
+ * Fix encoding `%` as last character
+
+1.0.1 / 2016-06-09
+==================
+
+ * Fix encoding unpaired surrogates at start/end of string
+
+1.0.0 / 2016-06-08
+==================
+
+ * Initial release
diff --git a/nginx-nodejs-redis/web/node_modules/encodeurl/LICENSE b/nginx-nodejs-redis/web/node_modules/encodeurl/LICENSE
new file mode 100644
index 0000000..8812229
--- /dev/null
+++ b/nginx-nodejs-redis/web/node_modules/encodeurl/LICENSE
@@ -0,0 +1,22 @@
+(The MIT License)
+
+Copyright (c) 2016 Douglas Christopher Wilson
+
+Permission is hereby granted, free of charge, to any person obtaining
+a copy of this software and associated documentation files (the
+'Software'), to deal in the Software without restriction, including
+without limitation the rights to use, copy, modify, merge, publish,
+distribute, sublicense, and/or sell copies of the Software, and to
+permit persons to whom the Software is furnished to do so, subject to
+the following conditions:
+
+The above copyright notice and this permission notice shall be
+included in all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND,
+EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.
+IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY
+CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT,
+TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE
+SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
diff --git a/nginx-nodejs-redis/web/node_modules/encodeurl/README.md b/nginx-nodejs-redis/web/node_modules/encodeurl/README.md
new file mode 100644
index 0000000..127c5a0
--- /dev/null
+++ b/nginx-nodejs-redis/web/node_modules/encodeurl/README.md
@@ -0,0 +1,128 @@
+# encodeurl
+
+[![NPM Version][npm-image]][npm-url]
+[![NPM Downloads][downloads-image]][downloads-url]
+[![Node.js Version][node-version-image]][node-version-url]
+[![Build Status][travis-image]][travis-url]
+[![Test Coverage][coveralls-image]][coveralls-url]
+
+Encode a URL to a percent-encoded form, excluding already-encoded sequences
+
+## Installation
+
+This is a [Node.js](https://nodejs.org/en/) module available through the
+[npm registry](https://www.npmjs.com/). Installation is done using the
+[`npm install` command](https://docs.npmjs.com/getting-started/installing-npm-packages-locally):
+
+```sh
+$ npm install encodeurl
+```
+
+## API
+
+```js
+var encodeUrl = require('encodeurl')
+```
+
+### encodeUrl(url)
+
+Encode a URL to a percent-encoded form, excluding already-encoded sequences.
+
+This function will take an already-encoded URL and encode all the non-URL
+code points (as UTF-8 byte sequences). This function will not encode the
+"%" character unless it is not part of a valid sequence (`%20` will be
+left as-is, but `%foo` will be encoded as `%25foo`).
+
+This encode is meant to be "safe" and does not throw errors. It will try as
+hard as it can to properly encode the given URL, including replacing any raw,
+unpaired surrogate pairs with the Unicode replacement character prior to
+encoding.
+
+This function is _similar_ to the intrinsic function `encodeURI`, except it
+will not encode the `%` character if that is part of a valid sequence, will
+not encode `[` and `]` (for IPv6 hostnames) and will replace raw, unpaired
+surrogate pairs with the Unicode replacement character (instead of throwing).
+
+## Examples
+
+### Encode a URL containing user-controled data
+
+```js
+var encodeUrl = require('encodeurl')
+var escapeHtml = require('escape-html')
+
+http.createServer(function onRequest (req, res) {
+ // get encoded form of inbound url
+ var url = encodeUrl(req.url)
+
+ // create html message
+ var body = 'Location ' + escapeHtml(url) + ' not found
'
+
+ // send a 404
+ res.statusCode = 404
+ res.setHeader('Content-Type', 'text/html; charset=UTF-8')
+ res.setHeader('Content-Length', String(Buffer.byteLength(body, 'utf-8')))
+ res.end(body, 'utf-8')
+})
+```
+
+### Encode a URL for use in a header field
+
+```js
+var encodeUrl = require('encodeurl')
+var escapeHtml = require('escape-html')
+var url = require('url')
+
+http.createServer(function onRequest (req, res) {
+ // parse inbound url
+ var href = url.parse(req)
+
+ // set new host for redirect
+ href.host = 'localhost'
+ href.protocol = 'https:'
+ href.slashes = true
+
+ // create location header
+ var location = encodeUrl(url.format(href))
+
+ // create html message
+ var body = 'Redirecting to new site: ' + escapeHtml(location) + '
'
+
+ // send a 301
+ res.statusCode = 301
+ res.setHeader('Content-Type', 'text/html; charset=UTF-8')
+ res.setHeader('Content-Length', String(Buffer.byteLength(body, 'utf-8')))
+ res.setHeader('Location', location)
+ res.end(body, 'utf-8')
+})
+```
+
+## Testing
+
+```sh
+$ npm test
+$ npm run lint
+```
+
+## References
+
+- [RFC 3986: Uniform Resource Identifier (URI): Generic Syntax][rfc-3986]
+- [WHATWG URL Living Standard][whatwg-url]
+
+[rfc-3986]: https://tools.ietf.org/html/rfc3986
+[whatwg-url]: https://url.spec.whatwg.org/
+
+## License
+
+[MIT](LICENSE)
+
+[npm-image]: https://img.shields.io/npm/v/encodeurl.svg
+[npm-url]: https://npmjs.org/package/encodeurl
+[node-version-image]: https://img.shields.io/node/v/encodeurl.svg
+[node-version-url]: https://nodejs.org/en/download
+[travis-image]: https://img.shields.io/travis/pillarjs/encodeurl.svg
+[travis-url]: https://travis-ci.org/pillarjs/encodeurl
+[coveralls-image]: https://img.shields.io/coveralls/pillarjs/encodeurl.svg
+[coveralls-url]: https://coveralls.io/r/pillarjs/encodeurl?branch=master
+[downloads-image]: https://img.shields.io/npm/dm/encodeurl.svg
+[downloads-url]: https://npmjs.org/package/encodeurl
diff --git a/nginx-nodejs-redis/web/node_modules/encodeurl/index.js b/nginx-nodejs-redis/web/node_modules/encodeurl/index.js
new file mode 100644
index 0000000..fc4906c
--- /dev/null
+++ b/nginx-nodejs-redis/web/node_modules/encodeurl/index.js
@@ -0,0 +1,60 @@
+/*!
+ * encodeurl
+ * Copyright(c) 2016 Douglas Christopher Wilson
+ * MIT Licensed
+ */
+
+'use strict'
+
+/**
+ * Module exports.
+ * @public
+ */
+
+module.exports = encodeUrl
+
+/**
+ * RegExp to match non-URL code points, *after* encoding (i.e. not including "%")
+ * and including invalid escape sequences.
+ * @private
+ */
+
+var ENCODE_CHARS_REGEXP = /(?:[^\x21\x25\x26-\x3B\x3D\x3F-\x5B\x5D\x5F\x61-\x7A\x7E]|%(?:[^0-9A-Fa-f]|[0-9A-Fa-f][^0-9A-Fa-f]|$))+/g
+
+/**
+ * RegExp to match unmatched surrogate pair.
+ * @private
+ */
+
+var UNMATCHED_SURROGATE_PAIR_REGEXP = /(^|[^\uD800-\uDBFF])[\uDC00-\uDFFF]|[\uD800-\uDBFF]([^\uDC00-\uDFFF]|$)/g
+
+/**
+ * String to replace unmatched surrogate pair with.
+ * @private
+ */
+
+var UNMATCHED_SURROGATE_PAIR_REPLACE = '$1\uFFFD$2'
+
+/**
+ * Encode a URL to a percent-encoded form, excluding already-encoded sequences.
+ *
+ * This function will take an already-encoded URL and encode all the non-URL
+ * code points. This function will not encode the "%" character unless it is
+ * not part of a valid sequence (`%20` will be left as-is, but `%foo` will
+ * be encoded as `%25foo`).
+ *
+ * This encode is meant to be "safe" and does not throw errors. It will try as
+ * hard as it can to properly encode the given URL, including replacing any raw,
+ * unpaired surrogate pairs with the Unicode replacement character prior to
+ * encoding.
+ *
+ * @param {string} url
+ * @return {string}
+ * @public
+ */
+
+function encodeUrl (url) {
+ return String(url)
+ .replace(UNMATCHED_SURROGATE_PAIR_REGEXP, UNMATCHED_SURROGATE_PAIR_REPLACE)
+ .replace(ENCODE_CHARS_REGEXP, encodeURI)
+}
diff --git a/nginx-nodejs-redis/web/node_modules/encodeurl/package.json b/nginx-nodejs-redis/web/node_modules/encodeurl/package.json
new file mode 100644
index 0000000..4f993d0
--- /dev/null
+++ b/nginx-nodejs-redis/web/node_modules/encodeurl/package.json
@@ -0,0 +1,78 @@
+{
+ "_from": "encodeurl@~1.0.2",
+ "_id": "encodeurl@1.0.2",
+ "_inBundle": false,
+ "_integrity": "sha1-rT/0yG7C0CkyL1oCw6mmBslbP1k=",
+ "_location": "/encodeurl",
+ "_phantomChildren": {},
+ "_requested": {
+ "type": "range",
+ "registry": true,
+ "raw": "encodeurl@~1.0.2",
+ "name": "encodeurl",
+ "escapedName": "encodeurl",
+ "rawSpec": "~1.0.2",
+ "saveSpec": null,
+ "fetchSpec": "~1.0.2"
+ },
+ "_requiredBy": [
+ "/express",
+ "/finalhandler",
+ "/send",
+ "/serve-static"
+ ],
+ "_resolved": "https://registry.npmjs.org/encodeurl/-/encodeurl-1.0.2.tgz",
+ "_shasum": "ad3ff4c86ec2d029322f5a02c3a9a606c95b3f59",
+ "_spec": "encodeurl@~1.0.2",
+ "_where": "/Users/ajeetraina/projects/13march/awesome-compose/nginx-nodejs-redis/web/node_modules/express",
+ "bugs": {
+ "url": "https://github.com/pillarjs/encodeurl/issues"
+ },
+ "bundleDependencies": false,
+ "contributors": [
+ {
+ "name": "Douglas Christopher Wilson",
+ "email": "doug@somethingdoug.com"
+ }
+ ],
+ "deprecated": false,
+ "description": "Encode a URL to a percent-encoded form, excluding already-encoded sequences",
+ "devDependencies": {
+ "eslint": "3.19.0",
+ "eslint-config-standard": "10.2.1",
+ "eslint-plugin-import": "2.8.0",
+ "eslint-plugin-node": "5.2.1",
+ "eslint-plugin-promise": "3.6.0",
+ "eslint-plugin-standard": "3.0.1",
+ "istanbul": "0.4.5",
+ "mocha": "2.5.3"
+ },
+ "engines": {
+ "node": ">= 0.8"
+ },
+ "files": [
+ "LICENSE",
+ "HISTORY.md",
+ "README.md",
+ "index.js"
+ ],
+ "homepage": "https://github.com/pillarjs/encodeurl#readme",
+ "keywords": [
+ "encode",
+ "encodeurl",
+ "url"
+ ],
+ "license": "MIT",
+ "name": "encodeurl",
+ "repository": {
+ "type": "git",
+ "url": "git+https://github.com/pillarjs/encodeurl.git"
+ },
+ "scripts": {
+ "lint": "eslint .",
+ "test": "mocha --reporter spec --bail --check-leaks test/",
+ "test-cov": "istanbul cover node_modules/mocha/bin/_mocha -- --reporter dot --check-leaks test/",
+ "test-travis": "istanbul cover node_modules/mocha/bin/_mocha --report lcovonly -- --reporter spec --check-leaks test/"
+ },
+ "version": "1.0.2"
+}
diff --git a/nginx-nodejs-redis/web/node_modules/escape-html/LICENSE b/nginx-nodejs-redis/web/node_modules/escape-html/LICENSE
new file mode 100644
index 0000000..2e70de9
--- /dev/null
+++ b/nginx-nodejs-redis/web/node_modules/escape-html/LICENSE
@@ -0,0 +1,24 @@
+(The MIT License)
+
+Copyright (c) 2012-2013 TJ Holowaychuk
+Copyright (c) 2015 Andreas Lubbe
+Copyright (c) 2015 Tiancheng "Timothy" Gu
+
+Permission is hereby granted, free of charge, to any person obtaining
+a copy of this software and associated documentation files (the
+'Software'), to deal in the Software without restriction, including
+without limitation the rights to use, copy, modify, merge, publish,
+distribute, sublicense, and/or sell copies of the Software, and to
+permit persons to whom the Software is furnished to do so, subject to
+the following conditions:
+
+The above copyright notice and this permission notice shall be
+included in all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND,
+EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.
+IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY
+CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT,
+TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE
+SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
diff --git a/nginx-nodejs-redis/web/node_modules/escape-html/Readme.md b/nginx-nodejs-redis/web/node_modules/escape-html/Readme.md
new file mode 100644
index 0000000..653d9ea
--- /dev/null
+++ b/nginx-nodejs-redis/web/node_modules/escape-html/Readme.md
@@ -0,0 +1,43 @@
+
+# escape-html
+
+ Escape string for use in HTML
+
+## Example
+
+```js
+var escape = require('escape-html');
+var html = escape('foo & bar');
+// -> foo & bar
+```
+
+## Benchmark
+
+```
+$ npm run-script bench
+
+> escape-html@1.0.3 bench nodejs-escape-html
+> node benchmark/index.js
+
+
+ http_parser@1.0
+ node@0.10.33
+ v8@3.14.5.9
+ ares@1.9.0-DEV
+ uv@0.10.29
+ zlib@1.2.3
+ modules@11
+ openssl@1.0.1j
+
+ 1 test completed.
+ 2 tests completed.
+ 3 tests completed.
+
+ no special characters x 19,435,271 ops/sec ±0.85% (187 runs sampled)
+ single special character x 6,132,421 ops/sec ±0.67% (194 runs sampled)
+ many special characters x 3,175,826 ops/sec ±0.65% (193 runs sampled)
+```
+
+## License
+
+ MIT
\ No newline at end of file
diff --git a/nginx-nodejs-redis/web/node_modules/escape-html/index.js b/nginx-nodejs-redis/web/node_modules/escape-html/index.js
new file mode 100644
index 0000000..bf9e226
--- /dev/null
+++ b/nginx-nodejs-redis/web/node_modules/escape-html/index.js
@@ -0,0 +1,78 @@
+/*!
+ * escape-html
+ * Copyright(c) 2012-2013 TJ Holowaychuk
+ * Copyright(c) 2015 Andreas Lubbe
+ * Copyright(c) 2015 Tiancheng "Timothy" Gu
+ * MIT Licensed
+ */
+
+'use strict';
+
+/**
+ * Module variables.
+ * @private
+ */
+
+var matchHtmlRegExp = /["'&<>]/;
+
+/**
+ * Module exports.
+ * @public
+ */
+
+module.exports = escapeHtml;
+
+/**
+ * Escape special characters in the given string of html.
+ *
+ * @param {string} string The string to escape for inserting into HTML
+ * @return {string}
+ * @public
+ */
+
+function escapeHtml(string) {
+ var str = '' + string;
+ var match = matchHtmlRegExp.exec(str);
+
+ if (!match) {
+ return str;
+ }
+
+ var escape;
+ var html = '';
+ var index = 0;
+ var lastIndex = 0;
+
+ for (index = match.index; index < str.length; index++) {
+ switch (str.charCodeAt(index)) {
+ case 34: // "
+ escape = '"';
+ break;
+ case 38: // &
+ escape = '&';
+ break;
+ case 39: // '
+ escape = ''';
+ break;
+ case 60: // <
+ escape = '<';
+ break;
+ case 62: // >
+ escape = '>';
+ break;
+ default:
+ continue;
+ }
+
+ if (lastIndex !== index) {
+ html += str.substring(lastIndex, index);
+ }
+
+ lastIndex = index + 1;
+ html += escape;
+ }
+
+ return lastIndex !== index
+ ? html + str.substring(lastIndex, index)
+ : html;
+}
diff --git a/nginx-nodejs-redis/web/node_modules/escape-html/package.json b/nginx-nodejs-redis/web/node_modules/escape-html/package.json
new file mode 100644
index 0000000..79687d2
--- /dev/null
+++ b/nginx-nodejs-redis/web/node_modules/escape-html/package.json
@@ -0,0 +1,59 @@
+{
+ "_from": "escape-html@~1.0.3",
+ "_id": "escape-html@1.0.3",
+ "_inBundle": false,
+ "_integrity": "sha1-Aljq5NPQwJdN4cFpGI7wBR0dGYg=",
+ "_location": "/escape-html",
+ "_phantomChildren": {},
+ "_requested": {
+ "type": "range",
+ "registry": true,
+ "raw": "escape-html@~1.0.3",
+ "name": "escape-html",
+ "escapedName": "escape-html",
+ "rawSpec": "~1.0.3",
+ "saveSpec": null,
+ "fetchSpec": "~1.0.3"
+ },
+ "_requiredBy": [
+ "/express",
+ "/finalhandler",
+ "/send",
+ "/serve-static"
+ ],
+ "_resolved": "https://registry.npmjs.org/escape-html/-/escape-html-1.0.3.tgz",
+ "_shasum": "0258eae4d3d0c0974de1c169188ef0051d1d1988",
+ "_spec": "escape-html@~1.0.3",
+ "_where": "/Users/ajeetraina/projects/13march/awesome-compose/nginx-nodejs-redis/web/node_modules/express",
+ "bugs": {
+ "url": "https://github.com/component/escape-html/issues"
+ },
+ "bundleDependencies": false,
+ "deprecated": false,
+ "description": "Escape string for use in HTML",
+ "devDependencies": {
+ "beautify-benchmark": "0.2.4",
+ "benchmark": "1.0.0"
+ },
+ "files": [
+ "LICENSE",
+ "Readme.md",
+ "index.js"
+ ],
+ "homepage": "https://github.com/component/escape-html#readme",
+ "keywords": [
+ "escape",
+ "html",
+ "utility"
+ ],
+ "license": "MIT",
+ "name": "escape-html",
+ "repository": {
+ "type": "git",
+ "url": "git+https://github.com/component/escape-html.git"
+ },
+ "scripts": {
+ "bench": "node benchmark/index.js"
+ },
+ "version": "1.0.3"
+}
diff --git a/nginx-nodejs-redis/web/node_modules/etag/HISTORY.md b/nginx-nodejs-redis/web/node_modules/etag/HISTORY.md
new file mode 100644
index 0000000..222b293
--- /dev/null
+++ b/nginx-nodejs-redis/web/node_modules/etag/HISTORY.md
@@ -0,0 +1,83 @@
+1.8.1 / 2017-09-12
+==================
+
+ * perf: replace regular expression with substring
+
+1.8.0 / 2017-02-18
+==================
+
+ * Use SHA1 instead of MD5 for ETag hashing
+ - Improves performance for larger entities
+ - Works with FIPS 140-2 OpenSSL configuration
+
+1.7.0 / 2015-06-08
+==================
+
+ * Always include entity length in ETags for hash length extensions
+ * Generate non-Stats ETags using MD5 only (no longer CRC32)
+ * Improve stat performance by removing hashing
+ * Remove base64 padding in ETags to shorten
+ * Use MD5 instead of MD4 in weak ETags over 1KB
+
+1.6.0 / 2015-05-10
+==================
+
+ * Improve support for JXcore
+ * Remove requirement of `atime` in the stats object
+ * Support "fake" stats objects in environments without `fs`
+
+1.5.1 / 2014-11-19
+==================
+
+ * deps: crc@3.2.1
+ - Minor fixes
+
+1.5.0 / 2014-10-14
+==================
+
+ * Improve string performance
+ * Slightly improve speed for weak ETags over 1KB
+
+1.4.0 / 2014-09-21
+==================
+
+ * Support "fake" stats objects
+ * Support Node.js 0.6
+
+1.3.1 / 2014-09-14
+==================
+
+ * Use the (new and improved) `crc` for crc32
+
+1.3.0 / 2014-08-29
+==================
+
+ * Default strings to strong ETags
+ * Improve speed for weak ETags over 1KB
+
+1.2.1 / 2014-08-29
+==================
+
+ * Use the (much faster) `buffer-crc32` for crc32
+
+1.2.0 / 2014-08-24
+==================
+
+ * Add support for file stat objects
+
+1.1.0 / 2014-08-24
+==================
+
+ * Add fast-path for empty entity
+ * Add weak ETag generation
+ * Shrink size of generated ETags
+
+1.0.1 / 2014-08-24
+==================
+
+ * Fix behavior of string containing Unicode
+
+1.0.0 / 2014-05-18
+==================
+
+ * Initial release
diff --git a/nginx-nodejs-redis/web/node_modules/etag/LICENSE b/nginx-nodejs-redis/web/node_modules/etag/LICENSE
new file mode 100644
index 0000000..cab251c
--- /dev/null
+++ b/nginx-nodejs-redis/web/node_modules/etag/LICENSE
@@ -0,0 +1,22 @@
+(The MIT License)
+
+Copyright (c) 2014-2016 Douglas Christopher Wilson
+
+Permission is hereby granted, free of charge, to any person obtaining
+a copy of this software and associated documentation files (the
+'Software'), to deal in the Software without restriction, including
+without limitation the rights to use, copy, modify, merge, publish,
+distribute, sublicense, and/or sell copies of the Software, and to
+permit persons to whom the Software is furnished to do so, subject to
+the following conditions:
+
+The above copyright notice and this permission notice shall be
+included in all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND,
+EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.
+IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY
+CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT,
+TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE
+SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
diff --git a/nginx-nodejs-redis/web/node_modules/etag/README.md b/nginx-nodejs-redis/web/node_modules/etag/README.md
new file mode 100644
index 0000000..09c2169
--- /dev/null
+++ b/nginx-nodejs-redis/web/node_modules/etag/README.md
@@ -0,0 +1,159 @@
+# etag
+
+[![NPM Version][npm-image]][npm-url]
+[![NPM Downloads][downloads-image]][downloads-url]
+[![Node.js Version][node-version-image]][node-version-url]
+[![Build Status][travis-image]][travis-url]
+[![Test Coverage][coveralls-image]][coveralls-url]
+
+Create simple HTTP ETags
+
+This module generates HTTP ETags (as defined in RFC 7232) for use in
+HTTP responses.
+
+## Installation
+
+This is a [Node.js](https://nodejs.org/en/) module available through the
+[npm registry](https://www.npmjs.com/). Installation is done using the
+[`npm install` command](https://docs.npmjs.com/getting-started/installing-npm-packages-locally):
+
+```sh
+$ npm install etag
+```
+
+## API
+
+
+
+```js
+var etag = require('etag')
+```
+
+### etag(entity, [options])
+
+Generate a strong ETag for the given entity. This should be the complete
+body of the entity. Strings, `Buffer`s, and `fs.Stats` are accepted. By
+default, a strong ETag is generated except for `fs.Stats`, which will
+generate a weak ETag (this can be overwritten by `options.weak`).
+
+
+
+```js
+res.setHeader('ETag', etag(body))
+```
+
+#### Options
+
+`etag` accepts these properties in the options object.
+
+##### weak
+
+Specifies if the generated ETag will include the weak validator mark (that
+is, the leading `W/`). The actual entity tag is the same. The default value
+is `false`, unless the `entity` is `fs.Stats`, in which case it is `true`.
+
+## Testing
+
+```sh
+$ npm test
+```
+
+## Benchmark
+
+```bash
+$ npm run-script bench
+
+> etag@1.8.1 bench nodejs-etag
+> node benchmark/index.js
+
+ http_parser@2.7.0
+ node@6.11.1
+ v8@5.1.281.103
+ uv@1.11.0
+ zlib@1.2.11
+ ares@1.10.1-DEV
+ icu@58.2
+ modules@48
+ openssl@1.0.2k
+
+> node benchmark/body0-100b.js
+
+ 100B body
+
+ 4 tests completed.
+
+ buffer - strong x 258,647 ops/sec ±1.07% (180 runs sampled)
+ buffer - weak x 263,812 ops/sec ±0.61% (184 runs sampled)
+ string - strong x 259,955 ops/sec ±1.19% (185 runs sampled)
+ string - weak x 264,356 ops/sec ±1.09% (184 runs sampled)
+
+> node benchmark/body1-1kb.js
+
+ 1KB body
+
+ 4 tests completed.
+
+ buffer - strong x 189,018 ops/sec ±1.12% (182 runs sampled)
+ buffer - weak x 190,586 ops/sec ±0.81% (186 runs sampled)
+ string - strong x 144,272 ops/sec ±0.96% (188 runs sampled)
+ string - weak x 145,380 ops/sec ±1.43% (187 runs sampled)
+
+> node benchmark/body2-5kb.js
+
+ 5KB body
+
+ 4 tests completed.
+
+ buffer - strong x 92,435 ops/sec ±0.42% (188 runs sampled)
+ buffer - weak x 92,373 ops/sec ±0.58% (189 runs sampled)
+ string - strong x 48,850 ops/sec ±0.56% (186 runs sampled)
+ string - weak x 49,380 ops/sec ±0.56% (190 runs sampled)
+
+> node benchmark/body3-10kb.js
+
+ 10KB body
+
+ 4 tests completed.
+
+ buffer - strong x 55,989 ops/sec ±0.93% (188 runs sampled)
+ buffer - weak x 56,148 ops/sec ±0.55% (190 runs sampled)
+ string - strong x 27,345 ops/sec ±0.43% (188 runs sampled)
+ string - weak x 27,496 ops/sec ±0.45% (190 runs sampled)
+
+> node benchmark/body4-100kb.js
+
+ 100KB body
+
+ 4 tests completed.
+
+ buffer - strong x 7,083 ops/sec ±0.22% (190 runs sampled)
+ buffer - weak x 7,115 ops/sec ±0.26% (191 runs sampled)
+ string - strong x 3,068 ops/sec ±0.34% (190 runs sampled)
+ string - weak x 3,096 ops/sec ±0.35% (190 runs sampled)
+
+> node benchmark/stats.js
+
+ stat
+
+ 4 tests completed.
+
+ real - strong x 871,642 ops/sec ±0.34% (189 runs sampled)
+ real - weak x 867,613 ops/sec ±0.39% (190 runs sampled)
+ fake - strong x 401,051 ops/sec ±0.40% (189 runs sampled)
+ fake - weak x 400,100 ops/sec ±0.47% (188 runs sampled)
+```
+
+## License
+
+[MIT](LICENSE)
+
+[npm-image]: https://img.shields.io/npm/v/etag.svg
+[npm-url]: https://npmjs.org/package/etag
+[node-version-image]: https://img.shields.io/node/v/etag.svg
+[node-version-url]: https://nodejs.org/en/download/
+[travis-image]: https://img.shields.io/travis/jshttp/etag/master.svg
+[travis-url]: https://travis-ci.org/jshttp/etag
+[coveralls-image]: https://img.shields.io/coveralls/jshttp/etag/master.svg
+[coveralls-url]: https://coveralls.io/r/jshttp/etag?branch=master
+[downloads-image]: https://img.shields.io/npm/dm/etag.svg
+[downloads-url]: https://npmjs.org/package/etag
diff --git a/nginx-nodejs-redis/web/node_modules/etag/index.js b/nginx-nodejs-redis/web/node_modules/etag/index.js
new file mode 100644
index 0000000..2a585c9
--- /dev/null
+++ b/nginx-nodejs-redis/web/node_modules/etag/index.js
@@ -0,0 +1,131 @@
+/*!
+ * etag
+ * Copyright(c) 2014-2016 Douglas Christopher Wilson
+ * MIT Licensed
+ */
+
+'use strict'
+
+/**
+ * Module exports.
+ * @public
+ */
+
+module.exports = etag
+
+/**
+ * Module dependencies.
+ * @private
+ */
+
+var crypto = require('crypto')
+var Stats = require('fs').Stats
+
+/**
+ * Module variables.
+ * @private
+ */
+
+var toString = Object.prototype.toString
+
+/**
+ * Generate an entity tag.
+ *
+ * @param {Buffer|string} entity
+ * @return {string}
+ * @private
+ */
+
+function entitytag (entity) {
+ if (entity.length === 0) {
+ // fast-path empty
+ return '"0-2jmj7l5rSw0yVb/vlWAYkK/YBwk"'
+ }
+
+ // compute hash of entity
+ var hash = crypto
+ .createHash('sha1')
+ .update(entity, 'utf8')
+ .digest('base64')
+ .substring(0, 27)
+
+ // compute length of entity
+ var len = typeof entity === 'string'
+ ? Buffer.byteLength(entity, 'utf8')
+ : entity.length
+
+ return '"' + len.toString(16) + '-' + hash + '"'
+}
+
+/**
+ * Create a simple ETag.
+ *
+ * @param {string|Buffer|Stats} entity
+ * @param {object} [options]
+ * @param {boolean} [options.weak]
+ * @return {String}
+ * @public
+ */
+
+function etag (entity, options) {
+ if (entity == null) {
+ throw new TypeError('argument entity is required')
+ }
+
+ // support fs.Stats object
+ var isStats = isstats(entity)
+ var weak = options && typeof options.weak === 'boolean'
+ ? options.weak
+ : isStats
+
+ // validate argument
+ if (!isStats && typeof entity !== 'string' && !Buffer.isBuffer(entity)) {
+ throw new TypeError('argument entity must be string, Buffer, or fs.Stats')
+ }
+
+ // generate entity tag
+ var tag = isStats
+ ? stattag(entity)
+ : entitytag(entity)
+
+ return weak
+ ? 'W/' + tag
+ : tag
+}
+
+/**
+ * Determine if object is a Stats object.
+ *
+ * @param {object} obj
+ * @return {boolean}
+ * @api private
+ */
+
+function isstats (obj) {
+ // genuine fs.Stats
+ if (typeof Stats === 'function' && obj instanceof Stats) {
+ return true
+ }
+
+ // quack quack
+ return obj && typeof obj === 'object' &&
+ 'ctime' in obj && toString.call(obj.ctime) === '[object Date]' &&
+ 'mtime' in obj && toString.call(obj.mtime) === '[object Date]' &&
+ 'ino' in obj && typeof obj.ino === 'number' &&
+ 'size' in obj && typeof obj.size === 'number'
+}
+
+/**
+ * Generate a tag for a stat.
+ *
+ * @param {object} stat
+ * @return {string}
+ * @private
+ */
+
+function stattag (stat) {
+ var mtime = stat.mtime.getTime().toString(16)
+ var size = stat.size.toString(16)
+
+ return '"' + size + '-' + mtime + '"'
+}
diff --git a/nginx-nodejs-redis/web/node_modules/etag/package.json b/nginx-nodejs-redis/web/node_modules/etag/package.json
new file mode 100644
index 0000000..942a7d3
--- /dev/null
+++ b/nginx-nodejs-redis/web/node_modules/etag/package.json
@@ -0,0 +1,86 @@
+{
+ "_from": "etag@~1.8.1",
+ "_id": "etag@1.8.1",
+ "_inBundle": false,
+ "_integrity": "sha1-Qa4u62XvpiJorr/qg6x9eSmbCIc=",
+ "_location": "/etag",
+ "_phantomChildren": {},
+ "_requested": {
+ "type": "range",
+ "registry": true,
+ "raw": "etag@~1.8.1",
+ "name": "etag",
+ "escapedName": "etag",
+ "rawSpec": "~1.8.1",
+ "saveSpec": null,
+ "fetchSpec": "~1.8.1"
+ },
+ "_requiredBy": [
+ "/express",
+ "/send"
+ ],
+ "_resolved": "https://registry.npmjs.org/etag/-/etag-1.8.1.tgz",
+ "_shasum": "41ae2eeb65efa62268aebfea83ac7d79299b0887",
+ "_spec": "etag@~1.8.1",
+ "_where": "/Users/ajeetraina/projects/13march/awesome-compose/nginx-nodejs-redis/web/node_modules/express",
+ "bugs": {
+ "url": "https://github.com/jshttp/etag/issues"
+ },
+ "bundleDependencies": false,
+ "contributors": [
+ {
+ "name": "Douglas Christopher Wilson",
+ "email": "doug@somethingdoug.com"
+ },
+ {
+ "name": "David Björklund",
+ "email": "david.bjorklund@gmail.com"
+ }
+ ],
+ "deprecated": false,
+ "description": "Create simple HTTP ETags",
+ "devDependencies": {
+ "beautify-benchmark": "0.2.4",
+ "benchmark": "2.1.4",
+ "eslint": "3.19.0",
+ "eslint-config-standard": "10.2.1",
+ "eslint-plugin-import": "2.7.0",
+ "eslint-plugin-markdown": "1.0.0-beta.6",
+ "eslint-plugin-node": "5.1.1",
+ "eslint-plugin-promise": "3.5.0",
+ "eslint-plugin-standard": "3.0.1",
+ "istanbul": "0.4.5",
+ "mocha": "1.21.5",
+ "safe-buffer": "5.1.1",
+ "seedrandom": "2.4.3"
+ },
+ "engines": {
+ "node": ">= 0.6"
+ },
+ "files": [
+ "LICENSE",
+ "HISTORY.md",
+ "README.md",
+ "index.js"
+ ],
+ "homepage": "https://github.com/jshttp/etag#readme",
+ "keywords": [
+ "etag",
+ "http",
+ "res"
+ ],
+ "license": "MIT",
+ "name": "etag",
+ "repository": {
+ "type": "git",
+ "url": "git+https://github.com/jshttp/etag.git"
+ },
+ "scripts": {
+ "bench": "node benchmark/index.js",
+ "lint": "eslint --plugin markdown --ext js,md .",
+ "test": "mocha --reporter spec --bail --check-leaks test/",
+ "test-cov": "istanbul cover node_modules/mocha/bin/_mocha -- --reporter dot --check-leaks test/",
+ "test-travis": "istanbul cover node_modules/mocha/bin/_mocha --report lcovonly -- --reporter spec --check-leaks test/"
+ },
+ "version": "1.8.1"
+}
diff --git a/nginx-nodejs-redis/web/node_modules/express/History.md b/nginx-nodejs-redis/web/node_modules/express/History.md
new file mode 100644
index 0000000..9f3f876
--- /dev/null
+++ b/nginx-nodejs-redis/web/node_modules/express/History.md
@@ -0,0 +1,3525 @@
+4.17.3 / 2022-02-16
+===================
+
+ * deps: accepts@~1.3.8
+ - deps: mime-types@~2.1.34
+ - deps: negotiator@0.6.3
+ * deps: body-parser@1.19.2
+ - deps: bytes@3.1.2
+ - deps: qs@6.9.7
+ - deps: raw-body@2.4.3
+ * deps: cookie@0.4.2
+ * deps: qs@6.9.7
+ * Fix handling of `__proto__` keys
+ * pref: remove unnecessary regexp for trust proxy
+
+4.17.2 / 2021-12-16
+===================
+
+ * Fix handling of `undefined` in `res.jsonp`
+ * Fix handling of `undefined` when `"json escape"` is enabled
+ * Fix incorrect middleware execution with unanchored `RegExp`s
+ * Fix `res.jsonp(obj, status)` deprecation message
+ * Fix typo in `res.is` JSDoc
+ * deps: body-parser@1.19.1
+ - deps: bytes@3.1.1
+ - deps: http-errors@1.8.1
+ - deps: qs@6.9.6
+ - deps: raw-body@2.4.2
+ - deps: safe-buffer@5.2.1
+ - deps: type-is@~1.6.18
+ * deps: content-disposition@0.5.4
+ - deps: safe-buffer@5.2.1
+ * deps: cookie@0.4.1
+ - Fix `maxAge` option to reject invalid values
+ * deps: proxy-addr@~2.0.7
+ - Use `req.socket` over deprecated `req.connection`
+ - deps: forwarded@0.2.0
+ - deps: ipaddr.js@1.9.1
+ * deps: qs@6.9.6
+ * deps: safe-buffer@5.2.1
+ * deps: send@0.17.2
+ - deps: http-errors@1.8.1
+ - deps: ms@2.1.3
+ - pref: ignore empty http tokens
+ * deps: serve-static@1.14.2
+ - deps: send@0.17.2
+ * deps: setprototypeof@1.2.0
+
+4.17.1 / 2019-05-25
+===================
+
+ * Revert "Improve error message for `null`/`undefined` to `res.status`"
+
+4.17.0 / 2019-05-16
+===================
+
+ * Add `express.raw` to parse bodies into `Buffer`
+ * Add `express.text` to parse bodies into string
+ * Improve error message for non-strings to `res.sendFile`
+ * Improve error message for `null`/`undefined` to `res.status`
+ * Support multiple hosts in `X-Forwarded-Host`
+ * deps: accepts@~1.3.7
+ * deps: body-parser@1.19.0
+ - Add encoding MIK
+ - Add petabyte (`pb`) support
+ - Fix parsing array brackets after index
+ - deps: bytes@3.1.0
+ - deps: http-errors@1.7.2
+ - deps: iconv-lite@0.4.24
+ - deps: qs@6.7.0
+ - deps: raw-body@2.4.0
+ - deps: type-is@~1.6.17
+ * deps: content-disposition@0.5.3
+ * deps: cookie@0.4.0
+ - Add `SameSite=None` support
+ * deps: finalhandler@~1.1.2
+ - Set stricter `Content-Security-Policy` header
+ - deps: parseurl@~1.3.3
+ - deps: statuses@~1.5.0
+ * deps: parseurl@~1.3.3
+ * deps: proxy-addr@~2.0.5
+ - deps: ipaddr.js@1.9.0
+ * deps: qs@6.7.0
+ - Fix parsing array brackets after index
+ * deps: range-parser@~1.2.1
+ * deps: send@0.17.1
+ - Set stricter CSP header in redirect & error responses
+ - deps: http-errors@~1.7.2
+ - deps: mime@1.6.0
+ - deps: ms@2.1.1
+ - deps: range-parser@~1.2.1
+ - deps: statuses@~1.5.0
+ - perf: remove redundant `path.normalize` call
+ * deps: serve-static@1.14.1
+ - Set stricter CSP header in redirect response
+ - deps: parseurl@~1.3.3
+ - deps: send@0.17.1
+ * deps: setprototypeof@1.1.1
+ * deps: statuses@~1.5.0
+ - Add `103 Early Hints`
+ * deps: type-is@~1.6.18
+ - deps: mime-types@~2.1.24
+ - perf: prevent internal `throw` on invalid type
+
+4.16.4 / 2018-10-10
+===================
+
+ * Fix issue where `"Request aborted"` may be logged in `res.sendfile`
+ * Fix JSDoc for `Router` constructor
+ * deps: body-parser@1.18.3
+ - Fix deprecation warnings on Node.js 10+
+ - Fix stack trace for strict json parse error
+ - deps: depd@~1.1.2
+ - deps: http-errors@~1.6.3
+ - deps: iconv-lite@0.4.23
+ - deps: qs@6.5.2
+ - deps: raw-body@2.3.3
+ - deps: type-is@~1.6.16
+ * deps: proxy-addr@~2.0.4
+ - deps: ipaddr.js@1.8.0
+ * deps: qs@6.5.2
+ * deps: safe-buffer@5.1.2
+
+4.16.3 / 2018-03-12
+===================
+
+ * deps: accepts@~1.3.5
+ - deps: mime-types@~2.1.18
+ * deps: depd@~1.1.2
+ - perf: remove argument reassignment
+ * deps: encodeurl@~1.0.2
+ - Fix encoding `%` as last character
+ * deps: finalhandler@1.1.1
+ - Fix 404 output for bad / missing pathnames
+ - deps: encodeurl@~1.0.2
+ - deps: statuses@~1.4.0
+ * deps: proxy-addr@~2.0.3
+ - deps: ipaddr.js@1.6.0
+ * deps: send@0.16.2
+ - Fix incorrect end tag in default error & redirects
+ - deps: depd@~1.1.2
+ - deps: encodeurl@~1.0.2
+ - deps: statuses@~1.4.0
+ * deps: serve-static@1.13.2
+ - Fix incorrect end tag in redirects
+ - deps: encodeurl@~1.0.2
+ - deps: send@0.16.2
+ * deps: statuses@~1.4.0
+ * deps: type-is@~1.6.16
+ - deps: mime-types@~2.1.18
+
+4.16.2 / 2017-10-09
+===================
+
+ * Fix `TypeError` in `res.send` when given `Buffer` and `ETag` header set
+ * perf: skip parsing of entire `X-Forwarded-Proto` header
+
+4.16.1 / 2017-09-29
+===================
+
+ * deps: send@0.16.1
+ * deps: serve-static@1.13.1
+ - Fix regression when `root` is incorrectly set to a file
+ - deps: send@0.16.1
+
+4.16.0 / 2017-09-28
+===================
+
+ * Add `"json escape"` setting for `res.json` and `res.jsonp`
+ * Add `express.json` and `express.urlencoded` to parse bodies
+ * Add `options` argument to `res.download`
+ * Improve error message when autoloading invalid view engine
+ * Improve error messages when non-function provided as middleware
+ * Skip `Buffer` encoding when not generating ETag for small response
+ * Use `safe-buffer` for improved Buffer API
+ * deps: accepts@~1.3.4
+ - deps: mime-types@~2.1.16
+ * deps: content-type@~1.0.4
+ - perf: remove argument reassignment
+ - perf: skip parameter parsing when no parameters
+ * deps: etag@~1.8.1
+ - perf: replace regular expression with substring
+ * deps: finalhandler@1.1.0
+ - Use `res.headersSent` when available
+ * deps: parseurl@~1.3.2
+ - perf: reduce overhead for full URLs
+ - perf: unroll the "fast-path" `RegExp`
+ * deps: proxy-addr@~2.0.2
+ - Fix trimming leading / trailing OWS in `X-Forwarded-For`
+ - deps: forwarded@~0.1.2
+ - deps: ipaddr.js@1.5.2
+ - perf: reduce overhead when no `X-Forwarded-For` header
+ * deps: qs@6.5.1
+ - Fix parsing & compacting very deep objects
+ * deps: send@0.16.0
+ - Add 70 new types for file extensions
+ - Add `immutable` option
+ - Fix missing `